1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

. dikloro difluoro metana e. Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin..... gas c... 80 % isooktana dan 20% n-heptana 14. a. solar b... Oli c. 4-etil-2-metil-5-heptena d. LPG tersebut mempunyai jumlah atom C sebanyak.....a.... a. C3 C4 c. alkana dan propana b.. 4-etil-6-metil-5-heptena c.. Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung. Nama struktur senyawa berikut: adalah.. alkena dan siklopropana c.. minyak tanah 15..... tetra etil timbal b... 80 % heptana dan 20% butana b.. Zat tersebut adalah. TEL d........ 4-metil-3-pentena b.residu d.. a... bensin e. 2-etil-2-pentena d.. Komponen utama dalam minyak bumi adalah.. Senyawa yang menaikkan angka oktan bensin adalah a... C14 C16 d. 4-etil-2-metil-2-heptena b. a... LPG merupakan salah satu produk yang digunakan untuk bahan bakar... dikloro difenil trikloro metana 16.... 3-metil-3-heksena 13... 4-etil-5-metil-2-heptena e... Nama yang sesuai dengan aturan tatanama IUPAC adalah.. garam dapur c... C1 C2 e........ a. 2-etil-3-pentena e.. 80 % n-heptana dan 20% isooktana e.. 80 % isooktana dan 20% butana c.. 2-isopropil-3-metilpentana ... 4-metil-3-heksena c. Hasil penyulingan bertingkat minyak bumi pada 1100C adalah.. senyawa aromatik dan alkana 17. C5 C6 b.. 80 % butana dan 20% isooktana d.. NaCl e. kloroform b............... C7 C8 18. bensin d.. a...... siklopropana dan alkana e.. siklopropana dan benzena d. a..... 4-propil-5-metil-4-heptena 12... 2-etil-3-metilpentana b.. tetra metil timbal 19....

propana etilkarboksilat.3-dimetilbutana e. d.6. dietileter. 2.4. CH3-(CH2)2-CHOH-CH3. c.2.3-metil butana 2-karboksilat. 2.3-metil 2-butanol. Senyawa berikut ini yang tidak dapat berisomeradalah: a. tersier dan kuartener dari senyawa 2. etil isopropil eter. b. 1. [2].7pentametiloktana? 3. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. 2-metil butana 3-karboksilat. dietil keton. b. alkana dengan sikloalkana.3-dimetilpropana karboksilat. alkena dengan sikloalkana. alkanoat dengan ester. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5.3-dimetil butirat. . Senyawa 2-metil butanal berisomer dengan: a. 2. Oksidasi suatu alkohol menghasilkan 3-metil butanal. [5]. propilpropanoat e. eter dengan alkohol. 3.4. c. e. Berapakah jumlah atom C primer. a. d. c. [4]. 2.5-dimetilheptana ESSAY 1. etil propil karboksilat.c. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1].3-dimetilbutanoat. e. 3-pentanol. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. b.6. propil etanoat. propana etana karboksilat. c. alkanal dengan alkanon. d. Tuliskan isomer dari C6H14 beserta namanya? 2. b. d. [3]. Alkoholtersebut adalah: a. e. sekunder.4-tribromoheksana d.

b. [6]. 2.4-dimetil2-heksanol.2.3. .b. CH3-C(CH3)2-CH2OH.3. dietil eter.3.(3) 2-propoksi etana. c. etanol dengan etanoat. dan denganasam asetat terbentuk ester. d. oksidasi 2-butanal. 1.3. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. Etil asetat berisomer dengan senyawa berikut ini. [9]. b.3. (CH3)2-CH-CH2-CH2OH. etil etana karboksilat. alkil alkana sulfat. d. b. (4) etil sekunder propil eter. [8]. 3. etanoldengan asam sulfat pekat. (2) 2-etoksi propana. d. n-butanon. c. e.3-dimetil pentanal.4.dietil eter. oksidasi2-butanol. c. d. 2. e. c. CH3-CH2-CHOH-CH2-CH3. b. [11]. 2-metil propanoat. propil metanoat. e.3-dietil butana. c. tersier butil alkohol. d.4. 1. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. d. CH3-(CH2)3-CH2OH. 2. 1.2. dietil keton. maka senyawa tersebut adalah: a. [10]. 1. b.2-dimetil propana.4. tak dapat dioksidasi. kecuali: a. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. c. e.3-dimetil 2-butanon. 2. butanoat.n-butanol. c. etena. [7]. Dietil eter dapat dihasilkan dari reaksi: a. e. n-butanal. ester.oksidasi 2-butanon. d.4. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. e. e. b.2. metil propanoat. Penamaanyang benar semuanya terdapat pada: a.

e. c. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. mengandung senyawa perak dan CuOdalam NaOH. aseton. Pereaksi Tollen bersifat sebagai berikut: a. e. e. b.aseton. c. mengandung CuO dalam larutan kalium natrium tartrat. alkanon. metil alkohol. alkanal.a. [16]. c. ditambahkanH2SO4 pekat yang maksudnya adalah: a. a dan b benar. dan c benar.mengandung garam perak dalam larutan amonia berlebih. a. b. metanol. Fehling A terdiri dari NaOH dan Cu2O.[12]. a dan b benar. Fehling B terdiridari NaOH dan kalium natrium tartrat. Pada reaksi metil alkohol + asam salisilat. e. [18]. [15]. reduktor. e. c. matanal. Fehling B terdiri dari NaOH dan kalium natriumtartrat. Fehling B terdiri dari kaliumnatrium tartrat. d. c. etil alkohol. d.oksidator. formalin. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. reduktor. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. [14]. e. dan c benar. d.mengikat air yang terjadi. dan c benar. mengandung CuO dalam kalium natriumtartrat. d. a. c. propanon. mencegah oksidasi. oksidator. . Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. metanal. b. asetaldehida. b. d. b. Fehling A terdiridari CuSO4 dan NaOH. e. b. Suatu senyawa karbon. c. Fehling A terdiridari Cu2O. Fehling A terdiri dari CuSO4. b. a dan b benar. [17]. metanol. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. d. [13].alkanol. d. b. menggeser kestimbangan reaksi. a dan b benar. mengandung garam perak dalam larutan amoniaberlebih. b. reduktor. Pernyataan yang tepat mengenai larutan Fehling adalah: a.maka senyawa itu kemungkinan adalah: a. Fehling B terdiri dari NaOH. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. supaya teroksidasi.

d. a dan b benar. KMnO4 + H2SO4.(f). b. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. metanal denganpereaksi Fehling. e. butil alkohol dengan K2Cr2O7+ H2SO4.[19]. ESSAY [1]. (d). demetil keton + NaOH(aq)+ I2(KI aq). Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. c. asetaldehida + NaOH(aq)+I2(KI aq). (e) formalin dengan pereaksi Tollen. pereaksi Fehling. (c). tuliskan pula masing-masingnamanya ! [3]. K2Cr2O7 + H2SO4. . Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a.pereaksi Tollen. (b). Tuliskan reaksi yang terjadi pada: (a). etil alkohol + NaOH(aq)+ I2(KI aq).

Na2SO4 & Na2S 4. reduktor c. a.... natrium perbromat . CO(NH2)2 3. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a.05 M H2SO4 2. HBr c.. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a.1 M CH3COOH b. reduksi e. 0. pada volume yang sama. oksidator b.1.. Bilangan oksidasi Br terendah terdapat dalam.. 0. oksidasi 5. Pada pemeriksaan daya hantar listrik larutan berikut. H2S & H2SO4 b.05 M CH3COOH c. 0. 0.1 M H2SO4 e. CCl4 e. a. H2SO3 & H2SO4 e. Menurut kaidah pengikatan & pelepasan oksigen.1 M HCl d. C6H6 d. C12H22O11 b.. hantaran terkecil akan diberikan oleh a. SO3 & SO2 d.. Na2SO3 & SO2 c. redoks d. pereaksi yg mengikat oksigen disebut. 0.

dalam air. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a. natrium hipobromit e. Diantara reaksi berikut yg termasuk autoredoks adalah. NaCl & HCl d. zat padat terurai menjadi ionnya 8. dalam air. tapi dalam cair dan larutan dapat menghantar listrik adalah« a. ternyata larutan zat tsb dapat menghantar listrik. zat padat terurai menjadi molekulnya e. air menjadi konduktor listrik jika ada zat terlarut c. a. natrium bromida 6. dalam air. Diantara pasangan senyawa berikut. yang dalam keadaan padat tidak menghantar listrik. CaCl2 + Mg(OH)2 c. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b.. zat padat terurai menjadi atomnya d. SO2 + O2 d. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. Suatu zat padat dilarutkan dalam air... FeCl3 + H2S e.b. natrium bromat c. natrium bromit d. air mudah terion jika ada zat padat didalamnya b.. CCl4 & HCl .

KMnO4 sebagai reduktor b. HCl & KCl 9.. a. S dalam H2SO4 mengalami penurunan bilangan oksidasi d. Pernyataan yang benar dari reaksi diatas adalah.. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. K2SO4 & CCl4 e. Jumlah atom HCl lebih sedikit daripada CH3COOH d. Persen ionisasi HCl lebih besar daripada CH3COOH 10.. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . HCl lebih mudah larut daripada H3PO4 e. HCl adalah senyawa ion. K2SO4 & BaCl2 c. CH3COOH terion lebih banyak daripada HCl c. CH3COOH senyawa kovalen b. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. FeSO4 sebagai oksidator c.. MnSO4 sebagai hasil oksidasi e. Hal itu disebabkan.b. a.

Cu CO3 c. CH3COCH3 e. reduktor. NaCNO 2. VC2O4 d. hasil oksidasi. NH4ClO3 b.a. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . Tentukanlah oksidator.

Sign up to vote on this title
UsefulNot useful