REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

c. gas tidak berbau. b. endapan putih berubah menjadi merah. kertas saring menjadi hijau. d. Pada reaksi antara Na2SO3 + HCl . (b). b. d. d. Zn. Fe. Suatu sistem koloid. gas berwarna kuning-coklat. d. Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a. e. [5]. partikelnya bersifat antara lain:a. dan c benar. asam sulfat. e. kertas saring menjadi tidak berwarna. a dan b benar. gas berbau amoniak. HCl. Reaksi berikut ini akan menghasilkan endapan garam.net. Cu + FeSO4. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa. e. dan dengan api gas itu akan meletup adalah: a. CaCl2(aq) + Na2CO3(aq). b. a. c. d. Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. c. e. gas tidak berwarna. ZnO(s) + NaOH(aq). asam klorida. ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). [8]. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. [6]. c. dan c benar. asam nitrat. d. cepat mengendap jika didiamkan. Zn + NaOH. a. e. b. Pernyataan berikut ini yang benar adalah : a. b. a dan b benar. [10]. Mg. Ba(OH)2(aq) + H2SO4(aq). a dan b benar. c. kertas saring menjadi hijau. BaCl2(aq) + Na2CO3(aq).1 mµ. b. dan c benar. a. . kertas saring menjadi biru. air kapur + gas CO2 berlebih. c. a. [9]. HNO3. NaOH. gas berbau menyengat. SO2 + K2Cr2O7 + H2SO4. memiliki diameter < 0. b. dan c benar.e. (c). [7].tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. c. e. dapat menyala jika ke dalamnya dialiri arus listrik. Ba(OH)2(aq) + HCl(aq). Fe + CuSO4. b. b. b. CaCl2(aq) + H2SO4(aq). Kunci Jawaban: e-mail ke johanoni@cbn. kertas saring menjadi tidak berwarna. Logam yang dengan HCl akan menghasilkan gas. b. kecuali: a. e.id KOLOID MULTIPLE CHOICE [1]. a dan b benar. d.

jawaban a dan b benar. b. emulsi. d. kaca warna.[2]. sehingga: a.hidrosol. d. air laut. dispersi. [10]. e.suspensi (sabun sebagai koloid pelindung). e. partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-. gel. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. sol. liofil-gel. c. emulsi padat. b. e. santan. Contoh emulsi padat antara lain adalah: a. intan hitam dan beberapa jenis mutiara. e. asap dariknalpot bis. e. hidrosol. c. b. b. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a. kimia. dapat digolongkan sebagai: a. [7]. [3]. e. hidrolisis. d. Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a. liofob. c. mentega. liofob-sol. emulsi (sabun sebagai emulgator). mutiara. gel. emulsi (sabun sebagai koloid pelindung). debu. b. c. c. [13].emulsi padat (sabun sebagai koloid pelindung atau emulgator). asap. Alum yaitu Al2(SO4)3. b. c. cat semprot (Pylox). dan agak larut dalam belerang disulfida. keju dan mutiara. b. redoks. liofob-gel. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. c.18H2O.b. . tinta dan cat. cat kayu atau cat tembok.emulsi padat. c. kondensasi-redoks. e. e. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a. suspensi(sabun sebagai emulgator). karbon aktif atau norit. dan c benar.kondensasi. c. aerosol. [11]. e. bersifat sangat stabil. [5]. b. c. d. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan.hidrofob. d. dispersi. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air. c. di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya. b. [6]. d. sol. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a. susu dan Scott's Emulsion (minyak ikan). b. d. d. belerang disulfida atau alkohol (kondensasi fisika). d. Diketahui belerang tidak dapat larut dalam air. [12]. [8]. Jika bubuk agar-agar diberi air lalu dimasak. c. b.kondensasi. b. e. Sistem koloid yang pelarutnya aseton. d. e.hair spray.awan dan kabut. air (kondensasi kimia). [9]. d. air dan diberi emulgator (emulsi padat). tergolong sebagai: a. sedikit larut dalam alkohol. d. kondensasi.partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-. [4]. Diketahui bahwa air tidak dapat bercampur dengan minyak.jawaban a. belerang disulfida atau alkohol (kondensasi kimia). buih atau busa.hidrofil. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. dispersi-busur Bredig. e. dispersi-mekanis.tetapi jika diberi sabun secukupnya maka akan terjadi: a. suspensi. fisika. air (kondensasi fisika).

b. alkana dengan sikloalkana. d. CH3-(CH2)2-CHOH-CH3. [4]. Kunci Jawaban: e-mail ke koloid@a03jkt. d. d.c. sistem koloid dipanaskan. dietileter. c. alkanoat dengan ester. c. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5. propana etana karboksilat.3-metil butana 2-karboksilat. Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3. Oksidasi suatu alkohol menghasilkan 3-metil butanal. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. eter dengan alkohol. c. 2. b. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. 3-pentanol. Koloid pelindung adalah merupakan: a. etil propil karboksilat. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1]. b. kecuali:a. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. .3-dimetilpropana karboksilat. d. Senyawa 2-metil butanal berisomer dengan: a. alkanal dengan alkanon. CH3-(CH2)3-CH2OH. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. propilpropanoat. [15]. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4.[14]. alkena dengan sikloalkana. dua macam koloid bermuatan berlawanan dicampurkan. e. zat penolong (berupa koloid) untuk membuat emulsi.or. b. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain. 2. Peristiwa koagulasi dapat terjadi sebagai berikut.e. [5].3-dimetilbutanoat. [2].b. b. Senyawa berikut ini yang tidak dapat berisomeradalah: a. zat(bukan koloid) untuk membuat emulsi.3-dimetil butirat. propil etanoat. c.c. [3]. e. (CH3)2-CH-CH2-CH2OH. etil isopropil eter. c.d. 2.bpkpenabur.3-metil 2-butanol. e. propana etilkarboksilat. e. ke dalam sistem koloid dimasukkan suatu elektrolit.id (ini pelayanan gratis !) ESSAY 1. CH3-C(CH3)2-CH2OH.e. e. zat (berupa koloid) untuk membuat emulsi.zat (bukan koloid) untuk mencegah koagulasi suatu koloid . b. 2-metil butana 3-karboksilat. Alkoholtersebut adalah: a. d. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan. CH3-CH2-CHOH-CH2-CH3. dietil keton. d.

oksidator. Suatu senyawa karbon. b. Pereaksi Tollen bersifat sebagai berikut: a. dan c benar. b.2. d. [16]. Fehling A terdiridari Cu2O. mengandung CuO dalam larutan kalium natrium tartrat. b. . [18]. mengandung garam perak dalam larutan amoniaberlebih. c. [8]. c. 1. b. b. maka senyawa tersebut adalah: a. e. Etil asetat berisomer dengan senyawa berikut ini.4. a dan b benar. etanol dengan etanoat. etena. [11].d. e. dan c benar. a dan b benar. [7].maka senyawa itu kemungkinan adalah: a. (2) 2-etoksi propana. d. [13]. Fehling B terdiri dari NaOH. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. c. (4) etil sekunder propil eter.c.3. b.metanol. 1. [9]. e. 1. ditambahkanH2SO4 pekat yang maksudnya adalah: a. alkil alkana sulfat.4.a.c. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. etil alkohol. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. dan c benar. matanal. a dan b benar.3-dimetil pentanal. c. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. d. tak dapat dioksidasi.3. e. c. 3. kecuali:a. a. d. etanoldengan asam sulfat pekat. dietil keton.4-dimetil2-heksanol. Fehling A terdiridari CuSO4 dan NaOH. 2-metil propanoat. b. e. dan denganasam asetat terbentuk ester.3. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a.4. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. [12]. etil etana karboksilat. c.(3) 2-propoksi etana.mengikat air yang terjadi. 1.3. Fehling B terdiri dari NaOH dan kalium natriumtartrat. tersier butil alkohol. n-butanal.2. reduktor. oksidasi2butanol. alkanon. 2. b. c. e. d. Dietil eter dapat dihasilkan dari reaksi: a. butanoat. b.aseton. oksidator. c.3-dimetil 2-butanon. metanal. 2. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a.[6]. c. alkanal. [15]. e. asetaldehida. c. Penamaanyang benar semuanya terdapat pada: a.2. d. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. menggeser kestimbangan reaksi. Fehling A terdiri dari CuSO4.propanon. e. supaya teroksidasi. d. e. metil propanoat.4. metanol.dietil eter. mencegah oksidasi. Fehling B terdiridari NaOH dan kalium natrium tartrat.mengandung garam perak dalam larutan amonia berlebih.dietil eter.3-dietil butana. b. ester. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. a. d. d.oksidasi 2-butanon. b. 2.Fehling A terdiri dari NaOH dan Cu2O. b. metil alkohol. b. e. oksidasi 2-butanal. Fehling B terdiri dari kaliumnatrium tartrat. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. propil metanoat. b. d. Pernyataan yang tepat mengenai larutan Fehling adalah:a. d. formalin. d. b. e. [10].n-butanol.2-dimetil propana.aseton. n-butanon.alkanol. a dan b benar. b. c. Pada reaksi metil alkohol + asam salisilat. [17]. Fehling B terdiridari NaOH dan kalium natrium tartrat.3. 2. [14]. e.

03 molal adalah sama. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. glukosa 0.8M e. tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e. jumlah mol zat terlarut dalam 1000 g larutan e. (e) formalin dengan pereaksi Tollen.(f). Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a. K2Cr2O7 + H2SO4. Mg(NO3)2 0. keduanya bukan elektrolit b.reduktor. e. jumlah mol zat terlarut dalam 1 L pelarut d. e. a dan bbenar. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b. CuSO4 0. massa jenis larutan b. Kunci Jawaban: e-mailke johanoni@cbn. (c). PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1.2M b. ESSAY [1].3M c. CH3COOH 0. (d). banyaknya partikel zat terlarut d. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a. warna zat pelarut c. asetaldehida + NaOH(aq)+I2(KI aq).b. Titik didih larutan CaCl2 0. (b).5 M d. metanal denganpereaksi Fehling.pereaksi Tollen. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. Harga kenaikan titik didih molal (Kb) bergantung pada: a. keduanya adalah nonelektrolit . jenis partikel zat terlarut e.net. pH pelarutnya lebih besar daripada pH larutannya 3. tuliskan pula masing-masingnamanya ! [3]. jumlah mol zat terlarut dalam 1 L larutan c. Tuliskan reaksi yang terjadi pada: (a).01 molal dan titik didih larutan glukosa (C6H12O6) 0. jumlah g zat terlarut dalam 1 L larutan b. pereaksi Fehling. mengandung CuO dalam kalium natriumtartrat.id Kembali ke Kimia SMU Home Page . Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. KMnO4 + H2SO4. etil alkohol + NaOH(aq)+ I2(KI aq). jumlah mol zat terlarut dalam 1000 g pelarut 4. karena: a. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. Na2CO3 0. d. mengandung senyawa perak dan CuOdalam NaOH.2M 2. banyak sedikitnya larutan 5. [19]. titik beku pelarutnya lebih rendah daripada titik beku larutannya c. reduktor. butil alkohol dengan K2Cr2O7+ H2SO4. Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a. demetil keton + NaOH(aq)+ I2(KI aq). c.

Jika penurunan titik beku molal air 1. hipertonik d.2M c.1M d. Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a.2 cmHg. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6.046 C° .86 C°.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. supertonik e. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a. Sebanyak 3. NaCl 1m artinya: a. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! .2M b. maka larutan A terhadap larutan B disebut: a.125 g/mL dan massa molekul relatif elektrolit 125. NaCl 0. hipotonik c. glukosa 0.c. n = 2 d. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. C6H12O6 0.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL. titik didih pelarut lebih rendah daripada titik didih larutannya b. merupakan elektrolit biner dalam b.2M 8. CO(NH2)2 0. I. berapakah Mr zat non-elektrolit tersebut ? 3. 1 mol NaCl dalam 1000 g larutan c.8M e. 1 mol NaCl dalam 1000 g pelarut b. 1 mol NaCl dalam 1 L larutan d. Mg(NO3)2 0. hitunglah derajat pengionan elektrolit tersebut ! 3. derajat ionisasi = 1 c.2M 11. CuSO4 0. jumlah partikel larutan menjadi II.3M b. Ba(NO3)2 0.1 mol suatu asam lemah bervalensi satu dalam 88. keduanya adalah elektrolit kuat d. Ca(NO3)2 ------> Ca2+ + 2NO3a. 1 g NaCl dalam 1 L larutan 9. isotonik b.2 g air pada p dan t yang sama? Ka = 1 x 10-7. n disebut faktor van't Hoff 2x e. titik beku pelarut lebih tinggi daripada titik beku larutannya c. Berapa tekanan uap jenuh larutan 10.3M c. Na2CO3 0. Tekanan osmotiknya = 15. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. jumlah partikel yang ada dalam kedua larutan sama banyak e. Berapa tekanan uap jenuh 100mL larutan 0. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e. monotonik 7. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g. AlCl3 0. 1 g NaCl dalam 1 L larutan e.3M e. ESSAY 1. massa jenis larutan 1.5 M d. CH3COOH 0. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a. massa jenis pelarut lebih besar daripada massa jenis larutannya 10.

[H+] ={ [asam] x K1}½ d. Larutan HCl merupakan asam kuat karena akan terion sempurna d. perubahan tekanan e. NH4OH merupakan basa kuat karena mudah larut dalam air b. [H+] = (Kb)½. karena pH berubah c. asam kuat + basa lemah berlebih b. asam kuat + basa kuat b. konsentrasinya e.dalam larutan H2SO4 0. Ka nya d. penambahan garam b.4 x 10-13.[g]/Kb d. kecuali: a. NH4Cl c. Konsentrasi ion OH. Harga tetapan kesetimbangan air dapat berubah oleh: a. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. asam lemah + basa kuat 4. dan K3 = 4. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a. kecuali: a. 10-12M d.005 N adalah: a. [H+] = (Kw)½. [H+] = (Kb)½/Kw. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. pernyataan yang salah adalah: a.1M . jenis pelarutnya b. (NH4)2SO4 e. [H ] = (Kw) . [H+] = (Kb)½. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. asam lemah + basa lemah d. Larutan penyangga dapat terjadi sebagai berikut. Pernyataan yang benar di antara pernyataan berikut ini adalah: a. HCl d. kesetimbangan air akan bergeser d. larutan basa akan mengurangi [H+] dalam air. volumenya 7.9 x 10-3 .Ka/Kw b. maka yang pH nya paling tinggi: a. karena Kw tetap 8. perubahan suhu 6. NaHSO4 b. 10-2M e. Jika zat di bawah ini konsentrasinya 1 M. dari data itu pengaruh K2 dan K3 tidak berarti e. NaOH merupakan basa pekat karena mudah larut dalam air c. Ka = K1 x K2 x K3 c. K2 = 6. CH3COONa 3. harga Kw berubah.5 x10-3M b. [H+]3 = [PO43-] b.[g]/Kw e. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini. penambahan basa d. Dalam kesetimbangan asam-basa. asam sangat lemah berlebih + basa lemah . larutan asam akan mengurangi [OH-] dalam air.Ka + ½ c. asam sangat lemah + basa lemah berlebih e.3 x 10-8. umumnya dipakai air sebagai pelarut.1. Pada larutan asam fosfat 0. harga Kw tetap tidak berubah b. karena Kw tetap e. asam kuat + basa lemah e. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a. tidak ada 2. 5 x 10-3M c.Ka/Kb 10. asam lemah berlebih + basa kuat c. asam sangat lemah + basa sangat lemah c. penambahan asam c. asam lemah + basa sangat lemah berlebih d. jika diketahui K1 = 5. derajat ionisasinya c. 2.

2. NH3 adalah basa karena sebagai donor proton d. NH4Cl c. Cle. HCl e. Dalam hal ini pernyataan yang tidak sesuai adalah: a. Diketahui pH CH3COOH 0. HCl b.11.c. PO43.1 kkal/mol b. Hc C(s) = -94. Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e.5M. Hf CO2(g) = -94. NaOH d. Hr = -94. HCO3. pernyataan yang salah berdasarkan teori Lewis: a. H2O c.1 kkal/mol d. Energi ikatan CO2(g) = +94. Derajat ionisasi asam tersebut adalah 3%. zat yang merupakan asam sangat kuat adalah: a. dibebaskan kalor sebesar 94. NH3 adalah basa karena sebagai akseptor proton c. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4. a dan b benar e. Larutan asam fosfat 0. Hitung derajat pengionan asam itu ! 5. a dan c benar 12. NH3 adalah basa karena sebagai donor elektron II.1 kkal c. (NH4)2CO3 b. 10 kkal/mol b. 1. ESSAY 1.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. NH3 adalah basa karena dapat mengikat H b.log 3.b. Pada reaksi C(s) + O2(g) -----> CO2(g). H3O+ 14. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. H-O. NH3 + HCl ------> NH4Cl.4 kkal/mol d. H3O+ d. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0. maka kalor yang dibebaskan adalah: a. tidak ada 13. 1200 kal/mol e. Berapa K1 asam itu ? 2.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3. HCl + H2O -------> H2O+ + Cl-.Hitunglah! a. Jika diketahui energi ikatan rata-rata H-H. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. berdasarkan konsep Bronted-Lowry. berapa L HCl 0.1 kkal/mol 2.0 kkal/mol c.01 N ! I.02 N dengan 400 ml HNO3 0. 20 kkal/mol 3. berturut-turut adalah 104 .1 N mempunyai pH = 3 . NH3 adalah basa karena sebagai akseptor elektron e. jika 1. berapa mL HCl 0.1M = 3.1 kkal/mol. NaCl d. terjadi perubahan suhu dari 30°C menjadi 35°C. Pada percobaan panas reaksi. O=O. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a. Bila 1 mol gas CO2 = 30 L.

5 kkal/mol e. -28. C(s) + 2S(s) -----> CS2(l) e.5 kJ/mol. maka kalor yang dibebaskan adalah: a. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. 2 kkal/mol 6.32 kkal e. 91. 0. +7200 kJ e. Mr metanol = 32. 16. 36.5 g e. C(g) + 2S(g) -----> CS2(g) b. 218. jawaban b dan c benar c. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. -56. 100. Pada percobaan panas reaksi. 73 g O // . C(s) + 2S(s) -----> CS2(g) 7. Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH). Diketahui kalor jenis air = 4. Bila 1 mol gas CO2 = 30 L. maka kalor pembentukan natrium oksida adalah: a.kkal/mol. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ. 0. 50. OH-(aq)+ H+(aq) --->H2O(l) c.12 kkal c. dipanaskan selama lima menit hingga suhu akhir 55°C.800 kal.6 g c. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi. 110 kkal/mol. 7. 14. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a. Jika diketahui Hf HCl = -92. Kalor pembakaran metanol itu adalah: a.8 kJ/mol 9.2 kkal 10.2 kJ/mol d. 29.4 kkal b.2 g d. Untuk itu digunakan 50 mL air yang suhunya 25°C. 504 kJ/mol b.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. -3 kkal 4. 25. 119 kkal/mol.05M. 81. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1.64 kkal d. O = 16) a.3 g b. -720 kJ d. 2H2(g) + O2(g) -----> 2H2O(g) 8. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a.5 kkal b. 12. -30 kJ b. Jika kalor pembentukan H2O(l) 68400 kal. 2H(g) + O(g) ---> H2O(g) e. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18. 2H(g) + O(g) ----> H2O(l) d. -184.3 kkal e. +30 kJ c. H2(g) + ½O2(g) ---> H2O(l) b. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g. kalor pembakaran C2H5OH = +1380 kJ. jika 0.4 kJ/mol e. terjadi perubahan suhu dari 30°C menjadi 35°C. 0. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal.6 kJ/mol c.24 kkal/mol d. -113 kkal c. -2100 kJ 5. 100 kkal/mol b.5 kkal d.2 J/g°C. C(g) + ¼S8(g) -----> CS2(g) d. 36. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a.1 kkal/mol c.

625 detik b. C-H = 99. laju reaksinya adalah: a. laju pembentukan B = 0. 0.2 kkal/mol.1 I.5 kkal 12.75 x 10 mol/L.0 dan -52. -26. laju pembentukan A = 0.4molar.1 e.det e.det -5 c.0 detik e. 0. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a.4. Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L . b dan c benar c. konsentrasi zat hasil reaksi e.9 kkal b.25 x 10-5 mol/L. 0.25 detik d. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a. Konsentrasi A2B2 mula-mula 1 molar. laju penguraian A2B2 = 0. 1.det 2. 0. laju penguraian A2B2 = 0.50 x 10-5 mol/L. luas permukaan kontak d. a dan b benar b.det d.3 kkal/mol. Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a. 3a dan 27a e. 0. 1/16 k b. 1. konsentrasi pereaksi 4.0 detik .6 kkal/mol. Diketahui reaksi CH3. dan OH = 110. konsentrasi pereaksi e. -14. Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g). Jika energi ikatan C=O = 173 kkal/mol.2 M dt-1 6. 27/64 k d. -36. -31. 10.4 M dt-1 e.H + H2 ------> CH2-CH2-OH.8 detik c. 37a dan 3a c. pernyataan yang benar adalah: a. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0.1 d.dt pada suhu 30°C. a dan c benar c. 1/3 a dan 27a b. -16. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C . Pada suhu tertentu.7 kkal d. Laju pembentukan NO2 adalah: a. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]².11.50 x 10-5 mol/L. maka perubahan entalpi reaksi itu adalah: a. 1. Jika diketahui energi ikatan rata-rata C-H = 99.det. Jika konsentrasi P dan Q mula-mula 1 mol/L.1 b.2 M dt-1 b. konsentrasi A2B2 menjadi 0.1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173. 1/8 k c. maka pada saat konsentrasi P tinggal 3/4 mol/L. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1.8 c.6 M dt-1 c.50 x 10-5 mol/L. Setelah reaksi berlangsung 2 detik. -42. C-O = 85 kkal/mol. 27a dan 1/3 a d. a dan b benar b. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a. Setelah 5 detik masih ada 5 mol gas NO. 3/16 k e. -32 kkal e. 8.3 kkal c.00 x 10-5 mol/L. -24.C-. H-H = 104. Pada reaksi penguraian A2B2 -----> 2A + 2B. laju pembentukan A = 1. konsentrasi zat hasil reaksi d. . -17.6 M dt-1 d. 3/8 k 5.det b. 1/3 a dan 9a 7.1 kkal/mol. tahapan reaksi 3. Setelah berapa detik gas Br2 tinggal 8 mol ? a.3 kkal/mol dan energi ikatan ratarata C-C = 83.

48 0. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat. IOb. 6. pada suhu tinggi c. pada suhu kamar b.+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a.3 x 10-3. 8. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a.24 [H+] awal mol/L 0. Ic.5 detik c. 1. IO.4 mol gas O2.4 0.3 x 10-12 b. Suatu reaksi berlangsung dalam dua tahap berikut: I. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a.24 0. maka kecepatan reaksinya adalah: a. diberi katalis .8 detik e. 37. 28.18.5 mol belerang dan 0. a dan b benar II.25 x 10-7 e.01 0. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a. tingkat reaksi total 2. Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0.2 detik d.24 0.2 x 10-9 9.01 0. 320 menit b.2 detik 10. H2O e.------> H2O + IOII.3 x 10-6 c. Saat 50% gas O2 berubah dan k = 1.8 [Br-] awal mil/L 0.5 x 10-6 d.4 0. Essay [nilai 2 per soal] 1.01 0. 83.8. 0. 3. H2O2 d. H2O2 + I.8 0. Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0. rumus kecepatan reaksi itu b.