REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

d. gas berbau amoniak. e. [10]. [7]. e. asam klorida. dan c benar. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. gas tidak berbau. ZnO(s) + NaOH(aq). (c). c. dan c benar. Pada reaksi antara Na2SO3 + HCl . CaCl2(aq) + H2SO4(aq). e. a dan b benar. b. d. dan dengan api gas itu akan meletup adalah: a. Mg. [8]. a. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. SO2 + K2Cr2O7 + H2SO4. Cu + FeSO4. cepat mengendap jika didiamkan. e. partikelnya bersifat antara lain:a. b.id KOLOID MULTIPLE CHOICE [1]. c. HCl. b. e. asam nitrat.net. b. Reaksi berikut ini akan menghasilkan endapan garam. b. e. CaCl2(aq) + Na2CO3(aq). kertas saring menjadi hijau. BaCl2(aq) + Na2CO3(aq). Pernyataan berikut ini yang benar adalah : a. Fe + CuSO4. kecuali: a. gas berbau menyengat. kertas saring menjadi biru. Ba(OH)2(aq) + H2SO4(aq). a dan b benar. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa. a. b. c. c. c. b. a. Ba(OH)2(aq) + HCl(aq). b. c. a dan b benar. Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. dan c benar.tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. (b). Zn + NaOH. Zn. b. c.e. b. Suatu sistem koloid. gas tidak berwarna. [6]. d. . a dan b benar. gas berwarna kuning-coklat. kertas saring menjadi tidak berwarna. d. b. memiliki diameter < 0. kertas saring menjadi hijau. [9]. d. NaOH. a. Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a. e. ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). d. asam sulfat. Logam yang dengan HCl akan menghasilkan gas. dan c benar. [5]. Fe. endapan putih berubah menjadi merah. d.1 mµ. dapat menyala jika ke dalamnya dialiri arus listrik. air kapur + gas CO2 berlebih. HNO3. kertas saring menjadi tidak berwarna. Kunci Jawaban: e-mail ke johanoni@cbn.

suspensi(sabun sebagai emulgator). c.emulsi padat. bersifat sangat stabil. Diketahui belerang tidak dapat larut dalam air. e. c. Diketahui bahwa air tidak dapat bercampur dengan minyak.partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-. dispersi. buih atau busa. dispersi-busur Bredig. [9]. sol. e.b. e. air (kondensasi fisika).hidrofob. Alum yaitu Al2(SO4)3. d. fisika. emulsi (sabun sebagai emulgator). redoks. asap. c. intan hitam dan beberapa jenis mutiara. air laut. e. d. kondensasi-redoks. Sistem koloid yang pelarutnya aseton. santan. d. mentega. d. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. sedikit larut dalam alkohol.tetapi jika diberi sabun secukupnya maka akan terjadi: a. b. Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a. c. susu dan Scott's Emulsion (minyak ikan). [3]. di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya. b. b. .awan dan kabut. aerosol. e. Jika bubuk agar-agar diberi air lalu dimasak.emulsi padat (sabun sebagai koloid pelindung atau emulgator). c. d. belerang disulfida atau alkohol (kondensasi fisika). c. b. kondensasi. e.kondensasi. emulsi. jawaban a dan b benar.[2]. dan c benar. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a. b. [13].hair spray. c. d. e. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . d. e. gel. b. tergolong sebagai: a. e. e. d. c. tinta dan cat. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air. [6]. e. Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan. d. debu. dispersi.suspensi (sabun sebagai koloid pelindung). d. b. b.18H2O. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. liofob-gel. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a. partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-. [11].kondensasi. belerang disulfida atau alkohol (kondensasi kimia). cat kayu atau cat tembok. asap dariknalpot bis. sehingga: a. liofob. liofob-sol. d. [7]. karbon aktif atau norit. hidrolisis. kimia. c. [10]. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. [12].hidrofil. b. Contoh emulsi padat antara lain adalah: a. emulsi padat. air dan diberi emulgator (emulsi padat). air (kondensasi kimia). dan agak larut dalam belerang disulfida. e. suspensi.jawaban a. gel. d.hidrosol. [5]. dispersi-mekanis. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. [4]. b. cat semprot (Pylox). kaca warna. mutiara. emulsi (sabun sebagai koloid pelindung). b. b. [8]. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a. hidrosol. c. c. sol. c. liofil-gel. keju dan mutiara. dapat digolongkan sebagai: a.

ke dalam sistem koloid dimasukkan suatu elektrolit. b. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6. sistem koloid dipanaskan.c. . Kunci Jawaban: e-mail ke koloid@a03jkt. propil etanoat. dietileter.3-metil 2-butanol.3-dimetilbutanoat. kecuali:a. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1]. [2]. [15]. 3-pentanol. propilpropanoat. alkana dengan sikloalkana. b. 2. dua macam koloid bermuatan berlawanan dicampurkan. Senyawa 2-metil butanal berisomer dengan: a. e.b. Alkoholtersebut adalah: a. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. d. c. b. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain.[14].zat (bukan koloid) untuk mencegah koagulasi suatu koloid . d. b. CH3-C(CH3)2-CH2OH. c. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5.e. propana etana karboksilat. propana etilkarboksilat. alkena dengan sikloalkana.d. (CH3)2-CH-CH2-CH2OH. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4. CH3-(CH2)2-CHOH-CH3. b. zat (berupa koloid) untuk membuat emulsi. [5]. 2. zat(bukan koloid) untuk membuat emulsi. d.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan. d. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. e. b. c.c. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. dietil keton.e.3-metil butana 2-karboksilat. 2.or.3-dimetil butirat. [3]. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. Koloid pelindung adalah merupakan: a. c.bpkpenabur.id (ini pelayanan gratis !) ESSAY 1. eter dengan alkohol. Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3. CH3-(CH2)3-CH2OH. etil isopropil eter. d. etil propil karboksilat. c. alkanal dengan alkanon.3-dimetilpropana karboksilat. Oksidasi suatu alkohol menghasilkan 3-metil butanal. e. Senyawa berikut ini yang tidak dapat berisomeradalah: a. e. d. alkanoat dengan ester. zat penolong (berupa koloid) untuk membuat emulsi. CH3-CH2-CHOH-CH2-CH3. Peristiwa koagulasi dapat terjadi sebagai berikut. 2-metil butana 3-karboksilat. e. [4].

tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. alkil alkana sulfat.oksidator. a. d. dietil keton. e.d.4. alkanal. Pernyataan yang tepat mengenai larutan Fehling adalah:a. 3. c.4.3. c. 1.dietil eter. etanol dengan etanoat. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. e. e. Penamaanyang benar semuanya terdapat pada: a. b.(3) 2-propoksi etana. (2) 2-etoksi propana. oksidator.metanol. [18]. matanal. dan denganasam asetat terbentuk ester. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. [16].3. [17].2. c. metanol. supaya teroksidasi. c.mengandung garam perak dalam larutan amonia berlebih. mengandung CuO dalam larutan kalium natrium tartrat. n-butanal. Fehling A terdiri dari CuSO4. b. c.3-dietil butana. d. b. 1.[6]. etil alkohol. Etil asetat berisomer dengan senyawa berikut ini. Dietil eter dapat dihasilkan dari reaksi: a. [9]. mencegah oksidasi. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. b. b.c. d.n-butanol. 2. d.Fehling A terdiri dari NaOH dan Cu2O. 2. Fehling B terdiri dari kaliumnatrium tartrat. reduktor. metanal.4-dimetil2-heksanol.2. butanoat.2. b. b. c. c. Fehling B terdiridari NaOH dan kalium natrium tartrat. oksidasi2butanol. [14]. tersier butil alkohol.2-dimetil propana. menggeser kestimbangan reaksi. b. b. b. mengandung garam perak dalam larutan amoniaberlebih. e. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. c. Fehling B terdiri dari NaOH dan kalium natriumtartrat.maka senyawa itu kemungkinan adalah: a.aseton.mengikat air yang terjadi. Fehling A terdiridari Cu2O. maka senyawa tersebut adalah: a. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. etena. ester. 2-metil propanoat. Fehling A terdiridari CuSO4 dan NaOH. a dan b benar. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a.dietil eter. [10].3-dimetil 2-butanon. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. 1. d. Pada reaksi metil alkohol + asam salisilat. [15]. 2. propil metanoat. metil alkohol.4. d. Fehling B terdiri dari NaOH. [11]. a.4. Fehling B terdiridari NaOH dan kalium natrium tartrat. e. alkanon.oksidasi 2-butanon. e. a dan b benar. ditambahkanH2SO4 pekat yang maksudnya adalah: a. b. metil propanoat.propanon. b. e.3. c. b. (4) etil sekunder propil eter. c. b. d. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. d. oksidasi 2-butanal. Pereaksi Tollen bersifat sebagai berikut: a.c. n-butanon. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. e. dan c benar. [7]. dan c benar.a. etil etana karboksilat.3-dimetil pentanal. 2. [8]. asetaldehida. a dan b benar. Suatu senyawa karbon. b.alkanol. e. e. e. c. e.3. tak dapat dioksidasi. etanoldengan asam sulfat pekat. .3. 1. [13].aseton. d. a dan b benar. [12]. b. dan c benar. d. d. d. kecuali:a. formalin.

CuSO4 0. jumlah mol zat terlarut dalam 1 L larutan c. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a. Tuliskan reaksi yang terjadi pada: (a).3M c. Na2CO3 0. banyak sedikitnya larutan 5. ESSAY [1].03 molal adalah sama. tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e. banyaknya partikel zat terlarut d. (e) formalin dengan pereaksi Tollen.2M 2. K2Cr2O7 + H2SO4. titik beku pelarutnya lebih rendah daripada titik beku larutannya c.(f). Harga kenaikan titik didih molal (Kb) bergantung pada: a.id Kembali ke Kimia SMU Home Page . demetil keton + NaOH(aq)+ I2(KI aq). jumlah g zat terlarut dalam 1 L larutan b. mengandung CuO dalam kalium natriumtartrat.b. KMnO4 + H2SO4.2M b. Kunci Jawaban: e-mailke johanoni@cbn. glukosa 0. Titik didih larutan CaCl2 0. warna zat pelarut c. (b). asetaldehida + NaOH(aq)+I2(KI aq). c.pereaksi Tollen.net. mengandung senyawa perak dan CuOdalam NaOH. keduanya adalah nonelektrolit . butil alkohol dengan K2Cr2O7+ H2SO4. CH3COOH 0. reduktor.8M e. Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a. tuliskan pula masing-masingnamanya ! [3]. Mg(NO3)2 0. metanal denganpereaksi Fehling. keduanya bukan elektrolit b. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. massa jenis larutan b. jenis partikel zat terlarut e. jumlah mol zat terlarut dalam 1 L pelarut d. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a. e. karena: a. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. etil alkohol + NaOH(aq)+ I2(KI aq).5 M d. (d). jumlah mol zat terlarut dalam 1000 g larutan e. pH pelarutnya lebih besar daripada pH larutannya 3. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b. (c).01 molal dan titik didih larutan glukosa (C6H12O6) 0. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. a dan bbenar. e. jumlah mol zat terlarut dalam 1000 g pelarut 4.reduktor. [19]. pereaksi Fehling. d.

5 M d. merupakan elektrolit biner dalam b. hipertonik d. 1 g NaCl dalam 1 L larutan e.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. Sebanyak 3.046 C° . Jika penurunan titik beku molal air 1.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL. monotonik 7. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a. Berapa tekanan uap jenuh 100mL larutan 0. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. Mg(NO3)2 0. titik didih pelarut lebih rendah daripada titik didih larutannya b. isotonik b. supertonik e. Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a.86 C°. Ba(NO3)2 0. n disebut faktor van't Hoff 2x e. 1 g NaCl dalam 1 L larutan 9. derajat ionisasi = 1 c. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. 1 mol NaCl dalam 1000 g larutan c. NaCl 0. massa jenis pelarut lebih besar daripada massa jenis larutannya 10. Na2CO3 0.3M b.2M c.125 g/mL dan massa molekul relatif elektrolit 125. glukosa 0. n = 2 d. hipotonik c.3M e. jumlah partikel larutan menjadi II. Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a. 1 mol NaCl dalam 1000 g pelarut b. AlCl3 0. ESSAY 1. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! . NaCl 1m artinya: a.2M b. massa jenis larutan 1. Tekanan osmotiknya = 15. I. Ca(NO3)2 ------> Ca2+ + 2NO3a.1 mol suatu asam lemah bervalensi satu dalam 88.8M e.2M 11. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g. keduanya adalah elektrolit kuat d.2M 8. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d. maka larutan A terhadap larutan B disebut: a. 1 mol NaCl dalam 1 L larutan d. berapakah Mr zat non-elektrolit tersebut ? 3.2 g air pada p dan t yang sama? Ka = 1 x 10-7. CuSO4 0. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2. titik beku pelarut lebih tinggi daripada titik beku larutannya c. jumlah partikel yang ada dalam kedua larutan sama banyak e.3M c. CH3COOH 0. Berapa tekanan uap jenuh larutan 10. C6H12O6 0. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e.c. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6.1M d. hitunglah derajat pengionan elektrolit tersebut ! 3. CO(NH2)2 0.2 cmHg. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg.

[g]/Kb d. pernyataan yang salah adalah: a.[g]/Kw e. harga Kw tetap tidak berubah b. perubahan suhu 6. kecuali: a. penambahan asam c. Pada larutan asam fosfat 0. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. [H ] = (Kw) . asam kuat + basa kuat b. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini. NH4Cl c. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a. asam kuat + basa lemah e. 10-12M d. derajat ionisasinya c. [H+] ={ [asam] x K1}½ d. penambahan basa d. asam lemah berlebih + basa kuat c. asam lemah + basa lemah d. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. jenis pelarutnya b. NaHSO4 b. perubahan tekanan e. kesetimbangan air akan bergeser d. asam lemah + basa sangat lemah berlebih d. asam sangat lemah + basa sangat lemah c. volumenya 7. NaOH merupakan basa pekat karena mudah larut dalam air c.1M .9 x 10-3 . dan K3 = 4. Harga tetapan kesetimbangan air dapat berubah oleh: a. CH3COONa 3. konsentrasinya e. umumnya dipakai air sebagai pelarut.5 x10-3M b. Dalam kesetimbangan asam-basa. larutan asam akan mengurangi [OH-] dalam air. 5 x 10-3M c. HCl d. asam sangat lemah + basa lemah berlebih e. [H+] = (Kb)½. dari data itu pengaruh K2 dan K3 tidak berarti e. [H+]3 = [PO43-] b. Konsentrasi ion OH. tidak ada 2. 10-2M e.1. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. maka yang pH nya paling tinggi: a.Ka/Kw b. asam kuat + basa lemah berlebih b. (NH4)2SO4 e. Ka = K1 x K2 x K3 c. K2 = 6. Larutan HCl merupakan asam kuat karena akan terion sempurna d. 2. harga Kw berubah. Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. karena Kw tetap e. [H+] = (Kb)½. Larutan penyangga dapat terjadi sebagai berikut.Ka/Kb 10. karena pH berubah c.dalam larutan H2SO4 0.3 x 10-8. Pernyataan yang benar di antara pernyataan berikut ini adalah: a. penambahan garam b. jika diketahui K1 = 5. karena Kw tetap 8. larutan basa akan mengurangi [H+] dalam air. Jika zat di bawah ini konsentrasinya 1 M. Ka nya d.005 N adalah: a.Ka + ½ c. asam lemah + basa kuat 4. asam sangat lemah berlebih + basa lemah .4 x 10-13. [H+] = (Kb)½/Kw. NH4OH merupakan basa kuat karena mudah larut dalam air b. [H+] = (Kw)½. kecuali: a.

Hitunglah! a. Pada percobaan panas reaksi. NH3 adalah basa karena sebagai akseptor elektron e.1 kkal/mol d.5M. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). H3O+ d.1M = 3. Hitung derajat pengionan asam itu ! 5.1 kkal/mol. zat yang merupakan asam sangat kuat adalah: a. 1200 kal/mol e.11. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a. Derajat ionisasi asam tersebut adalah 3%. 2. terjadi perubahan suhu dari 30°C menjadi 35°C. O=O.c. NH3 adalah basa karena sebagai donor elektron II. Diketahui pH CH3COOH 0. 10 kkal/mol b.1 N mempunyai pH = 3 . massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. H3O+ 14.02 N dengan 400 ml HNO3 0. Dalam hal ini pernyataan yang tidak sesuai adalah: a. ESSAY 1.1 kkal/mol b. NH3 adalah basa karena sebagai donor proton d. HCl e. Hf CO2(g) = -94. Energi ikatan CO2(g) = +94.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0.log 3. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0. tidak ada 13. Berapa K1 asam itu ? 2.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. dibebaskan kalor sebesar 94.b. NH3 adalah basa karena sebagai akseptor proton c. H2O c. berdasarkan konsep Bronted-Lowry. maka kalor yang dibebaskan adalah: a. jika 1. Cle. 20 kkal/mol 3. Larutan asam fosfat 0.4 kkal/mol d. Hr = -94. Bila 1 mol gas CO2 = 30 L. Pada reaksi C(s) + O2(g) -----> CO2(g). Hc C(s) = -94. NaCl d. HCO3. HCl + H2O -------> H2O+ + Cl-. NH3 adalah basa karena dapat mengikat H b. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. pernyataan yang salah berdasarkan teori Lewis: a.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3. berapa L HCl 0. PO43. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4. a dan b benar e.1 kkal/mol 2.0 kkal/mol c.1 kkal c.01 N ! I. HCl b. Jika diketahui energi ikatan rata-rata H-H. a dan c benar 12. Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e. (NH4)2CO3 b. H-O. NH3 + HCl ------> NH4Cl. pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a. NaOH d. NH4Cl c. berapa mL HCl 0. 1. berturut-turut adalah 104 .

1 kkal/mol c. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a.8 kJ/mol 9.32 kkal e. maka kalor pembentukan natrium oksida adalah: a. jawaban b dan c benar c.2 J/g°C. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g. Jika kalor pembentukan H2O(l) 68400 kal. 91. -2100 kJ 5. Jika diketahui Hf HCl = -92. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ. H2(g) + ½O2(g) ---> H2O(l) b. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ. 504 kJ/mol b. 14.5 g e. dipanaskan selama lima menit hingga suhu akhir 55°C. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a.2 kkal 10. +30 kJ c. kalor pembakaran C2H5OH = +1380 kJ. 12. Pada percobaan panas reaksi. C(g) + ¼S8(g) -----> CS2(g) d. 2 kkal/mol 6. Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH). 2H2(g) + O2(g) -----> 2H2O(g) 8. 110 kkal/mol.5 kkal b. -720 kJ d. C(s) + 2S(s) -----> CS2(g) 7. 2H(g) + O(g) ---> H2O(g) e.6 kJ/mol c.6 g c. 100.05M. 100 kkal/mol b. -30 kJ b.5 kkal/mol e.5 kJ/mol. 81. Untuk itu digunakan 50 mL air yang suhunya 25°C. Diketahui kalor jenis air = 4. 2H(g) + O(g) ----> H2O(l) d. 16. O = 16) a. 36. 50. maka kalor yang dibebaskan adalah: a. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi. 25.5 kkal d. 119 kkal/mol.64 kkal d. 73 g O // . -28. OH-(aq)+ H+(aq) --->H2O(l) c. 218.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. Mr metanol = 32. 0. +7200 kJ e. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. -113 kkal c. C(s) + 2S(s) -----> CS2(l) e. 0. -3 kkal 4.24 kkal/mol d.3 kkal e. 7.4 kJ/mol e. jika 0.2 kJ/mol d. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a. -56. 0. terjadi perubahan suhu dari 30°C menjadi 35°C. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C.3 g b.kkal/mol. C(g) + 2S(g) -----> CS2(g) b.2 g d. 29.4 kkal b. 36. Kalor pembakaran metanol itu adalah: a. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18.800 kal. -184. Bila 1 mol gas CO2 = 30 L. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal.12 kkal c.

Setelah reaksi berlangsung 2 detik. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C . Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L . a dan c benar c. 1. konsentrasi zat hasil reaksi d.25 x 10-5 mol/L. 1.25 detik d.7 kkal d. pernyataan yang benar adalah: a.5 kkal 12. 0. -14.det d. laju pembentukan B = 0.C-. Pada reaksi penguraian A2B2 -----> 2A + 2B.dt pada suhu 30°C. 3a dan 27a e. dan OH = 110. laju pembentukan A = 0. -24. 1. 27/64 k d.4. Jika konsentrasi P dan Q mula-mula 1 mol/L.1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173.11. Diketahui reaksi CH3.8 detik c. laju penguraian A2B2 = 0. konsentrasi A2B2 menjadi 0. konsentrasi zat hasil reaksi e.50 x 10-5 mol/L. -31. 0. C-O = 85 kkal/mol.1 b.2 M dt-1 6. Setelah berapa detik gas Br2 tinggal 8 mol ? a.0 detik .det -5 c. 1/8 k c.det e.6 M dt-1 c. 10.3 kkal/mol dan energi ikatan ratarata C-C = 83.H + H2 ------> CH2-CH2-OH.6 kkal/mol.2 M dt-1 b. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a.625 detik b.1 kkal/mol. 0. 1/16 k b.4molar. Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g). Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a.00 x 10-5 mol/L.1 e. a dan b benar b.0 detik e.0 dan -52. . Jika diketahui energi ikatan rata-rata C-H = 99. konsentrasi pereaksi 4. -36.3 kkal c. 1/3 a dan 27a b. 1/3 a dan 9a 7.9 kkal b. 0. Jika energi ikatan C=O = 173 kkal/mol.det 2. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0. Pada suhu tertentu.6 M dt-1 d. maka pada saat konsentrasi P tinggal 3/4 mol/L. a dan b benar b.det.8 c. -42. maka perubahan entalpi reaksi itu adalah: a.2 kkal/mol. 3/8 k 5. H-H = 104. -17.3 kkal/mol. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]². laju pembentukan A = 1. Laju pembentukan NO2 adalah: a. -26. konsentrasi pereaksi e.50 x 10-5 mol/L. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a.4 M dt-1 e.1 I. 0. 8. Setelah 5 detik masih ada 5 mol gas NO. laju reaksinya adalah: a. b dan c benar c. 37a dan 3a c.det b. tahapan reaksi 3.75 x 10 mol/L. luas permukaan kontak d. 27a dan 1/3 a d. -16.50 x 10-5 mol/L. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2. 3/16 k e. -32 kkal e. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1.1 d. laju penguraian A2B2 = 0. Konsentrasi A2B2 mula-mula 1 molar. C-H = 99.

18. 3. rumus kecepatan reaksi itu b. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a. a dan b benar II. 6. H2O2 d.+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a.8.3 x 10-12 b.4 0. 0.2 detik d.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a. 28. pada suhu tinggi c.3 x 10-6 c. IOb.4 0. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit.2 x 10-9 9. Ic.24 0.4 mol gas O2.8 detik e.5 mol belerang dan 0.01 0.25 x 10-7 e. 37. 320 menit b. Saat 50% gas O2 berubah dan k = 1.5 x 10-6 d.24 0.2 detik 10. Essay [nilai 2 per soal] 1. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat. H2O e. Suatu reaksi berlangsung dalam dua tahap berikut: I. IO. Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0. tingkat reaksi total 2.48 0. Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0.3 x 10-3.24 [H+] awal mol/L 0.01 0. 8. pada suhu kamar b.01 0.8 0. 83.5 detik c. diberi katalis .------> H2O + IOII.8 [Br-] awal mil/L 0. maka kecepatan reaksinya adalah: a. 1. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a. H2O2 + I.

Sign up to vote on this title
UsefulNot useful