1

ANALISA ANION
Penyelidikan anion-anion dapat dilakukan menggunakan : 1. larutan asal atau zat padat asal misal: CO32-; Asetat; S2-; borat 2. dari larutan ekstrak soda (E.S) Penggolongan Anion Anion dibagi menjadi 6 golongan : 1. Anion yang ditambah dengan asam encer menghasilkan gas Misal: CO32- ; SO32- ; S2-; S2O32-; HCO3-; HSO3- ; CN-; NO2- ; CN- ; Ac2. Anion- anion golongan oksidator Misal: Fe(CN)6 IO3NO3 3-

CLO3AsO43NO2-

MnO4Cr2O72-

CrO42BrO3-

3. Anion-anion golongan reduktor Misal: SO32S2O32SCN Br3AsO3 Fe(CN)64-

S2INO2-

CNClPO33-

4. Anion-anion golongan AgNO3 a. Anion-anion yang mengendap dalam suasana asam (HNO3 encer)
Misal ClCNS2O32Misal : BrFe(CN)64IO3IFe(CN)63SCNS2-

b. Anion-anion yang mengendap setelah direduksi dengan NaNO2  
BrO3- direduksi menjadi BrClO3- direduksi menjadi Cl-

c. Anion-anion yang mengendap dalam suasana netral Misal: PO43- ; HPO42- ; AsO43- ; AsO33- ; C2O42- ; CrO42-

5. Anion –anion golongan BaCl2
5.1. Anion yang mengendap dalam suasana asam (HCl) Misal :  SO42 S2O82- direduksi dalam HCl menjadi SO42-

Anion anion membentuk warna dalam suasana asam lemah Misal : Fe(CN)64. ReaksiPenetapan I REAKSI PENDAHULUAN Dalam reaksipendahuluan dapat digunakan :  Zat padat asli  Larutan zat asli dalam air Reaksi pendahuluan meliputi antara lain : a. Reaksi Pendahuluan 2. Reaksi Penggolongan 3.2 5. Anion-anion yang dapat membentuk warna dengan FeCl3 a. Ac- b.. Anion mengendap dalam suasana asam setelah dioksidasi dengan Br2 adau I2 Misal : o SO32Diubah menjadi SO422o S2O8 5. Anion yang mengendap dalam suasana netral Misal: PO43C2O42AsO33PO33FAsO43CrO42BO33- 6. Fe(CN)63... Reaksi nyala api (untuk melihat halogen) Cara : o Garam (halogen) → logam halida yang mudah menguap (hijau) Percobaan : Beilstein ( menggunakan kawat Cu/CuO) Cara:  CuO + halogen → Cu halida ( nyala hijau) . SCN.3.membentuk warna biru CrO42membentuk warna hijau dari garam Cr3+ PELAKSANAAN ANALISA ANION Pelaksanaan analisa anion seperti halnya kation dilakukan dalam 3 tahap yakni: 1. Membentuk warna yang kadang kadang dipertegas dengan FeSO4 Misal :   Fe(CN)63.2.

Zat asli ditambah dengan asam sulfat 2N akan membentuk gas Yang bemberikan tes positif adalah:   CaCO3 + H2SO4 Na2SO3 + H2SO4 CaSO4 + CO2 + H2O Na2SO4 + SO2 + H2O Selanjutnya gas yang timbul diselidiki menggunakan pereaksi yang khas c.3 Yang bemberikan tes positif adalah: ClBrO3SCNBrIO3Fe(CN)64ClO3CNFe(CN)63- Reaksi ini diganggu oleh : Ba2+ dan BO33b... SO32. Borat (BO33-) Asetat:   Borat: zat padat + H2SO4 p CH3COOH + SO42bau cuka CH3COOK + HSO4bau cuka Zat + KHSO4  Zat padat + H2SO4p + methanol/etanol → nyala hijau H2SO4p Reaksi:  H3BO3 + CH3OH Menarik air B(OCH3) + H2O nyala hijau Reaksi ini diganggu oleh : Cu2+ dan Ba2+ d. Zat diselidiki dalam bentuk padatannya Misal : Asetat ( CH3COO-) . S2O32.dan SCNCara : reaksi redoks   Zat + Zn + H2SO4 2N → gas Hn Bau telur busuk Gas Hn+ zat H2S + Pb(Ac)2 → PbS Hitam . Penyelidikan anion-anion seperti : S2.

+ H+ → H2SO3 H2S + 3H2O H2S2O3 + 6Hn → H2S + 3H2O + S Kuning HSCN + 2Hn → H2S + HCN Beberapa anion yang ditemukan dalam penggolongankation adalah:      CrO42Cr2O72MnO4AsO33AsO43- + H2S → reaksi redoks II REAKSI PENGGOLONGAN Untuk keperluan reaksi penggolongan anion-anion zat yang digunakan dalam bentuk larutan .S) Cara : Zat + Na2CO3 → garam CO3 + Na anion (endapan) (filtrat) Anion dianalisa dari filtrat sedangkan kation dianalisa dari residu larutan E. maka :  bila zatnya larut dalam air maka dilarutkan dalam akuades  bila zatnya tidak larut dalam air maka dibuat ekstrak soda (E.+ 2H+ → H2SO3 + 6Hn → S2O32.+ 2H+ → SCN.+ 2H+ → H2S + Pb(Ac)2 → PbS + AcHitam SO32.S 1. Golongan anion-anion yang dengan asam menimbulkan gas Cara:  Selidiki dari zat padat/larutan asli dalam air .4 Pb asetat Zat + Zn + H2SO4 2N Reaksi :      S2.

Anion-anion jika ditambah H2SO4 encer mengeluarkan gas adalah:        Karbonat Sulfit Asetat Tiosulfat Sulfida Asetat nitrit b.5   Selidiki zat dari suspensi air Zat yang diselidiki tidak boleh dari E. maka warna KmnO4 setelah reduksi tidak hilang Anion yang memberikan reaksi positif dalam keadaan dingin adalah: S2O32IGrm Fe2+ S2Br\ SO32SCNH2O2  NO2AsO33- CNFe(CN)64- Anion anion yang memberikan reaksi positif dalam keadaan panas adalah:  Oksalat . Anion-anion dengan asam sulfat pekat menimbulkan gas adalah:  Oksalat  Klorida  Bromida’iodida  Nitrat  Klorat (ClO3-) 2. Anion-anion golongan oksidator Zat + difenil amin + H2SO4p → difenilbensidin (biru) Zat oksidator pada konsentrasi rendah.02N) Jika konsentrasi KmnO4 pekat.S karena mengandung garam karbonat a. jika ditambah asam warna menjadi hilang Anion-anion yang termasuk golongan oksidator adalah: NO3H2O2 NO2IO3CrO42BrO3Cr2O72Fe(CN)63MnO4ASO43- Karenareaksinya oksidari-reduksi maka dapat diganggu oleh kation kation oksidator Misal : Fe3+ dari FeCl3 + difenil amin memberikan warna biru 3. Anion-anion golongan reduktor Reaksi:  MnO4.+ H+ Violet    Mn2+ + H2O tdk berwarna (encer) / rosa (agak pekat) Dalam keadaan dingin. warna yang terbentuk kurang peka. KmnO4 harus encer (0.

netral maupun alkali lemah Reaksi : X. H2SO4 ditambahkan AgNO3 + basa sedikit . Anion-anion golongan AgNO3 Anion-anion dengan larutan AgNO3 dapat mengendap baik dalam suasana asam. Anion-anion yang mengendap dengan AgNO3 dalam suasana netral/basa lemah adalah: PO43C2O42CrO42AsO33AsO43Asetat dalam konsentrasi besar   Na2HPO4 + Ag+ → Basa lemah Ag3PO4 Kuning H3PO4 (sangat asam) + Ag+   Jika zatnya asam : HCl. H2SO4 tidak positif pada golongan ini .6  Formiat Ion nitrit dan H2O2 dapat positif dengan pereaksi oksidator maupun reduktor karena bersifat baik sebagai oksidator maupun reduktor 4. HNO3 .+ Ag+ → AgX 1. Anion-anion yang dengan AgNO3 mengendap dalam suasan asam (HNO3 encer) adalah : ClFe(CN)64CLO3-* IO3CN3Fe(CN)6 Br*) setelah direduksi dengan NaNO2 IS2SCNBrO3-* 2. maka jika mengendap berarti ada HKCl Sedangkan asam HNO3 . H3PO4 .

Fe(CN)63Filtrat + NaNO2 + AgNO3 Endapan Br.+ NO2AgNO2 Pemanasan 80oC bertujuan untuk melarutkan Agasetat.. CrO42-.+ Ag+ → Br. IO3.dari ClO3- Filtrat + NaOH → netral +HAc → 80oC + AgNO3 Endapan : PO43-. CN.→ NO2. AsO43-.dari BrO3Cl. C2O42- Filtrat : buang  Penambahan NaNO2 tidak boleh berlebih (1-2 tetes) karena jika konsentrasi NaNO2 besar .7 Reaksi Penggolongan AgNO 3 Zat + HNO3 + AgNO3 Endapan: Cl-. namun penambahan NaNO2 dapat mereduksi CrO42menjadi garam Cr3+ 5. yangsemestinya adalah Ag2CrO4 (dalam suasana netral). Fe(CN)64. S2-. dengan penambahan AgNO3 akan membentuk kristal Reaksi:    BrO3. SCN. AsO33-... I-. Br-.+ NO2.. Golongan BaCl2: .

. BO3 + CaCl2 Filtrat Endapan: C2O4 2- . AsO .dapat mengendap dalam suasana netral . SO3224 + NaAc (netral + BaCl2 Endapan: CrO42-. namun konsentrasinya harus cukup besar Reaksi Penggolongan BaCl 2 Zat + HCl + BaCl2 Endapan: SO42- Filtrat + Br2/I2 + BaCl2 Filtrat Endapan: SO dari S2O32.8   Pereaksi : BaCl2 / BaNO3 Hasil reaksi : endapan berwarna atau tidak berwarna Anion-anion dapat mengendap dengan BaCl2 dalam suasana asam dan netral  Anion-anion yang mengendap dalam suasana asam kuat adalah:  SO42 S2O32setelah dioksidasi dengan Br2 menjadi SO422 SO3 Anion anion yang mengendap dalam suasana netral adalah:  CrO42 PO43 AsO43 BrO3 C2O42. 334 Filtrat 3- PO4 .

→ Fe2S3 Jika ada ion Fe2+ dapat berelsi membentuk warna sebagai:  Fe2+ + Fe(CN)63- → Fe3[Fe(CN)6]2 III. REAKSI PENETAPAN ANION  Pada umumnya anion anion dengan asam (kuat maupun lemah) menimbulkan gas yang terlihat sebagai gelembung-gelembung Jika konsentrasi nya terlaluencer seringkali gelembung yang keluar tidak jelas Adanya gelembung dapat dilihat secara langsung menggunakan mikroskop/gelas obyek Anion anion yang menimbulkan gas dengan asam adalah: CO32NO3HCO3NO2SO32CLOHSO3CNS2O32OCNS2-    .(formiat) SCNBO33- Anion anion yang memberikan warna dengan FeCl3 dalam suasana asam tidak kuat adalah:  Fe3+ + Fe(CN)64.→ KFeFe(CN)6 (biru berlin)   Fe3+ + CH3COOFe3+ + SCN→ → Fe(CH3COO)3 (merah-coklat) Fe(SCN)2+ (merah darah) Bila ada bisulfit (H2SO3 . Golongan FeCl3 /FeSO4 Anion-anion yang memberikan reaksi warna dengann FeCl3 adalah :      Fe(CN)64CH3COO.(asetat) HCOO. S2-) maka akan bereaksinsebagai:  Fe3+ + S2.9 6.

Melihat golongan reduktor  Sulfit (+)  Karbonat (-) b. Reaksi Penetapan CO 32-/HCO 3 Pada reaksi pendahuluan dengan larutan Ba(OH)2 atau Ca(OH)2 terbentuk endapan putih  Reaksi :    Cara : CO32. larutan menjadi keruh Reaksi:  SO32. Melihat golongann BaCl2  Sulfit (+)  Karbonat (-) c.10 1.+ Cr2O72SO42.dengan CO32-: .+ H+ → → CO2 + H2O BaCO3 Putih + H2O Ba(OH)2 + CO2 Ba(OH)2 + CO2 + H+ → Ba(HCO3)2 Larut Ba(OH)2 atau Ca(OH)2 Zat + H2SO4/HCl Reaksi ini juga diberikan oleh ion sulfite:   SO32. Zat + H2SO42N + K2Cr2O7   Sulfit ( + ) larutan menjadi hijau Karbonat (-) .+ Cr3+ (hijau) Cara membedakan HCO3.+ H+ → SO2 + H2O Ba(HCO3)2 larut Ba(OH)2 + SO2 + H2O → Cara membedakan ion karbonat dan sulfit: a.

dengan HgCl2 (sublimat)   4 CO32. Bau merangsang seperti belerang.+ 2SO2 → I2 + amilum → I2 + SO42Iod. menggunakan indikator universal (cocokkan dengan literatur) 2. akan berbah menjadi hijau K2Cr2O7 Cr2O72.+ Mg2+ → HCO3. zat tunggal.+ SO2 + 10H+ → Zat + H2SO4 2N 2Cr3+ + SO42.+ 4Hg2+ → HCO3.dengan HSO 3.+ Mg2+ MgCO3 Putih Mg(HCO3)2 (larut)  Mg(HCO3)2 MgCO3 + H2O + CO2 putih 3. tidak berwarna (gas SO2) Cara membedakan SO 32.+ 5H2O Hijau (kertas saring) b.amilum (biru) c.11 1. Reaksi Penetapan SO 32-/HSO 3   Golongan reduktor (+) Golongan BaCl2 (+) Golongan mengeluarkan gas (+) Cara : a.+ Hg2+ Hg4O3CO3 + 3CO2 Merah coklat 2. Kertas saring dibasahi dengan larutan K2Cr2O7 (oranye) diletakkan di mulut tabung reaksi yang berisi zat yang telah diasamkan dengan H2SO42N.: . Kerats saring yang telah dibasahi dengan KIO3 dan amilum akan berubah menjadi biru reaksi :   IO3. dengan garam MaSO4:    CO32.

+ 2H+ H2S + AgNO3 → Ag2S Hitam H2S + HgCl2 → HgS Hitam CdS Kuning H2S + Cd(Ac)2 → .:   Larutan + I2 + amilum Biru warnanya hilang  Reaksi ini positif jika ada ion sulfit dan tiosulfat ( ditandai adanya endapan kuning muda dari belerang) 4.+ amilum → SO42.+ Ba2+ → BaSO3 Putih HSO3.+ H+ → SO2 + H2O + S Kuning SO2 + K2Cr2O7 + 10H+ → SO2 + IO3.+ 2H+ → Reaksi :    S2. Reaksi Penetapan ion sulfida:   Golongan reduktor (+) Dengan asam H2SO4 encer → menghasilkan gas H2S yang dapat menghitamkan kertas Pb asetat H2S + Pb(Ac)2 → PbS Reaksi : S2.+ 2Cr3+ biru Cara membedakan ion S2O32-. Reaksi Penetapan ion tiosulfat (S 2O 32-)    Reaksi: Golongan reduktor (+) Golongan BaCl2 (+) Golongan mengeluarkan gas (+)    S2O32.dan CO32.+ Ba2+ → Ba(HSO3)2 ( larut) 3.12  Dengan kertas indikator universal Dengan BaCl2 maka:    SO32. SO32.

sehingga jika ditambah asam encer tidak menimbulkan gas H2S Ciri khas gas H2S:    Gas tidak berwrna Bau telur busuk Menghitamkan kertas saring yang dibasahi dengan Pb asetat Reaksi warna yang peka untuk sulfida adalah:    Pb2+ + H2S → PbS + 2H+ Hitam Dengan larutan Na. jika tidak maka reaksinya negatif Reaksi dengan Na nitroprusid ini sangat peka dan dapat menunjukkan adanya sulfida dalam jumlah kecil Reaksi: Na2Fe(CN)5NO + Na2S → NaFe(CN)5NOS Ungu  Larutan zat + NaOH + reagen (dalam air)(baru) → ungu Untuk sulfida yang sukar larut (HgS) diidentifikasi menggunakan reaksi Gutzeit AgNO3 H2S Kapas PbAsetat Zat + H2SO4 2N 5.nitroprusid ( Na2Fe(CN)5NO) dalam alkali NaOH menghasilkan warna ungu/violet Sulfida harus dalam bentuk garam yang larut dan bereaksi basa. Reaksi Penetapan ion Nitrit .13 Sulfida –sulfida kation golongan II tidak larut dalam asam encer.

+ Fe2+ → Fe3[Fe(CN)6]2 .+ H2SO4 2N → Reaksi: NO2    Tb I HNO2 → NO + HNO3 + H2O udara NO + (O) → NO2 (coklat) Dengan larutan FeSO4 pekat + H2SO4 encer/ Hac encer → reaksi cincin coklat Alirkan pelan-pelan melalui dinding tabung I → terbentuk cincin coklat Larutan FeSO4pekat + HAc NO2.+ 2NO2 + 4H+ → I2 + NO + 2H2O Coklat Fe(CN)63.14    Dengan asam encer menimbulkan gas NO2 berwarna coklat .encer Reaksi:    2NaNO2 + 2Hac 2HNO2 FeSO4 + NO 2 Na Ac + 2HNO2 NO + HNO3 + H2O Fe(NO)SO4 Coklat Reaksi ini diganggu oleh ion-ion yang memberikan warna dengan Fe2+ misal Fe(CN)63dan I-   I. bau merangsang Golongan oksidator (+) Golongan reduktor (+) Kertas KI-amilum → biru NO2.

dengan reaksi diazo  nitrat dengan asam sulfanilat dan α naftilamin dan asam asetat menimbulkan warna merah di papan tetes Cara membedakan ion nitrit dan nitrat: Zat NO2NO3H2SO42N + Oksidator + + Reduktor + FeSO4HAc + FeSO4/H2SO 4 ++ + KI-Hac → I2 + - Cara menghilangkan nitrit: a.+ 2H+ → CO2 + N2 + H2O b. direduksi dengan urea dan H2SO4 encer menjadi gas N2 reduksi  NO2N2  (NH2)2C=O + 2NO2. sehingga nitrit mengganggu penentuan nitrat    NaNO3 + H2SO4 p NaHSO4 + HNO3 3Fe2(SO4)3 + 2 NO + 4H2O 6FeSO4 + 2HNO3 + 3 H2SO4 FeSO4 + NO   Fe(NO)So4 Coklat Ion nitrat tidak mengganggu penentuan nitrit Ion nitrit mengganggu penentuan nitrat 2.+ FeSO4 Bila ada nitrit tidak (+) dan seluruh larutan berwarna coklat .15 Biru 6. ditambah aam amina sulfat/NH2SO3H . Reaksi Penetapan Ion Nitrat Reaksi penetapan untuk ion nitrat antara lain adalah: 1. Reaksi cincin coklat dengan pereaksi FeSO4 encer dan H2SO4 pekat H2SO4 pkt pelan-pelan sehingga membentuk 2 lapisan  Reaksi NO3.

+ H2O Paling baik adalah reaksi (b) karena tidak ada hasil samping.16  Kristal ditambahkan pada campuran NO3. sedangkan reaksi (a) dan (c) sebagaian nitrit dioksidasi menjadi nitrat . dengan NH4Cl  NO3..→ N2 + H2SO4 + H2O   Disini terjadi oksidasi-reduksi SO3.menjadi SO42- c.+ NH4Cl → N2 + Cl.dan NO2. dipanaskan menghasilakn gas N2 NH3-SO3H +H+ + NO3.

Sign up to vote on this title
UsefulNot useful