REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

b. a dan b benar. e. kertas saring menjadi tidak berwarna. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. Reaksi berikut ini akan menghasilkan endapan garam. endapan putih berubah menjadi merah. e.tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. e. a. ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. e. CaCl2(aq) + H2SO4(aq). e. memiliki diameter < 0. Ba(OH)2(aq) + HCl(aq).net. b. asam sulfat. gas tidak berwarna. asam nitrat. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. a. . CaCl2(aq) + Na2CO3(aq). Zn + NaOH. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa. gas berbau menyengat.id KOLOID MULTIPLE CHOICE [1].e. c. [7].1 mµ. gas berwarna kuning-coklat. d. partikelnya bersifat antara lain:a. d. d. b. a dan b benar. Kunci Jawaban: e-mail ke johanoni@cbn. a dan b benar. dan c benar. cepat mengendap jika didiamkan. a. d. dan dengan api gas itu akan meletup adalah: a. [8]. kertas saring menjadi tidak berwarna. c. a. c. b. a dan b benar. (b). e. BaCl2(aq) + Na2CO3(aq). c. c. ZnO(s) + NaOH(aq). Suatu sistem koloid. b. air kapur + gas CO2 berlebih. d. [5]. b. Zn. c. gas tidak berbau. b. gas berbau amoniak. dan c benar. b. c. Cu + FeSO4. Logam yang dengan HCl akan menghasilkan gas. [9]. d. b. dan c benar. [10]. Pada reaksi antara Na2SO3 + HCl . HNO3. (c). b. dapat menyala jika ke dalamnya dialiri arus listrik. dan c benar. kertas saring menjadi hijau. kecuali: a. Mg. asam klorida. HCl. e. Pernyataan berikut ini yang benar adalah : a. b. SO2 + K2Cr2O7 + H2SO4. [6]. kertas saring menjadi biru. d. NaOH. Fe. Ba(OH)2(aq) + H2SO4(aq). Fe + CuSO4. kertas saring menjadi hijau. Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a.

partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-.emulsi padat. [5]. e. b. d. buih atau busa. c. c.partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-. c. d. cat semprot (Pylox). c. b. [3]. jawaban a dan b benar.kondensasi. belerang disulfida atau alkohol (kondensasi fisika). Alum yaitu Al2(SO4)3. hidrolisis. b. suspensi(sabun sebagai emulgator). c. kondensasi-redoks. d. e. c. b. hidrosol. c. c. Diketahui bahwa air tidak dapat bercampur dengan minyak. kimia. intan hitam dan beberapa jenis mutiara. [12]. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. c. dispersi. e. dan agak larut dalam belerang disulfida. e. dispersi-mekanis. d. sol. b. emulsi (sabun sebagai koloid pelindung). debu. asap dariknalpot bis. gel. e. sedikit larut dalam alkohol. d.tetapi jika diberi sabun secukupnya maka akan terjadi: a. dan c benar.emulsi padat (sabun sebagai koloid pelindung atau emulgator). c. d. bersifat sangat stabil. Jika bubuk agar-agar diberi air lalu dimasak. c. cat kayu atau cat tembok. Diketahui belerang tidak dapat larut dalam air. [10].18H2O. karbon aktif atau norit. d. b. kaca warna. emulsi. d. kondensasi. liofil-gel. Sistem koloid yang pelarutnya aseton. b. di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. air dan diberi emulgator (emulsi padat). e. Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a. b. mentega. c. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. sehingga: a. fisika. e. [8]. [9]. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . liofob-gel.kondensasi. e. b.[2]. air (kondensasi kimia). air laut. [11]. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a. asap. tinta dan cat. emulsi padat. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a. mutiara. [7].suspensi (sabun sebagai koloid pelindung). belerang disulfida atau alkohol (kondensasi kimia). dispersi-busur Bredig. e. Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. redoks. [13]. [6]. dapat digolongkan sebagai: a. gel. b. d.hidrofil. liofob-sol. e. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air.b. b. d. sol. susu dan Scott's Emulsion (minyak ikan). tergolong sebagai: a. emulsi (sabun sebagai emulgator). d. air (kondensasi fisika). Contoh emulsi padat antara lain adalah: a.hidrosol. e. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a.hidrofob. santan. . e. b.jawaban a. keju dan mutiara.awan dan kabut. liofob.hair spray. [4]. dispersi. aerosol. d. suspensi.

3-dimetil butirat. propana etana karboksilat. c.b. Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3.3-dimetilpropana karboksilat. propilpropanoat. [4]. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. etil isopropil eter. ke dalam sistem koloid dimasukkan suatu elektrolit. d. [5]. dietil keton. e. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. Senyawa 2-metil butanal berisomer dengan: a. (CH3)2-CH-CH2-CH2OH. Koloid pelindung adalah merupakan: a.3-metil 2-butanol.zat (bukan koloid) untuk mencegah koagulasi suatu koloid . kecuali:a. Oksidasi suatu alkohol menghasilkan 3-metil butanal. . zat(bukan koloid) untuk membuat emulsi.d.c.3-dimetilbutanoat. CH3-CH2-CHOH-CH2-CH3. CH3-(CH2)3-CH2OH. 2. Peristiwa koagulasi dapat terjadi sebagai berikut.c. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4.e. alkena dengan sikloalkana.[14]. e. e. c. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. c. d. c. [2]. 3-pentanol. zat (berupa koloid) untuk membuat emulsi. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain. Alkoholtersebut adalah: a. 2. b.e. etil propil karboksilat. CH3-(CH2)2-CHOH-CH3. b. [15]. 2-metil butana 3-karboksilat. b.id (ini pelayanan gratis !) ESSAY 1. alkana dengan sikloalkana. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6. alkanoat dengan ester.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5. dua macam koloid bermuatan berlawanan dicampurkan. b. zat penolong (berupa koloid) untuk membuat emulsi. propil etanoat. alkanal dengan alkanon. propana etilkarboksilat. d. [3]. Senyawa berikut ini yang tidak dapat berisomeradalah: a. 2. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. b. e. sistem koloid dipanaskan. Kunci Jawaban: e-mail ke koloid@a03jkt. d. CH3-C(CH3)2-CH2OH. eter dengan alkohol. c. b.3-metil butana 2-karboksilat.bpkpenabur. d. d. e. dietileter. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1].or.

d. d. e. metil alkohol. menggeser kestimbangan reaksi.mengandung garam perak dalam larutan amonia berlebih. c. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a.propanon. d. e. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a.(3) 2-propoksi etana. Pada reaksi metil alkohol + asam salisilat. 2. a dan b benar. 2. b. d.d. b. b. maka senyawa tersebut adalah: a. metanol. c.maka senyawa itu kemungkinan adalah: a. e. formalin.2. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. dan denganasam asetat terbentuk ester.3. a dan b benar. [15]. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. 2-metil propanoat. [16]. Dietil eter dapat dihasilkan dari reaksi: a. e. e. e. c. dan c benar. b. a dan b benar. c. oksidator.metanol. e.[6]. tersier butil alkohol. c. 2. Penamaanyang benar semuanya terdapat pada: a. Pernyataan yang tepat mengenai larutan Fehling adalah:a. mencegah oksidasi.2. etanoldengan asam sulfat pekat. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. Suatu senyawa karbon. b. asetaldehida. 1. e. alkanal.2. Fehling B terdiri dari kaliumnatrium tartrat. c. c.3. d. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi.c. b. Fehling A terdiridari Cu2O. tak dapat dioksidasi. [9].4-dimetil2-heksanol.3-dimetil pentanal. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. etanol dengan etanoat. c.dietil eter. [13].2-dimetil propana. 1. butanoat.aseton. b. [10]. dan c benar. etena. a. Fehling A terdiri dari CuSO4.mengikat air yang terjadi.3-dimetil 2-butanon. Fehling A terdiridari CuSO4 dan NaOH.n-butanol. [12]. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. dan c benar. . Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. d. d. dietil keton. alkanon. metil propanoat. oksidasi2butanol. oksidasi 2-butanal.3. n-butanal. e. alkil alkana sulfat. b. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a.4.4. c. c.c. 2. [18]. ester.dietil eter. d. b. b. supaya teroksidasi. e. Fehling B terdiridari NaOH dan kalium natrium tartrat. d. matanal. n-butanon.3-dietil butana. kecuali:a. reduktor.a.aseton. a dan b benar.Fehling A terdiri dari NaOH dan Cu2O. d. [14]. b. (4) etil sekunder propil eter. c. [7]. 3.alkanol. b. (2) 2-etoksi propana. b. d. metanal. Fehling B terdiri dari NaOH. Pereaksi Tollen bersifat sebagai berikut: a. Fehling B terdiri dari NaOH dan kalium natriumtartrat. etil etana karboksilat. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. e.4. e. mengandung garam perak dalam larutan amoniaberlebih.oksidator.3. a. ditambahkanH2SO4 pekat yang maksudnya adalah: a. Etil asetat berisomer dengan senyawa berikut ini.4. 1. b. propil metanoat. b. [8]. 1. mengandung CuO dalam larutan kalium natrium tartrat.oksidasi 2-butanon.3. [17]. [11]. etil alkohol. d.

butil alkohol dengan K2Cr2O7+ H2SO4.5 M d. a dan bbenar. banyak sedikitnya larutan 5. Harga kenaikan titik didih molal (Kb) bergantung pada: a. reduktor. KMnO4 + H2SO4.3M c. jumlah mol zat terlarut dalam 1 L larutan c.01 molal dan titik didih larutan glukosa (C6H12O6) 0. etil alkohol + NaOH(aq)+ I2(KI aq). Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a. massa jenis larutan b. keduanya adalah nonelektrolit . glukosa 0. ESSAY [1]. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. demetil keton + NaOH(aq)+ I2(KI aq). Titik didih larutan CaCl2 0.2M 2. jumlah g zat terlarut dalam 1 L larutan b. (c).(f). (e) formalin dengan pereaksi Tollen. CuSO4 0. pereaksi Fehling. keduanya bukan elektrolit b. [19]. Mg(NO3)2 0. (b). banyaknya partikel zat terlarut d. e. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a.reduktor. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b. CH3COOH 0. pH pelarutnya lebih besar daripada pH larutannya 3. tuliskan pula masing-masingnamanya ! [3]. mengandung CuO dalam kalium natriumtartrat. titik beku pelarutnya lebih rendah daripada titik beku larutannya c.03 molal adalah sama. Na2CO3 0. K2Cr2O7 + H2SO4.2M b. e. c.8M e. Tuliskan reaksi yang terjadi pada: (a). jumlah mol zat terlarut dalam 1000 g pelarut 4.net. (d).id Kembali ke Kimia SMU Home Page . mengandung senyawa perak dan CuOdalam NaOH. asetaldehida + NaOH(aq)+I2(KI aq). tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e. jenis partikel zat terlarut e. warna zat pelarut c.pereaksi Tollen. d. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1.b. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. jumlah mol zat terlarut dalam 1000 g larutan e. jumlah mol zat terlarut dalam 1 L pelarut d. Kunci Jawaban: e-mailke johanoni@cbn. metanal denganpereaksi Fehling. karena: a. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a.

jumlah partikel yang ada dalam kedua larutan sama banyak e. n disebut faktor van't Hoff 2x e. isotonik b. Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g.1M d. titik beku pelarut lebih tinggi daripada titik beku larutannya c. monotonik 7. 1 mol NaCl dalam 1000 g larutan c. massa jenis larutan 1. NaCl 1m artinya: a.5 M d.3M c.8M e. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d. Berapa tekanan uap jenuh larutan 10. Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a.125 g/mL dan massa molekul relatif elektrolit 125.2M 11.046 C° .3M b. titik didih pelarut lebih rendah daripada titik didih larutannya b. Ca(NO3)2 ------> Ca2+ + 2NO3a. merupakan elektrolit biner dalam b. 1 g NaCl dalam 1 L larutan e. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! .3M e. CO(NH2)2 0. Tekanan osmotiknya = 15. Na2CO3 0. jumlah partikel larutan menjadi II. derajat ionisasi = 1 c. berapakah Mr zat non-elektrolit tersebut ? 3. hitunglah derajat pengionan elektrolit tersebut ! 3. maka larutan A terhadap larutan B disebut: a. hipertonik d. glukosa 0. keduanya adalah elektrolit kuat d. 1 mol NaCl dalam 1000 g pelarut b.2 cmHg.2M c. C6H12O6 0. AlCl3 0. Berapa tekanan uap jenuh 100mL larutan 0.c. I. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2.2 g air pada p dan t yang sama? Ka = 1 x 10-7.86 C°. 1 mol NaCl dalam 1 L larutan d. Ba(NO3)2 0. CH3COOH 0.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg.2M 8. massa jenis pelarut lebih besar daripada massa jenis larutannya 10.1 mol suatu asam lemah bervalensi satu dalam 88. n = 2 d. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e. ESSAY 1. Jika penurunan titik beku molal air 1. NaCl 0.2M b. CuSO4 0. supertonik e. hipotonik c. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. 1 g NaCl dalam 1 L larutan 9. Mg(NO3)2 0. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6. Sebanyak 3. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg.

NaHSO4 b. Konsentrasi ion OH. konsentrasinya e. Harga tetapan kesetimbangan air dapat berubah oleh: a. K2 = 6. jika diketahui K1 = 5. maka yang pH nya paling tinggi: a. [H+] = (Kb)½/Kw. karena Kw tetap 8. kecuali: a. perubahan suhu 6. karena Kw tetap e. asam sangat lemah + basa sangat lemah c. dan K3 = 4. 2. Dalam kesetimbangan asam-basa. penambahan asam c.9 x 10-3 . [H+] ={ [asam] x K1}½ d. harga Kw berubah.3 x 10-8. [H+] = (Kb)½.4 x 10-13. 10-12M d.[g]/Kw e.Ka + ½ c. Larutan penyangga dapat terjadi sebagai berikut.1. Larutan HCl merupakan asam kuat karena akan terion sempurna d. CH3COONa 3. [H+] = (Kw)½.005 N adalah: a. volumenya 7. 10-2M e. Ka = K1 x K2 x K3 c. dari data itu pengaruh K2 dan K3 tidak berarti e. HCl d. asam lemah + basa kuat 4. asam sangat lemah berlebih + basa lemah . NH4Cl c. kecuali: a. karena pH berubah c. asam lemah + basa sangat lemah berlebih d. (NH4)2SO4 e. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. [H+] = (Kb)½. larutan basa akan mengurangi [H+] dalam air. penambahan basa d. asam lemah + basa lemah d. [H ] = (Kw) . Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. derajat ionisasinya c. penambahan garam b. 5 x 10-3M c.1M . Pernyataan yang benar di antara pernyataan berikut ini adalah: a. Ka nya d. jenis pelarutnya b.Ka/Kb 10. tidak ada 2. pernyataan yang salah adalah: a. asam kuat + basa lemah berlebih b. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini. [H+]3 = [PO43-] b. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a. Pada larutan asam fosfat 0. harga Kw tetap tidak berubah b. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a. umumnya dipakai air sebagai pelarut. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. asam sangat lemah + basa lemah berlebih e. larutan asam akan mengurangi [OH-] dalam air. NH4OH merupakan basa kuat karena mudah larut dalam air b. asam kuat + basa kuat b. perubahan tekanan e. asam kuat + basa lemah e. kesetimbangan air akan bergeser d. NaOH merupakan basa pekat karena mudah larut dalam air c.5 x10-3M b.dalam larutan H2SO4 0.Ka/Kw b. asam lemah berlebih + basa kuat c.[g]/Kb d. Jika zat di bawah ini konsentrasinya 1 M.

Bila 1 mol gas CO2 = 30 L. HCl b. Cle. H-O. Pada percobaan panas reaksi. terjadi perubahan suhu dari 30°C menjadi 35°C. NaCl d. berturut-turut adalah 104 . pernyataan yang salah berdasarkan teori Lewis: a.log 3. zat yang merupakan asam sangat kuat adalah: a. H3O+ 14. 20 kkal/mol 3. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4. maka kalor yang dibebaskan adalah: a.1M = 3. berdasarkan konsep Bronted-Lowry. NH3 adalah basa karena sebagai akseptor elektron e. jika 1. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. Jika diketahui energi ikatan rata-rata H-H.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. Energi ikatan CO2(g) = +94. Hitung derajat pengionan asam itu ! 5. Berapa K1 asam itu ? 2. 2. 1200 kal/mol e. Dalam hal ini pernyataan yang tidak sesuai adalah: a. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). HCO3. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a. Diketahui pH CH3COOH 0. HCl + H2O -------> H2O+ + Cl-. NaOH d. Derajat ionisasi asam tersebut adalah 3%. ESSAY 1. NH4Cl c.0 kkal/mol c. NH3 adalah basa karena sebagai akseptor proton c.1 kkal/mol. Pada reaksi C(s) + O2(g) -----> CO2(g). a dan c benar 12.Hitunglah! a. NH3 adalah basa karena sebagai donor elektron II.1 kkal/mol 2.c.01 N ! I. NH3 + HCl ------> NH4Cl.1 kkal c.4 kkal/mol d.1 kkal/mol b. NH3 adalah basa karena sebagai donor proton d. H3O+ d. PO43. Hr = -94. berapa L HCl 0.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. H2O c. 1. O=O. tidak ada 13. Hf CO2(g) = -94.b.1 kkal/mol d. HCl e. dibebaskan kalor sebesar 94.1 N mempunyai pH = 3 . Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e. pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a. Hc C(s) = -94.5M. berapa mL HCl 0.11. Larutan asam fosfat 0. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3. NH3 adalah basa karena dapat mengikat H b. a dan b benar e. (NH4)2CO3 b. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C.02 N dengan 400 ml HNO3 0. 10 kkal/mol b.

3 g b. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. -2100 kJ 5. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a. 91. 16.3 kkal e. 25. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a. C(s) + 2S(s) -----> CS2(l) e. maka kalor pembentukan natrium oksida adalah: a. +30 kJ c. +7200 kJ e. -3 kkal 4.2 J/g°C. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ.32 kkal e. Mr metanol = 32. 2H(g) + O(g) ---> H2O(g) e. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi. Jika diketahui Hf HCl = -92. 36. -28.1 kkal/mol c. 0. 218. 2 kkal/mol 6. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal. Kalor pembakaran metanol itu adalah: a.05M. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. 14.800 kal. C(s) + 2S(s) -----> CS2(g) 7. -720 kJ d.kkal/mol. -113 kkal c. Diketahui kalor jenis air = 4. 36.2 g d. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g. 29.8 kJ/mol 9. 119 kkal/mol. C(g) + 2S(g) -----> CS2(g) b.5 kJ/mol. kalor pembakaran C2H5OH = +1380 kJ. dipanaskan selama lima menit hingga suhu akhir 55°C. maka kalor yang dibebaskan adalah: a. Jika kalor pembentukan H2O(l) 68400 kal. 73 g O // . Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH).5 kkal b. 2H2(g) + O2(g) -----> 2H2O(g) 8.5 g e. terjadi perubahan suhu dari 30°C menjadi 35°C.2 kJ/mol d. 0.5 kkal d.2 kkal 10.4 kkal b.6 g c. 81. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18. 2H(g) + O(g) ----> H2O(l) d.64 kkal d. -30 kJ b. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1. 110 kkal/mol. H2(g) + ½O2(g) ---> H2O(l) b. 50.12 kkal c. Bila 1 mol gas CO2 = 30 L. 100 kkal/mol b. 0.24 kkal/mol d. C(g) + ¼S8(g) -----> CS2(g) d. 7. -184. 504 kJ/mol b.5 kkal/mol e. OH-(aq)+ H+(aq) --->H2O(l) c. Pada percobaan panas reaksi.6 kJ/mol c. Untuk itu digunakan 50 mL air yang suhunya 25°C. 100. O = 16) a. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a. -56. 12.4 kJ/mol e. jika 0. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ. jawaban b dan c benar c.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0.

Konsentrasi A2B2 mula-mula 1 molar.6 kkal/mol.5 kkal 12. 1/16 k b. b dan c benar c. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a.det d. Setelah berapa detik gas Br2 tinggal 8 mol ? a. 8.0 detik e. C-H = 99. 0.0 detik . -36. -31.50 x 10-5 mol/L. Setelah 5 detik masih ada 5 mol gas NO.7 kkal d.dt pada suhu 30°C. Pada suhu tertentu. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. -17.8 c. Jika energi ikatan C=O = 173 kkal/mol.1 I. laju reaksinya adalah: a. tahapan reaksi 3. Laju pembentukan NO2 adalah: a. laju pembentukan B = 0. 3/16 k e. .H + H2 ------> CH2-CH2-OH.2 M dt-1 6. 0.1 b.625 detik b.det. konsentrasi zat hasil reaksi d. Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g).50 x 10-5 mol/L. dan OH = 110. laju pembentukan A = 1. -32 kkal e.1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173. konsentrasi zat hasil reaksi e.25 detik d.75 x 10 mol/L. laju pembentukan A = 0.8 detik c. laju penguraian A2B2 = 0.50 x 10-5 mol/L. -16. 1. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0.C-.1 e. 0.det 2. maka perubahan entalpi reaksi itu adalah: a. luas permukaan kontak d. H-H = 104.det e. pernyataan yang benar adalah: a. 0. 1/3 a dan 27a b. 3/8 k 5.2 kkal/mol.det -5 c. Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L . konsentrasi pereaksi e. -24. a dan c benar c. 1/8 k c.11. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2.3 kkal/mol dan energi ikatan ratarata C-C = 83. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]².1 kkal/mol.2 M dt-1 b.det b. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a. laju penguraian A2B2 = 0. 1. 27/64 k d. 1. C-O = 85 kkal/mol. 0. a dan b benar b. konsentrasi pereaksi 4. Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a. Pada reaksi penguraian A2B2 -----> 2A + 2B.9 kkal b. 27a dan 1/3 a d.4 M dt-1 e. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C .4. Jika konsentrasi P dan Q mula-mula 1 mol/L. -26. 3a dan 27a e. Diketahui reaksi CH3. Jika diketahui energi ikatan rata-rata C-H = 99. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a.6 M dt-1 c. 10. 37a dan 3a c. konsentrasi A2B2 menjadi 0.1 d.00 x 10-5 mol/L. -14.6 M dt-1 d. a dan b benar b. maka pada saat konsentrasi P tinggal 3/4 mol/L. Setelah reaksi berlangsung 2 detik.25 x 10-5 mol/L. 1/3 a dan 9a 7.4molar.3 kkal/mol. -42.0 dan -52.3 kkal c.

pada suhu kamar b. 320 menit b. 37.3 x 10-6 c.24 [H+] awal mol/L 0. 1.24 0. 6. 8. pada suhu tinggi c.8 [Br-] awal mil/L 0. H2O e.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a.4 0.4 0. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat.2 detik 10.------> H2O + IOII. Saat 50% gas O2 berubah dan k = 1. H2O2 + I.4 mol gas O2. IOb. 3.2 x 10-9 9.48 0.25 x 10-7 e. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a. Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0. tingkat reaksi total 2. 83.5 x 10-6 d.01 0. IO.2 detik d. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a. Suatu reaksi berlangsung dalam dua tahap berikut: I.8. diberi katalis . 0.18.3 x 10-12 b.01 0. a dan b benar II. Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0. maka kecepatan reaksinya adalah: a. H2O2 d.8 0.01 0. 28. Ic.8 detik e. rumus kecepatan reaksi itu b.3 x 10-3. Essay [nilai 2 per soal] 1.24 0.5 detik c.+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit.5 mol belerang dan 0.

Sign up to vote on this title
UsefulNot useful