1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

a. tetra metil timbal 19... 4-metil-3-heksena c.. tetra etil timbal b.. a. Zat tersebut adalah... dikloro difenil trikloro metana 16.... 2-etil-3-metilpentana b... siklopropana dan alkana e...residu d...... 4-etil-5-metil-2-heptena e....... a. 4-etil-2-metil-5-heptena d........a. 4-etil-2-metil-2-heptena b.. 80 % heptana dan 20% butana b.. Nama struktur senyawa berikut: adalah. C7 C8 18...... LPG merupakan salah satu produk yang digunakan untuk bahan bakar. 2-etil-3-pentena e.. 2-etil-2-pentena d... 4-propil-5-metil-4-heptena 12... alkana dan propana b.. C1 C2 e. senyawa aromatik dan alkana 17.... solar b........ Senyawa yang menaikkan angka oktan bensin adalah a... kloroform b. Hasil penyulingan bertingkat minyak bumi pada 1100C adalah. 80 % butana dan 20% isooktana d. 80 % isooktana dan 20% butana c. 2-isopropil-3-metilpentana . a... 80 % n-heptana dan 20% isooktana e.. LPG tersebut mempunyai jumlah atom C sebanyak...... 4-etil-6-metil-5-heptena c.. Nama yang sesuai dengan aturan tatanama IUPAC adalah.. siklopropana dan benzena d.. C14 C16 d.. 4-metil-3-pentena b... gas c.... a. C5 C6 b... a. 80 % isooktana dan 20% n-heptana 14.. Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin... bensin e... C3 C4 c.. bensin d.... a... Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung.. alkena dan siklopropana c. NaCl e. 3-metil-3-heksena 13.. Komponen utama dalam minyak bumi adalah. Oli c... TEL d. garam dapur c.... dikloro difluoro metana e...... minyak tanah 15....

6.3-metil butana 2-karboksilat.3-dimetilbutanoat.3-dimetilbutana e. 2. Berapakah jumlah atom C primer. 2. e. Senyawa 2-metil butanal berisomer dengan: a. tersier dan kuartener dari senyawa 2. 3-pentanol.3-metil 2-butanol.6. c. b. c. e. c. a. etil propil karboksilat. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. alkena dengan sikloalkana. [3]. dietil keton. propilpropanoat e. b. b. alkanal dengan alkanon.5-dimetilheptana ESSAY 1. e. [2]. Senyawa berikut ini yang tidak dapat berisomeradalah: a. [4]. d. c. propana etilkarboksilat. 2. 2-metil butana 3-karboksilat. 3. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las. propana etana karboksilat. Alkoholtersebut adalah: a. d. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4. Tuliskan isomer dari C6H14 beserta namanya? 2. [5]. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. . eter dengan alkohol.2.4.3-dimetilpropana karboksilat. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1]. alkanoat dengan ester.7pentametiloktana? 3. Oksidasi suatu alkohol menghasilkan 3-metil butanal. 2. CH3-(CH2)2-CHOH-CH3.4-tribromoheksana d. d.3-dimetil butirat. alkana dengan sikloalkana. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5.c. sekunder. b.4. d. dietileter. 1. etil isopropil eter. propil etanoat. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a.

etanol dengan etanoat. (2) 2-etoksi propana. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. b.4. d. b.3.3-dimetil pentanal.3. etil etana karboksilat. 1. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a.3. 1. Penamaanyang benar semuanya terdapat pada: a. c.3. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. . Dietil eter dapat dihasilkan dari reaksi: a. e. c. dietil eter. [6]. kecuali: a. d. CH3-C(CH3)2-CH2OH. d. 2.2.3-dimetil 2-butanon. 2. [9].2-dimetil propana.4-dimetil2-heksanol.oksidasi 2-butanon. b.4. tersier butil alkohol. c. 1. e.2. 2. d. d. CH3-CH2-CHOH-CH2-CH3. 3. c. e. [8]. 2. e.n-butanol.2. n-butanon. c.3-dietil butana. (CH3)2-CH-CH2-CH2OH. Etil asetat berisomer dengan senyawa berikut ini. 2-metil propanoat. b. butanoat. dietil keton. ester. etena. dan denganasam asetat terbentuk ester.dietil eter. oksidasi2-butanol. metil propanoat. d. CH3-(CH2)3-CH2OH. d. [11]. [10].4.4. maka senyawa tersebut adalah: a. e. c. [7].b. n-butanal. tak dapat dioksidasi.3. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. b. c. etanoldengan asam sulfat pekat. 1. propil metanoat. oksidasi 2-butanal. (4) etil sekunder propil eter. e. e.(3) 2-propoksi etana. alkil alkana sulfat. b.

a. mengandung CuO dalam larutan kalium natrium tartrat.maka senyawa itu kemungkinan adalah: a. a dan b benar. d. metil alkohol. b. . [13]. a dan b benar.a. Fehling B terdiridari NaOH dan kalium natrium tartrat. e. d. c. c. d. mengandung CuO dalam kalium natriumtartrat. e. aseton. d. Fehling A terdiri dari CuSO4. supaya teroksidasi. [16]. c. [14].mengandung garam perak dalam larutan amonia berlebih.mengikat air yang terjadi. formalin. c. Fehling A terdiridari Cu2O. mencegah oksidasi. Pereaksi Tollen bersifat sebagai berikut: a. b. reduktor. etil alkohol. b. e. Fehling B terdiridari NaOH dan kalium natrium tartrat. alkanal. c. dan c benar. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. b. b. Fehling B terdiri dari kaliumnatrium tartrat. Fehling A terdiri dari NaOH dan Cu2O. d. metanol. e. dan c benar. a dan b benar. Fehling B terdiri dari NaOH. [18]. reduktor. b. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. a. Fehling B terdiri dari NaOH dan kalium natriumtartrat. mengandung garam perak dalam larutan amoniaberlebih. metanol. Pada reaksi metil alkohol + asam salisilat. metanal. c. dan c benar. menggeser kestimbangan reaksi.oksidator.aseton. a dan b benar. mengandung senyawa perak dan CuOdalam NaOH. matanal. b. [15]. e. c. e. d. ditambahkanH2SO4 pekat yang maksudnya adalah: a. [17]. Fehling A terdiridari CuSO4 dan NaOH. asetaldehida. b. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. e. oksidator. alkanon.alkanol. Pernyataan yang tepat mengenai larutan Fehling adalah: a. reduktor.[12]. b. d. propanon. Suatu senyawa karbon. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. b.

Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. KMnO4 + H2SO4. metanal denganpereaksi Fehling. (c). asetaldehida + NaOH(aq)+I2(KI aq). demetil keton + NaOH(aq)+ I2(KI aq). etil alkohol + NaOH(aq)+ I2(KI aq). Tuliskan reaksi yang terjadi pada: (a).pereaksi Tollen. . pereaksi Fehling. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. butil alkohol dengan K2Cr2O7+ H2SO4. (e) formalin dengan pereaksi Tollen.[19]. tuliskan pula masing-masingnamanya ! [3]. (b). d. c. ESSAY [1]. a dan b benar. e. K2Cr2O7 + H2SO4. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. b.(f). (d).

Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. pada volume yang sama... C6H6 d. HBr c. 0. CO(NH2)2 3.. a.05 M CH3COOH c.. Menurut kaidah pengikatan & pelepasan oksigen. 0.1. 0. H2S & H2SO4 b. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a. H2SO3 & H2SO4 e.. 0. Pada pemeriksaan daya hantar listrik larutan berikut.. SO3 & SO2 d..1 M CH3COOH b. a. Na2SO4 & Na2S 4. CCl4 e. reduksi e.1 M HCl d. Bilangan oksidasi Br terendah terdapat dalam.1 M H2SO4 e.05 M H2SO4 2.. Na2SO3 & SO2 c. natrium perbromat . hantaran terkecil akan diberikan oleh a. 0. C12H22O11 b. redoks d. reduktor c. oksidator b. pereaksi yg mengikat oksigen disebut. oksidasi 5.

FeCl3 + H2S e.. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a. natrium bromat c. SO2 + O2 d.. NaCl & HCl d. natrium hipobromit e. zat padat terurai menjadi molekulnya e. dalam air.b. CaCl2 + Mg(OH)2 c. natrium bromida 6.. dalam air. a. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. Suatu zat padat dilarutkan dalam air. air menjadi konduktor listrik jika ada zat terlarut c. Diantara reaksi berikut yg termasuk autoredoks adalah. Diantara pasangan senyawa berikut. zat padat terurai menjadi ionnya 8. tapi dalam cair dan larutan dapat menghantar listrik adalah« a. dalam air. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b. natrium bromit d. zat padat terurai menjadi atomnya d. ternyata larutan zat tsb dapat menghantar listrik. air mudah terion jika ada zat padat didalamnya b. yang dalam keadaan padat tidak menghantar listrik. CCl4 & HCl ..

. HCl lebih mudah larut daripada H3PO4 e. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . CH3COOH senyawa kovalen b. a. S dalam H2SO4 mengalami penurunan bilangan oksidasi d. HCl adalah senyawa ion. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. MnSO4 sebagai hasil oksidasi e. KMnO4 sebagai reduktor b. Jumlah atom HCl lebih sedikit daripada CH3COOH d. K2SO4 & CCl4 e. Pernyataan yang benar dari reaksi diatas adalah. Persen ionisasi HCl lebih besar daripada CH3COOH 10. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. HCl & KCl 9. a.. CH3COOH terion lebih banyak daripada HCl c. Hal itu disebabkan...b. K2SO4 & BaCl2 c. FeSO4 sebagai oksidator c. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O.

hasil oksidasi. VC2O4 d. reduktor. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . Cu CO3 c. NH4ClO3 b.a. Tentukanlah oksidator. CH3COCH3 e. NaCNO 2.