1. Diantara senyawa dibawah ini yang termasuk golongan alkuna adalah . a. C3H8 c. C6H6 e. C5H8 b. C3H4 d. C4H8 2.

10 ml hidrokarbon tepet bereaksi dengan 40 mL oksigen mengahasilkan 20 mL CO2. jika volume gas diukur pada suhu dan tekanan yang sama maka rumus molekul hidrokarbon tersebut adalah........... a. CH4 c. C3H4 e. C3H8 b. C2H6 d. C3H6 3. Sejumlah 3,2 g gas metana dibakar dengan 16 g oksigen maka gas CO2 yang dihasilkan adalah a. 2,24 g c. 8,80 g e. 17,6 g b. 4,40 g d. 8,96 g 4. Pada pembakaran 12 g suatu senyawa karbon dihasilkan 22 g gas CO2. Kadar unsur karbon dalam senyawa tersebut ..... a. 23% c. 50% e. 77% b. 27% d. 55% 5. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana b. 2,2,4,4-tetrametilheptana c. 4,4,6,6-tetrametilheptana d. 4,4-dimetilnonana e. 2,4-dimetilnonana 6. Nama dari senyawa berikut adalah . a. heksana b. heksena c. 2,2-dimetilbutana d. 3,3-dimetil-1-butuna e. 3,3-dimetil-1-butena 7. senyawa yang bukan isomer dari oktana adalah a. 2-metilheptana d. 2,2-dimetilpentana b. 2,3-dimetilheksana e. 2,2,3,3-tetrametilbutana c. 2,3,4-trimetilpentana 8. Jika propena direkasikan dengan brom dalam CCl4 hasilnya adalah.............. a. 1-bromopropana d. 1,2-dibromopropana b. 2-bromopropana e. 1,3-dibromopropana c. siklopropana 9. Nama IUPAC untuk senyawa CH3CH2CH2C(CH3)2CH2C(CH3)2 adalah....... a. dekana e. 2,4-dimetilnonana b. 2,2,4,4-tetrametilheptana d. 4,4-dimetilnonana c. 4,4,6,6-tetrametilheptana 10. Jumlah isomer dari C6H10 adalah......... a. 3 b. 4 c. 5 d. 6 e. 7 11. Nama yang tepat untuk senyawa alkena dibawah ini adalah.........

......... a.. Zat tersebut adalah..a. garam dapur c. a. Bensin yang mempunyai angka oktana 80 berarti bensin tersebut mengandung.. Bensin yang banyak digunakan bahan bakar kendaraan bermotor ditambahkan zat aditif yang berfungsi mengurangi ketukan dalam mesin. 2-etil-3-pentena e... 80 % isooktana dan 20% n-heptana 14. gas c. 80 % butana dan 20% isooktana d..residu d...... C1 C2 e. Oli c. dikloro difluoro metana e. 3-metil-3-heksena 13.... LPG tersebut mempunyai jumlah atom C sebanyak. 2-etil-3-metilpentana b..... a... 80 % n-heptana dan 20% isooktana e......... bensin d. TEL d.... 4-etil-5-metil-2-heptena e.. alkena dan siklopropana c.. 4-etil-2-metil-2-heptena b... 4-metil-3-heksena c.. 2-isopropil-3-metilpentana . 4-etil-2-metil-5-heptena d.. Senyawa yang menaikkan angka oktan bensin adalah a. 4-etil-6-metil-5-heptena c. C7 C8 18..... Komponen utama dalam minyak bumi adalah... senyawa aromatik dan alkana 17.... 80 % heptana dan 20% butana b. bensin e... C14 C16 d... a.. tetra etil timbal b. C3 C4 c.. siklopropana dan alkana e. C5 C6 b.... a...... LPG merupakan salah satu produk yang digunakan untuk bahan bakar.. 80 % isooktana dan 20% butana c.. Nama struktur senyawa berikut: adalah.. a. minyak tanah 15.. siklopropana dan benzena d... solar b... dikloro difenil trikloro metana 16......... Hasil penyulingan bertingkat minyak bumi pada 1100C adalah. 4-metil-3-pentena b. a...... NaCl e. 4-propil-5-metil-4-heptena 12. tetra metil timbal 19. Nama yang sesuai dengan aturan tatanama IUPAC adalah..... alkana dan propana b.. kloroform b. 2-etil-2-pentena d.......

Jelaskan prinsip penyulingan minyak bumi menjadi komponen-komponennya (fraksi-fraksi) dan apa nama metodenya? 5.3-metil butana 2-karboksilat. Senyawa berikut ini yang tidak dapat berisomeradalah: a. propana etana karboksilat. b.5-dimetilheptana ESSAY 1. sekunder. 2. b.4-tribromoheksana d. . Tuliskan isomer dari C6H14 beserta namanya? 2. CH3-(CH2)2-CHOH-CH3. e.c. b. 2-metil butana 3-karboksilat.4.3-dimetilbutana e. Senyawa 2-metil butanal berisomer dengan: a. alkena dengan sikloalkana.3-dimetilbutanoat. c. 3-pentanol. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a.3-metil 2-butanol. Asetilen merupakan salah satu bagian dari senyawa hidrokarbon yang digunakan oleh tukang las.4. eter dengan alkohol. [5]. e.3-dimetilpropana karboksilat. alkanoat dengan ester. etil isopropil eter. d. asetilena tersebut dibuat dengan meraksikan kalsium karbida dengan air [1]. alkanal dengan alkanon. [3]. e. Berapakah jumlah atom C primer. a. Alkoholtersebut adalah: a. [4]. 2. etil propil karboksilat. propilpropanoat e.7pentametiloktana? 3. c.6. d. Oksidasi suatu alkohol menghasilkan 3-metil butanal. [2]. dietil keton. c. b. Sebutkan pula dampaknya terhadap lingkungan (manusia) ? 4. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. Sebutkan gas-gas/komponen apa saja yang dihasilkan dari bahan bakar kendaraan bermotor dan minyak bumi (atau bahan bakar fosil) ? b.3-dimetil butirat. d. propana etilkarboksilat. 2. dietileter. 2.2. 3.6. 1. alkana dengan sikloalkana. tersier dan kuartener dari senyawa 2. propil etanoat. d. c.

c. b.3-dimetil 2-butanon. c.2-dimetil propana. e. [7]. b. kecuali: a. dietil eter. 3. c. etil etana karboksilat. e. d.(3) 2-propoksi etana.4. c. 2. Penamaanyang benar semuanya terdapat pada: a.3. e. tersier butil alkohol. 2. oksidasi2-butanol.4. d.4. 2-metil propanoat. butanoat.3-dimetil pentanal. CH3-(CH2)3-CH2OH. dietil keton. n-butanon.2. . Etil asetat berisomer dengan senyawa berikut ini. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. CH3-CH2-CHOH-CH2-CH3. c.dietil eter. (2) 2-etoksi propana. b. 1. e. metil propanoat.2.n-butanol. propil metanoat. [10]. d. tak dapat dioksidasi. etanol dengan etanoat.b. etanoldengan asam sulfat pekat. 2.3.3. 1. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. d.3. b. e.2. CH3-C(CH3)2-CH2OH. (4) etil sekunder propil eter. n-butanal. oksidasi 2-butanal. 1. b. Dietil eter dapat dihasilkan dari reaksi: a. [8]. (CH3)2-CH-CH2-CH2OH. d. d.oksidasi 2-butanon. [11]. etena. maka senyawa tersebut adalah: a. [9]. c.3-dietil butana. d. [6]. c. 1. e. dan denganasam asetat terbentuk ester. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. ester. 2. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. b. alkil alkana sulfat. e.4.3.4-dimetil2-heksanol.

Fehling A terdiri dari NaOH dan Cu2O. Fehling B terdiridari NaOH dan kalium natrium tartrat. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. a dan b benar. b. b. Fehling B terdiri dari NaOH. a. reduktor. etil alkohol. c. metil alkohol. metanal. d.mengikat air yang terjadi. e.a.aseton. Pernyataan yang tepat mengenai larutan Fehling adalah: a. b. aseton. reduktor. dan c benar. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. Fehling B terdiridari NaOH dan kalium natrium tartrat. b. b. mengandung senyawa perak dan CuOdalam NaOH. Pada reaksi metil alkohol + asam salisilat. e. [15]. a dan b benar. propanon. e. [14]. e.maka senyawa itu kemungkinan adalah: a. ditambahkanH2SO4 pekat yang maksudnya adalah: a. metanol. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. mengandung CuO dalam kalium natriumtartrat. [16]. c. asetaldehida. supaya teroksidasi.alkanol. d. a. Fehling A terdiri dari CuSO4. mengandung garam perak dalam larutan amoniaberlebih. mengandung CuO dalam larutan kalium natrium tartrat. c. b.[12]. e. d. reduktor. b. oksidator.mengandung garam perak dalam larutan amonia berlebih. [17]. b. . alkanal. [13]. d. mencegah oksidasi.oksidator. metanol. alkanon. c. c. c. Fehling B terdiri dari kaliumnatrium tartrat. formalin. matanal. Pereaksi Tollen bersifat sebagai berikut: a. d. Fehling A terdiridari Cu2O. b. a dan b benar. Fehling B terdiri dari NaOH dan kalium natriumtartrat. b. Suatu senyawa karbon. d. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. dan c benar. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. d. dan c benar. a dan b benar. c. e. Fehling A terdiridari CuSO4 dan NaOH. menggeser kestimbangan reaksi. [18]. e. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a.

(b). ESSAY [1]. a dan b benar.[19]. tuliskan pula masing-masingnamanya ! [3]. metanal denganpereaksi Fehling. d. butil alkohol dengan K2Cr2O7+ H2SO4. Tuliskan reaksi yang terjadi pada: (a). KMnO4 + H2SO4. K2Cr2O7 + H2SO4. c. . asetaldehida + NaOH(aq)+I2(KI aq).pereaksi Tollen. b. demetil keton + NaOH(aq)+ I2(KI aq). Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah: a. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. etil alkohol + NaOH(aq)+ I2(KI aq). (e) formalin dengan pereaksi Tollen.(f). (d). pereaksi Fehling. (c). Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. e.

Pada pemeriksaan daya hantar listrik larutan berikut.. reduktor c.1. Na2SO4 & Na2S 4. 0. natrium perbromat . pada volume yang sama. pereaksi yg mengikat oksigen disebut.1 M CH3COOH b.. hantaran terkecil akan diberikan oleh a.. a. SO3 & SO2 d. HBr c..1 M H2SO4 e. oksidator b.. Menurut kaidah pengikatan & pelepasan oksigen. Bilangan oksidasi Br terendah terdapat dalam. a.. CCl4 e. H2S & H2SO4 b. Pasangan zat berikut yang mengandung S dengan bilangan oksidasi yg sama: a. H2SO3 & H2SO4 e..1 M HCl d. 0. Na2SO3 & SO2 c.05 M H2SO4 2. 0. CO(NH2)2 3.. 0. Larutan senyawa kovalen berikut yang dapat menghantarkan listrik adalah a. redoks d. reduksi e. C12H22O11 b.05 M CH3COOH c. 0. oksidasi 5. C6H6 d.

Suatu zat padat dilarutkan dalam air. CCl4 & HCl . dalam air. Diantara reaksi berikut yg termasuk autoredoks adalah. natrium hipobromit e.. Pernyataan yang tepat untuk menerangkan peristiwa tsb: a.. natrium bromit d. zat padat terurai menjadi ionnya 8.. dalam air. NaCl & HCl d. Diantara pasangan senyawa berikut. ternyata larutan zat tsb dapat menghantar listrik. yang dalam keadaan padat tidak menghantar listrik. dalam air. FeCl3 + H2S e. natrium bromida 6. air menjadi konduktor listrik jika ada zat terlarut c.b. zat padat terurai menjadi atomnya d. CaCl2 + Mg(OH)2 c. Br2 + NaOH SO3 FeCl2 + HCl + S NaBr + NaBrO3 + H2O 7. natrium bromat c. SO2 + H2S S + H2O Ca(OH)2 + MgCl2 b.. air mudah terion jika ada zat padat didalamnya b. a. tapi dalam cair dan larutan dapat menghantar listrik adalah« a. zat padat terurai menjadi molekulnya e. SO2 + O2 d.

MnSO4 sebagai hasil oksidasi e. Persen ionisasi HCl lebih besar daripada CH3COOH 10. HCl adalah senyawa ion. HCl lebih mudah larut daripada H3PO4 e. CH3COOH terion lebih banyak daripada HCl c.. Jumlah atom HCl lebih sedikit daripada CH3COOH d. S dalam H2SO4 mengalami penurunan bilangan oksidasi d. Tentukan biloks unsur yang dicetak tebal& digarisbawahi: .. Pernyataan yang benar dari reaksi diatas adalah. Fe2(SO4)3 sebagai hasil oksidasi ESSAY 1. K2SO4 & CCl4 e. Larutan HCl 1M punya daya hantar listrik lebih baik daripada larutan CH3COOH 1M. Hal itu disebabkan.b. FeSO4 sebagai oksidator c.. K2SO4 & BaCl2 c. CH3COOH senyawa kovalen b. a. a. HCl & KCl 9. KMnO4 sebagai reduktor b. 2 KMnO4 + 10 FeSO4 + 8 H2SO4 K2SO4 + 2 MnSO4 + 5 Fe2(SO4)3 + 8 H2O..

a. NH4ClO3 b. Tentukanlah oksidator. CH3COCH3 e. reduktor. VC2O4 d. hasil reduksi dari reaksi : CrBr3 + NaOH + Cl2 Æ Na2CrO4 + NaBrO4 + NaCl + H2O . NaCNO 2. hasil oksidasi. Cu CO3 c.

Sign up to vote on this title
UsefulNot useful