1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

a....... 4-etil-2-metil-2-heptena b. kloroform b.. minyak tanah 15... 80 % isooktana dan 20% butana c.... alkana dan propana b........ Nama yang sesuai dengan aturan tatanama IUPAC adalah... 80 % butana dan 20% isooktana d. Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung... gas c.. 80 % isooktana dan 20% n-heptana 14.. Zat tersebut adalah. LPG merupakan salah satu produk yang digunakan untuk bahan bakar. a. senyawa aromatik dan alkana 17... a....... tetra metil timbal 19..... C5 C6 b. C7 C8 18.. Nama struktur senyawa berikut: adalah....... a.. TEL d. a. Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin. garam dapur c. tetra etil timbal b. LPG tersebut mempunyai jumlah atom C sebanyak......a.... dikloro difenil trikloro metana 16... C14 C16 d...... 4-propil-5-metil-4-heptena 12.. a...... 2-isopropil-3-metilpentana .. a..... siklopropana dan benzena d.... 4-metil-3-heksena c... solar b.. 4-etil-5-metil-2-heptena e.. 4-metil-3-pentena b. 80 % heptana dan 20% butana b. alkena dan siklopropana c.. C1 C2 e... 2-etil-2-pentena d. 2-etil-3-pentena e... NaCl e.. 80 % n-heptana dan 20% isooktana e. 2-etil-3-metilpentana b. C3 C4 c. bensin d... siklopropana dan alkana e... bensin e.. 4-etil-2-metil-5-heptena d. dikloro difluoro metana e. 3-metil-3-heksena 13. Oli c... Senyawa yang menaikkan angka oktan bensin adalah a..residu d..... 4-etil-6-metil-5-heptena c. Komponen utama dalam minyak bumi adalah.... Hasil penyulingan bertingkat minyak bumi pada 1100C adalah...

dietileter. c. eter dengan alkohol. c. a. 2. d. 3.4-tribromoheksana d. [5].3-dimetilbutanoat. alkanoat dengan ester. d. [4]. 1. [3].6. alkanal dengan alkanon. [2]. Berapakah jumlah atom C primer. . Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a.7pentametiloktana? 3. 2. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b. propana etana karboksilat.3-metil 2-butanol. c. e. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1].4. Alkoholtersebut adalah: a. propil etanoat. 2.3-dimetilpropana karboksilat. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las. b. dietil keton.6.c. b. b. e. d. e. etil propil karboksilat. propana etilkarboksilat. alkana dengan sikloalkana. alkena dengan sikloalkana. propilpropanoat e. Tuliskan isomer dari C6H14 beserta namanya? 2.3-metil butana 2-karboksilat.3-dimetil butirat. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4.2. c.5-dimetilheptana ESSAY 1. Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5. 2. b. CH3-(CH2)2-CHOH-CH3. tersier dan kuartener dari senyawa 2. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. sekunder. etil isopropil eter.4. Senyawa 2-metil butanal berisomer dengan: a.3-dimetilbutana e. 3-pentanol. Senyawa berikut ini yang tidak dapat berisomeradalah: a. d. 2-metil butana 3-karboksilat. Oksidasi suatu alkohol menghasilkan 3-metil butanal.

oksidasi 2-butanon.4.4. d. n-butanon.3.3. tersier butil alkohol. (2) 2-etoksi propana. b. d. d. metil propanoat.4. d.3. Dietil eter dapat dihasilkan dari reaksi: a. dan denganasam asetat terbentuk ester. b. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. b. 1. c. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. b. c. e. alkil alkana sulfat. etena. etanol dengan etanoat. oksidasi 2-butanal. . e. d. 2-metil propanoat. (4) etil sekunder propil eter. [7].n-butanol.4. maka senyawa tersebut adalah: a. 2. e. e.2. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. c.dietil eter. tak dapat dioksidasi. kecuali: a. 1.2. e. (CH3)2-CH-CH2-CH2OH. butanoat.b. d. [9]. e. c. ester. c.(3) 2-propoksi etana. b. CH3-C(CH3)2-CH2OH. [11]. [8]. 3. d.3-dimetil 2-butanon. CH3-(CH2)3-CH2OH. 1. propil metanoat. dietil eter.3-dietil butana. 1.3. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. c.2-dimetil propana. etil etana karboksilat. b. e.4-dimetil2-heksanol. [6]. [10].3. c. Penamaanyang benar semuanya terdapat pada: a.2. etanoldengan asam sulfat pekat. 2. 2. CH3-CH2-CHOH-CH2-CH3. 2. n-butanal. dietil keton. oksidasi2-butanol. Etil asetat berisomer dengan senyawa berikut ini.3-dimetil pentanal.

d. [14]. b. a.oksidator. aseton. b. c. reduktor. [17].mengandung garam perak dalam larutan amonia berlebih.a. Fehling A terdiridari Cu2O. b. . Fehling B terdiri dari NaOH. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. b. [16]. a dan b benar. formalin. a dan b benar. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. c. dan c benar. Fehling A terdiridari CuSO4 dan NaOH. menggeser kestimbangan reaksi. c. e. reduktor. e. Pernyataan yang tepat mengenai larutan Fehling adalah: a. a. b.mengikat air yang terjadi. propanon. metil alkohol. b. Fehling B terdiri dari NaOH dan kalium natriumtartrat. metanol. [13]. metanol. a dan b benar. d. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. mengandung CuO dalam kalium natriumtartrat. Pereaksi Tollen bersifat sebagai berikut: a. alkanal. [15]. d. c. dan c benar. c. [18]. b. b. d. Fehling A terdiri dari NaOH dan Cu2O. oksidator.[12]. mengandung senyawa perak dan CuOdalam NaOH. metanal. mengandung garam perak dalam larutan amoniaberlebih.aseton. mengandung CuO dalam larutan kalium natrium tartrat. b. d. dan c benar. Suatu senyawa karbon. b. asetaldehida. reduktor. matanal. a dan b benar. e. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. Fehling B terdiri dari kaliumnatrium tartrat. Pada reaksi metil alkohol + asam salisilat. Fehling B terdiridari NaOH dan kalium natrium tartrat. c. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. c. e. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. d. Fehling B terdiridari NaOH dan kalium natrium tartrat. d. ditambahkanH2SO4 pekat yang maksudnya adalah: a.alkanol. alkanon. e. Fehling A terdiri dari CuSO4. etil alkohol.maka senyawa itu kemungkinan adalah: a. e. e. supaya teroksidasi. mencegah oksidasi.

Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O.(f). (e) formalin dengan pereaksi Tollen. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. demetil keton + NaOH(aq)+ I2(KI aq). e. etil alkohol + NaOH(aq)+ I2(KI aq). ESSAY [1]. K2Cr2O7 + H2SO4. (c). d. (d). Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. KMnO4 + H2SO4. (b). asetaldehida + NaOH(aq)+I2(KI aq). b. butil alkohol dengan K2Cr2O7+ H2SO4. c.pereaksi Tollen.[19]. pereaksi Fehling. metanal denganpereaksi Fehling. . a dan b benar. tuliskan pula masing-masingnamanya ! [3]. Tuliskan reaksi yang terjadi pada: (a).

hantaran terkecil akan diberikan oleh a. a. Pada pemeriksaan daya hantar listrik larutan berikut. H2SO3 & H2SO4 e. natrium perbromat .1 M HCl d. Menurut kaidah pengikatan & pelepasan oksigen. C6H6 d. Na2SO3 & SO2 c.1 M CH3COOH b. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. CCl4 e. oksidator b.05 M H2SO4 2.1 M H2SO4 e. 0..1. SO3 & SO2 d. 0. a. pereaksi yg mengikat oksigen disebut... reduksi e. 0.. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a.. 0. HBr c. C12H22O11 b.05 M CH3COOH c. CO(NH2)2 3. reduktor c.. H2S & H2SO4 b. redoks d. Na2SO4 & Na2S 4. 0.. Bilangan oksidasi Br terendah terdapat dalam. pada volume yang sama.. oksidasi 5.

air menjadi konduktor listrik jika ada zat terlarut c. Diantara reaksi berikut yg termasuk autoredoks adalah. zat padat terurai menjadi atomnya d. natrium bromat c. dalam air. dalam air. a. zat padat terurai menjadi molekulnya e. ternyata larutan zat tsb dapat menghantar listrik. natrium bromida 6. SO2 + O2 d.. FeCl3 + H2S e. natrium hipobromit e. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b. air mudah terion jika ada zat padat didalamnya b.b. zat padat terurai menjadi ionnya 8. dalam air. yang dalam keadaan padat tidak menghantar listrik. Suatu zat padat dilarutkan dalam air. NaCl & HCl d.. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. tapi dalam cair dan larutan dapat menghantar listrik adalah« a.. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a. natrium bromit d.. CaCl2 + Mg(OH)2 c. CCl4 & HCl . Diantara pasangan senyawa berikut.

CH3COOH senyawa kovalen b.. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: . HCl adalah senyawa ion. Pernyataan yang benar dari reaksi diatas adalah. HCl & KCl 9.. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. a. K2SO4 & BaCl2 c. Persen ionisasi HCl lebih besar daripada CH3COOH 10. K2SO4 & CCl4 e. Hal itu disebabkan. a. HCl lebih mudah larut daripada H3PO4 e.. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. CH3COOH terion lebih banyak daripada HCl c. S dalam H2SO4 mengalami penurunan bilangan oksidasi d.b. Jumlah atom HCl lebih sedikit daripada CH3COOH d. FeSO4 sebagai oksidator c. KMnO4 sebagai reduktor b.. MnSO4 sebagai hasil oksidasi e.

hasil oksidasi. VC2O4 d. NaCNO 2. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . NH4ClO3 b. reduktor. Tentukanlah oksidator.a. CH3COCH3 e. Cu CO3 c.

Sign up to vote on this title
UsefulNot useful