P. 1
kimia gan

kimia gan

|Views: 203|Likes:

More info:

Published by: Maulida Nur Fitriana on May 31, 2011
Copyright:Attribution Non-commercial

Availability:

Read on Scribd mobile: iPhone, iPad and Android.
download as DOCX, PDF, TXT or read online from Scribd
See more
See less

08/06/2014

pdf

text

original

1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

. 4-etil-2-metil-2-heptena b. a.. C7 C8 18........ kloroform b... C5 C6 b.... 4-etil-5-metil-2-heptena e. tetra etil timbal b. 80 % isooktana dan 20% butana c. Nama struktur senyawa berikut: adalah. Senyawa yang menaikkan angka oktan bensin adalah a.. Hasil penyulingan bertingkat minyak bumi pada 1100C adalah. Oli c. garam dapur c. Nama yang sesuai dengan aturan tatanama IUPAC adalah. bensin e. 4-metil-3-pentena b........... a.... siklopropana dan benzena d.residu d.. a. 4-propil-5-metil-4-heptena 12... a. 2-etil-3-pentena e. C1 C2 e... 80 % butana dan 20% isooktana d.... siklopropana dan alkana e. tetra metil timbal 19... 3-metil-3-heksena 13. dikloro difenil trikloro metana 16.. alkena dan siklopropana c. a.. gas c.. 4-etil-2-metil-5-heptena d.. 2-isopropil-3-metilpentana ... senyawa aromatik dan alkana 17. dikloro difluoro metana e.... NaCl e.......... a... C3 C4 c. LPG tersebut mempunyai jumlah atom C sebanyak. LPG merupakan salah satu produk yang digunakan untuk bahan bakar...... minyak tanah 15..... a. bensin d.. 80 % n-heptana dan 20% isooktana e.a.. TEL d.. alkana dan propana b.... Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin.. 4-metil-3-heksena c...... 2-etil-3-metilpentana b.. 80 % isooktana dan 20% n-heptana 14.. Zat tersebut adalah... 80 % heptana dan 20% butana b. 2-etil-2-pentena d. C14 C16 d..... Komponen utama dalam minyak bumi adalah.... Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung. solar b.... 4-etil-6-metil-5-heptena c.........

dietileter. b. [5]. 1. tersier dan kuartener dari senyawa 2. propil etanoat. Senyawa berikut ini yang tidak dapat berisomeradalah: a.5-dimetilheptana ESSAY 1. d.c. d.3-metil 2-butanol.2. 2. dietil keton. sekunder. Oksidasi suatu alkohol menghasilkan 3-metil butanal. b. 2-metil butana 3-karboksilat. [3]. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. [2]. c. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4. etil isopropil eter. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. Alkoholtersebut adalah: a. Senyawa 2-metil butanal berisomer dengan: a. c. c.3-metil butana 2-karboksilat. propana etana karboksilat. CH3-(CH2)2-CHOH-CH3. alkanal dengan alkanon. d. Tuliskan isomer dari C6H14 beserta namanya? 2. 3. [4]. c. eter dengan alkohol. 3-pentanol. d. propilpropanoat e. alkana dengan sikloalkana. e. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5.3-dimetilbutana e. a. alkanoat dengan ester.6.4-tribromoheksana d.3-dimetilpropana karboksilat. 2. b. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1]. 2.6. .3-dimetilbutanoat. e.7pentametiloktana? 3. alkena dengan sikloalkana. 2. propana etilkarboksilat. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las.3-dimetil butirat. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. etil propil karboksilat.4.4. Berapakah jumlah atom C primer. b. e.

e. e. ester.dietil eter. d. dietil keton. butanoat. n-butanal. dan denganasam asetat terbentuk ester. 2-metil propanoat.4-dimetil2-heksanol. (2) 2-etoksi propana. 1.2. (CH3)2-CH-CH2-CH2OH. 2. 1. n-butanon.3. 1. kecuali: a.4.3-dimetil 2-butanon.3.2.2-dimetil propana. [7]. b. etanoldengan asam sulfat pekat. 3. [10].3-dimetil pentanal. d. b.(3) 2-propoksi etana. maka senyawa tersebut adalah: a. e. Etil asetat berisomer dengan senyawa berikut ini. d. Dietil eter dapat dihasilkan dari reaksi: a. 2. e. tersier butil alkohol. b. etena. c. d. 1. oksidasi2-butanol. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. d. e.3. oksidasi 2-butanal. CH3-(CH2)3-CH2OH. etanol dengan etanoat.3-dietil butana. Penamaanyang benar semuanya terdapat pada: a.n-butanol.4. c.4.oksidasi 2-butanon.4.b. d. metil propanoat. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. CH3-CH2-CHOH-CH2-CH3. [8].2. b. 2. (4) etil sekunder propil eter. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. c. dietil eter. propil metanoat. c. [6]. 2. . b. e. tak dapat dioksidasi. [11]. c. CH3-C(CH3)2-CH2OH.3. d. b. alkil alkana sulfat. [9].3. c. c. e. etil etana karboksilat.

alkanol. reduktor. b. a dan b benar. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. b. metanal. asetaldehida. e. etil alkohol. matanal. d. mengandung CuO dalam larutan kalium natrium tartrat. a dan b benar. mengandung CuO dalam kalium natriumtartrat.mengikat air yang terjadi. Fehling B terdiri dari NaOH dan kalium natriumtartrat. Pereaksi Tollen bersifat sebagai berikut: a. [13]. Fehling B terdiri dari kaliumnatrium tartrat. . d.aseton. b. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. Pada reaksi metil alkohol + asam salisilat. Fehling A terdiridari CuSO4 dan NaOH. dan c benar.maka senyawa itu kemungkinan adalah: a. e. d.[12]. c. Suatu senyawa karbon. a. e. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. a dan b benar. c. aseton. b.mengandung garam perak dalam larutan amonia berlebih. mengandung senyawa perak dan CuOdalam NaOH. reduktor. c. mencegah oksidasi. Fehling A terdiridari Cu2O. Fehling B terdiridari NaOH dan kalium natrium tartrat. [14]. reduktor. [16]. [18]. b. menggeser kestimbangan reaksi. [15]. b. mengandung garam perak dalam larutan amoniaberlebih. d. ditambahkanH2SO4 pekat yang maksudnya adalah: a. c. d. formalin. Fehling B terdiri dari NaOH. Fehling A terdiri dari CuSO4. a dan b benar. alkanal. Fehling A terdiri dari NaOH dan Cu2O. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. oksidator. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. Pernyataan yang tepat mengenai larutan Fehling adalah: a.a. b. a. e. c. e. d. e. metanol. b. [17]. propanon. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. e. dan c benar.oksidator. dan c benar. metil alkohol. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. b. d. supaya teroksidasi. alkanon. c. c. metanol.

. (b). d. butil alkohol dengan K2Cr2O7+ H2SO4. demetil keton + NaOH(aq)+ I2(KI aq). K2Cr2O7 + H2SO4. pereaksi Fehling. ESSAY [1]. KMnO4 + H2SO4. metanal denganpereaksi Fehling. Tuliskan reaksi yang terjadi pada: (a). asetaldehida + NaOH(aq)+I2(KI aq).(f). Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. etil alkohol + NaOH(aq)+ I2(KI aq). Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. c. (e) formalin dengan pereaksi Tollen.[19]. e. (d).pereaksi Tollen. a dan b benar. tuliskan pula masing-masingnamanya ! [3]. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. (c). b.

hantaran terkecil akan diberikan oleh a. oksidator b. Menurut kaidah pengikatan & pelepasan oksigen. a. C12H22O11 b. Pada pemeriksaan daya hantar listrik larutan berikut. reduktor c. H2SO3 & H2SO4 e. natrium perbromat ....05 M H2SO4 2. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. Na2SO3 & SO2 c. CO(NH2)2 3. reduksi e.1 M H2SO4 e. pada volume yang sama..1. Na2SO4 & Na2S 4.1 M CH3COOH b. HBr c. 0. oksidasi 5. pereaksi yg mengikat oksigen disebut.05 M CH3COOH c.. CCl4 e. 0. 0.1 M HCl d. C6H6 d. a.. SO3 & SO2 d. redoks d. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a. 0. Bilangan oksidasi Br terendah terdapat dalam.. 0. H2S & H2SO4 b..

tapi dalam cair dan larutan dapat menghantar listrik adalah« a.b. ternyata larutan zat tsb dapat menghantar listrik. zat padat terurai menjadi ionnya 8. SO2 + O2 d. Diantara pasangan senyawa berikut. a. natrium hipobromit e. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b. natrium bromit d. natrium bromida 6. dalam air. dalam air. CaCl2 + Mg(OH)2 c. air menjadi konduktor listrik jika ada zat terlarut c. zat padat terurai menjadi molekulnya e. CCl4 & HCl . NaCl & HCl d. Suatu zat padat dilarutkan dalam air. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a. air mudah terion jika ada zat padat didalamnya b.. FeCl3 + H2S e.. Diantara reaksi berikut yg termasuk autoredoks adalah. dalam air. zat padat terurai menjadi atomnya d. natrium bromat c.. yang dalam keadaan padat tidak menghantar listrik..

CH3COOH senyawa kovalen b.b. a. MnSO4 sebagai hasil oksidasi e. HCl lebih mudah larut daripada H3PO4 e. KMnO4 sebagai reduktor b. K2SO4 & CCl4 e. Persen ionisasi HCl lebih besar daripada CH3COOH 10.. CH3COOH terion lebih banyak daripada HCl c. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. Hal itu disebabkan. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. HCl & KCl 9. Jumlah atom HCl lebih sedikit daripada CH3COOH d... HCl adalah senyawa ion. a. FeSO4 sebagai oksidator c. K2SO4 & BaCl2 c. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . Pernyataan yang benar dari reaksi diatas adalah. S dalam H2SO4 mengalami penurunan bilangan oksidasi d..

VC2O4 d. hasil oksidasi. reduktor. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . NH4ClO3 b. NaCNO 2. Cu CO3 c. Tentukanlah oksidator. CH3COCH3 e.a.

You're Reading a Free Preview

Download
scribd
/*********** DO NOT ALTER ANYTHING BELOW THIS LINE ! ************/ var s_code=s.t();if(s_code)document.write(s_code)//-->