1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

Zat tersebut adalah. 4-propil-5-metil-4-heptena 12.. NaCl e..a. 2-etil-3-metilpentana b...... C5 C6 b.... a. Nama yang sesuai dengan aturan tatanama IUPAC adalah..... LPG merupakan salah satu produk yang digunakan untuk bahan bakar.. C3 C4 c... a..... 80 % butana dan 20% isooktana d... 2-isopropil-3-metilpentana . 4-etil-2-metil-2-heptena b. tetra metil timbal 19....... a.. gas c. Senyawa yang menaikkan angka oktan bensin adalah a... Oli c.... a... LPG tersebut mempunyai jumlah atom C sebanyak......... 4-metil-3-heksena c. siklopropana dan benzena d. 4-metil-3-pentena b... dikloro difluoro metana e.... minyak tanah 15.... Nama struktur senyawa berikut: adalah.... C14 C16 d. 2-etil-2-pentena d. garam dapur c... Hasil penyulingan bertingkat minyak bumi pada 1100C adalah. alkana dan propana b..... Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin. Komponen utama dalam minyak bumi adalah..... C1 C2 e. kloroform b....... C7 C8 18. bensin d. 2-etil-3-pentena e... a.. 80 % isooktana dan 20% butana c. a. a. 4-etil-6-metil-5-heptena c. 80 % isooktana dan 20% n-heptana 14.. dikloro difenil trikloro metana 16. 4-etil-2-metil-5-heptena d... bensin e.. 3-metil-3-heksena 13. siklopropana dan alkana e... tetra etil timbal b. 80 % heptana dan 20% butana b. 4-etil-5-metil-2-heptena e...... Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung. 80 % n-heptana dan 20% isooktana e... alkena dan siklopropana c. solar b. TEL d........... senyawa aromatik dan alkana 17..residu d...

2.6. [2]. [4]. propana etana karboksilat. alkana dengan sikloalkana. d. d. propana etilkarboksilat. propilpropanoat e. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. 2.c.3-metil 2-butanol. etil propil karboksilat. alkanal dengan alkanon. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4. b. e. b. sekunder. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1]. c. 1.3-dimetilpropana karboksilat. Oksidasi suatu alkohol menghasilkan 3-metil butanal. Senyawa berikut ini yang tidak dapat berisomeradalah: a. dietil keton.3-dimetil butirat.3-metil butana 2-karboksilat. . b.6. eter dengan alkohol. Alkoholtersebut adalah: a. b. CH3-(CH2)2-CHOH-CH3.3-dimetilbutanoat. etil isopropil eter. a. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5. 3. c.4-tribromoheksana d. d. 2-metil butana 3-karboksilat.4. Senyawa 2-metil butanal berisomer dengan: a. [5]. [3]. dietileter. e. Berapakah jumlah atom C primer. Tuliskan isomer dari C6H14 beserta namanya? 2. propil etanoat. d. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a.7pentametiloktana? 3. tersier dan kuartener dari senyawa 2.4. 3-pentanol. c. c.5-dimetilheptana ESSAY 1. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. alkanoat dengan ester.3-dimetilbutana e. 2. e. 2. alkena dengan sikloalkana. 2.

c. 2.3. dietil eter. 1.2-dimetil propana. e. (4) etil sekunder propil eter. tak dapat dioksidasi. [8]. c.b. c. dietil keton. CH3-(CH2)3-CH2OH. [7]. c. e. n-butanon. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. d. n-butanal. oksidasi2-butanol. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. e. b. oksidasi 2-butanal. butanoat. etil etana karboksilat. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. 2. CH3-CH2-CHOH-CH2-CH3. 2. d. alkil alkana sulfat. [11]. 1. d. d.4. etanol dengan etanoat. maka senyawa tersebut adalah: a.3-dimetil pentanal. c. b. .4. Dietil eter dapat dihasilkan dari reaksi: a.4-dimetil2-heksanol. CH3-C(CH3)2-CH2OH. Etil asetat berisomer dengan senyawa berikut ini. 1. (2) 2-etoksi propana. e. etena. Penamaanyang benar semuanya terdapat pada: a. [10].n-butanol.3. e.3-dimetil 2-butanon. [9].2. 3. c. d. b.2. tersier butil alkohol.3.4. etanoldengan asam sulfat pekat. 2. d.2. d. 2-metil propanoat. b. dan denganasam asetat terbentuk ester.oksidasi 2-butanon. 1. propil metanoat. metil propanoat. ester.3. e.dietil eter. kecuali: a. b. [6].3-dietil butana. (CH3)2-CH-CH2-CH2OH. c. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter.(3) 2-propoksi etana.3. e.4. b.

supaya teroksidasi. Fehling A terdiri dari NaOH dan Cu2O. e. e. [16]. mengandung garam perak dalam larutan amoniaberlebih. aseton.mengikat air yang terjadi. [13]. a dan b benar. dan c benar. mencegah oksidasi. [17]. mengandung senyawa perak dan CuOdalam NaOH.oksidator. b. d. Fehling B terdiridari NaOH dan kalium natrium tartrat. Pereaksi Tollen bersifat sebagai berikut: a. e. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. Fehling B terdiri dari NaOH. oksidator. Fehling B terdiri dari kaliumnatrium tartrat. b. reduktor. Pada reaksi metil alkohol + asam salisilat. etil alkohol. Fehling A terdiridari Cu2O. dan c benar. matanal. menggeser kestimbangan reaksi. d. [14]. formalin. d. b. e. a dan b benar. Fehling B terdiridari NaOH dan kalium natrium tartrat. Fehling A terdiridari CuSO4 dan NaOH. d. alkanal. a. Fehling B terdiri dari NaOH dan kalium natriumtartrat.mengandung garam perak dalam larutan amonia berlebih. metanol.aseton. alkanon. e. [18]. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. c. metanal. b. b. c. metil alkohol.a. d. b.alkanol. c. b. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. mengandung CuO dalam kalium natriumtartrat. e.maka senyawa itu kemungkinan adalah: a. Suatu senyawa karbon. ditambahkanH2SO4 pekat yang maksudnya adalah: a. reduktor. b. c. d. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. Pernyataan yang tepat mengenai larutan Fehling adalah: a. c.[12]. b. asetaldehida. c. Fehling A terdiri dari CuSO4. dan c benar. a. mengandung CuO dalam larutan kalium natrium tartrat. c. a dan b benar. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. d. a dan b benar. b. e. reduktor. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. propanon. [15]. . metanol.

a dan b benar. butil alkohol dengan K2Cr2O7+ H2SO4. pereaksi Fehling. (c).(f). ESSAY [1]. tuliskan pula masing-masingnamanya ! [3]. d.pereaksi Tollen. KMnO4 + H2SO4. asetaldehida + NaOH(aq)+I2(KI aq). K2Cr2O7 + H2SO4. demetil keton + NaOH(aq)+ I2(KI aq). Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. metanal denganpereaksi Fehling. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. (d). etil alkohol + NaOH(aq)+ I2(KI aq). c. b. (b).[19]. (e) formalin dengan pereaksi Tollen. . Tuliskan reaksi yang terjadi pada: (a). e. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2].

1 M HCl d. 0. pada volume yang sama. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. 0. hantaran terkecil akan diberikan oleh a.. natrium perbromat . reduktor c. 0. H2SO3 & H2SO4 e.1 M CH3COOH b.1 M H2SO4 e. SO3 & SO2 d. 0.. 0. Bilangan oksidasi Br terendah terdapat dalam... Pada pemeriksaan daya hantar listrik larutan berikut. Menurut kaidah pengikatan & pelepasan oksigen. a. CO(NH2)2 3.. C6H6 d. HBr c..05 M H2SO4 2. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a.1.. oksidasi 5. C12H22O11 b. oksidator b. pereaksi yg mengikat oksigen disebut. reduksi e. CCl4 e. Na2SO3 & SO2 c. a. H2S & H2SO4 b..05 M CH3COOH c. redoks d. Na2SO4 & Na2S 4.

zat padat terurai menjadi ionnya 8. dalam air. zat padat terurai menjadi atomnya d.b. natrium bromida 6. yang dalam keadaan padat tidak menghantar listrik... Diantara reaksi berikut yg termasuk autoredoks adalah. tapi dalam cair dan larutan dapat menghantar listrik adalah« a. CCl4 & HCl . CaCl2 + Mg(OH)2 c.. NaCl & HCl d. zat padat terurai menjadi molekulnya e. Diantara pasangan senyawa berikut. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. FeCl3 + H2S e. natrium bromat c. SO2 + O2 d. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b. air menjadi konduktor listrik jika ada zat terlarut c.. dalam air. ternyata larutan zat tsb dapat menghantar listrik. Suatu zat padat dilarutkan dalam air. natrium hipobromit e. air mudah terion jika ada zat padat didalamnya b. a. natrium bromit d. dalam air. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a.

. FeSO4 sebagai oksidator c. Jumlah atom HCl lebih sedikit daripada CH3COOH d. Hal itu disebabkan.. CH3COOH terion lebih banyak daripada HCl c. KMnO4 sebagai reduktor b. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. CH3COOH senyawa kovalen b. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . Pernyataan yang benar dari reaksi diatas adalah. K2SO4 & BaCl2 c. HCl lebih mudah larut daripada H3PO4 e. Persen ionisasi HCl lebih besar daripada CH3COOH 10. a. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. MnSO4 sebagai hasil oksidasi e. a. HCl & KCl 9.. K2SO4 & CCl4 e. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O. HCl adalah senyawa ion.b.. S dalam H2SO4 mengalami penurunan bilangan oksidasi d.

reduktor. NaCNO 2. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . Cu CO3 c. Tentukanlah oksidator. hasil oksidasi. VC2O4 d. NH4ClO3 b.a. CH3COCH3 e.

Sign up to vote on this title
UsefulNot useful