1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

........a. 2-etil-2-pentena d. LPG tersebut mempunyai jumlah atom C sebanyak. 80 % heptana dan 20% butana b. gas c. solar b. 4-propil-5-metil-4-heptena 12..... 80 % isooktana dan 20% butana c. 80 % isooktana dan 20% n-heptana 14........ 4-etil-5-metil-2-heptena e.. 3-metil-3-heksena 13. Zat tersebut adalah.. Hasil penyulingan bertingkat minyak bumi pada 1100C adalah.......... tetra etil timbal b........... dikloro difluoro metana e.... siklopropana dan alkana e.residu d. C3 C4 c. Komponen utama dalam minyak bumi adalah. bensin d.. a.. TEL d... NaCl e. tetra metil timbal 19.. senyawa aromatik dan alkana 17. 2-etil-3-metilpentana b... kloroform b.. alkena dan siklopropana c... C5 C6 b. Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin. C1 C2 e. a.... C14 C16 d. a. a...... Oli c.. 4-metil-3-pentena b.. garam dapur c. 80 % butana dan 20% isooktana d... 4-etil-2-metil-2-heptena b.... dikloro difenil trikloro metana 16. 80 % n-heptana dan 20% isooktana e.... bensin e...... 4-etil-2-metil-5-heptena d.. 4-metil-3-heksena c.. a.... C7 C8 18. LPG merupakan salah satu produk yang digunakan untuk bahan bakar. Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung.... a. 2-etil-3-pentena e....... alkana dan propana b.. minyak tanah 15.. Senyawa yang menaikkan angka oktan bensin adalah a.... Nama yang sesuai dengan aturan tatanama IUPAC adalah.. a. Nama struktur senyawa berikut: adalah. 2-isopropil-3-metilpentana ... 4-etil-6-metil-5-heptena c... siklopropana dan benzena d..

propana etana karboksilat. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5.3-dimetilbutana e.2. d. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4.4. 1.3-metil 2-butanol. dietil keton. 2.6.3-dimetil butirat. d. 2. d.4-tribromoheksana d. b. d. Berapakah jumlah atom C primer.c. c. b. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. c. etil propil karboksilat.7pentametiloktana? 3. Oksidasi suatu alkohol menghasilkan 3-metil butanal.3-metil butana 2-karboksilat. CH3-(CH2)2-CHOH-CH3. . propil etanoat. b. dietileter. Alkoholtersebut adalah: a.5-dimetilheptana ESSAY 1. tersier dan kuartener dari senyawa 2. 3-pentanol. 2. b. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1]. [5]. alkena dengan sikloalkana.3-dimetilpropana karboksilat. alkanoat dengan ester. e.4. c. e. 2-metil butana 3-karboksilat. a. 3. eter dengan alkohol. etil isopropil eter. Senyawa 2-metil butanal berisomer dengan: a. 2. e.3-dimetilbutanoat. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las. Senyawa berikut ini yang tidak dapat berisomeradalah: a. [3]. sekunder.6. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. alkana dengan sikloalkana. propana etilkarboksilat. propilpropanoat e. [2]. [4]. Tuliskan isomer dari C6H14 beserta namanya? 2. alkanal dengan alkanon. c.

Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter.3. metil propanoat. (CH3)2-CH-CH2-CH2OH. 1. 2. etil etana karboksilat. butanoat. n-butanal.4. b. c. d. e.4.2. b. d. c. b.4. d. dan denganasam asetat terbentuk ester. ester. Penamaanyang benar semuanya terdapat pada: a.3. Etil asetat berisomer dengan senyawa berikut ini. e. Dietil eter dapat dihasilkan dari reaksi: a.3-dimetil 2-butanon. oksidasi 2-butanal. alkil alkana sulfat. 2. oksidasi2-butanol. d.(3) 2-propoksi etana.2. [8]. e. etanoldengan asam sulfat pekat. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a.4. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. b. c. (2) 2-etoksi propana. CH3-(CH2)3-CH2OH.dietil eter. dietil keton. n-butanon. 1. d. kecuali: a. maka senyawa tersebut adalah: a. e. CH3-CH2-CHOH-CH2-CH3. 2-metil propanoat. 2. e. CH3-C(CH3)2-CH2OH. [6].3. tak dapat dioksidasi. tersier butil alkohol. [9]. (4) etil sekunder propil eter.3. 1. d. [7].3.n-butanol. [11]. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a.b. b. d. e. [10].2-dimetil propana.3-dietil butana. b. c. 1. etena.oksidasi 2-butanon. 2. propil metanoat. c.2. e. c. c. .4-dimetil2-heksanol. etanol dengan etanoat. dietil eter.3-dimetil pentanal. 3.

mengandung senyawa perak dan CuOdalam NaOH. Fehling B terdiri dari NaOH. reduktor.oksidator. d. ditambahkanH2SO4 pekat yang maksudnya adalah: a. b. Pernyataan yang tepat mengenai larutan Fehling adalah: a. mengandung CuO dalam kalium natriumtartrat. c. b. [17]. b. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. b. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. [18]. dan c benar. [13]. e. mengandung CuO dalam larutan kalium natrium tartrat. Suatu senyawa karbon. mencegah oksidasi. propanon. d. metanal. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. Pereaksi Tollen bersifat sebagai berikut: a. aseton. [15]. oksidator. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. e. [16].maka senyawa itu kemungkinan adalah: a.aseton. metil alkohol. d. metanol. metanol. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. . etil alkohol.alkanol. matanal. mengandung garam perak dalam larutan amoniaberlebih. dan c benar. a dan b benar. d. e. a dan b benar. asetaldehida. d. c. [14]. Fehling B terdiri dari NaOH dan kalium natriumtartrat. alkanal. dan c benar. e. e. e. Fehling B terdiridari NaOH dan kalium natrium tartrat. b. supaya teroksidasi. Fehling A terdiri dari NaOH dan Cu2O. c. b. alkanon. c. Fehling A terdiri dari CuSO4. d. e. a dan b benar.mengikat air yang terjadi. c. Fehling A terdiridari CuSO4 dan NaOH. a. Fehling B terdiri dari kaliumnatrium tartrat. c. reduktor.a. b. reduktor. b. menggeser kestimbangan reaksi.[12]. formalin. Fehling A terdiridari Cu2O. Pada reaksi metil alkohol + asam salisilat. a. d. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. a dan b benar.mengandung garam perak dalam larutan amonia berlebih. b. c.

(d). d. e.(f). KMnO4 + H2SO4. K2Cr2O7 + H2SO4. a dan b benar. Tuliskan reaksi yang terjadi pada: (a). metanal denganpereaksi Fehling. tuliskan pula masing-masingnamanya ! [3]. (e) formalin dengan pereaksi Tollen. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. b. (c).pereaksi Tollen. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. . demetil keton + NaOH(aq)+ I2(KI aq). (b). pereaksi Fehling. ESSAY [1]. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. c. butil alkohol dengan K2Cr2O7+ H2SO4.[19]. etil alkohol + NaOH(aq)+ I2(KI aq). asetaldehida + NaOH(aq)+I2(KI aq).

.. Na2SO4 & Na2S 4.1. H2SO3 & H2SO4 e. reduksi e.. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a. reduktor c. hantaran terkecil akan diberikan oleh a. oksidasi 5. Bilangan oksidasi Br terendah terdapat dalam. CCl4 e. Pada pemeriksaan daya hantar listrik larutan berikut. C6H6 d. a. a. 0.. 0..1 M HCl d. C12H22O11 b. oksidator b. 0.05 M CH3COOH c.05 M H2SO4 2. CO(NH2)2 3. 0. SO3 & SO2 d. 0. HBr c. Na2SO3 & SO2 c. natrium perbromat .1 M CH3COOH b. pereaksi yg mengikat oksigen disebut.. redoks d.1 M H2SO4 e... Menurut kaidah pengikatan & pelepasan oksigen. pada volume yang sama. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. H2S & H2SO4 b.

b. dalam air. Diantara reaksi berikut yg termasuk autoredoks adalah. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b. dalam air.. CaCl2 + Mg(OH)2 c. zat padat terurai menjadi molekulnya e. natrium bromit d. SO2 + O2 d. ternyata larutan zat tsb dapat menghantar listrik. natrium hipobromit e. air mudah terion jika ada zat padat didalamnya b. Suatu zat padat dilarutkan dalam air. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a. yang dalam keadaan padat tidak menghantar listrik. air menjadi konduktor listrik jika ada zat terlarut c. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. Diantara pasangan senyawa berikut. natrium bromida 6. natrium bromat c.. zat padat terurai menjadi atomnya d. tapi dalam cair dan larutan dapat menghantar listrik adalah« a. FeCl3 + H2S e. a.. zat padat terurai menjadi ionnya 8. NaCl & HCl d.. CCl4 & HCl . dalam air.

Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. Hal itu disebabkan. K2SO4 & CCl4 e. a. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1... a. S dalam H2SO4 mengalami penurunan bilangan oksidasi d. Jumlah atom HCl lebih sedikit daripada CH3COOH d. K2SO4 & BaCl2 c. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O.. HCl adalah senyawa ion. CH3COOH senyawa kovalen b. FeSO4 sebagai oksidator c.. HCl & KCl 9. Persen ionisasi HCl lebih besar daripada CH3COOH 10. Pernyataan yang benar dari reaksi diatas adalah. CH3COOH terion lebih banyak daripada HCl c.b. HCl lebih mudah larut daripada H3PO4 e. KMnO4 sebagai reduktor b. MnSO4 sebagai hasil oksidasi e.

hasil oksidasi. NH4ClO3 b. reduktor. Tentukanlah oksidator. NaCNO 2. VC2O4 d. Cu CO3 c. CH3COCH3 e. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O .a.