P. 1
REAKSI-LARUTAN-ELEKTROLIT

REAKSI-LARUTAN-ELEKTROLIT

|Views: 244|Likes:

More info:

Published by: Dietya Nuris Liarachma on Apr 02, 2012
Copyright:Attribution Non-commercial

Availability:

Read on Scribd mobile: iPhone, iPad and Android.
download as DOC, PDF, TXT or read online from Scribd
See more
See less

05/02/2015

pdf

text

original

REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

asam nitrat. cepat mengendap jika didiamkan. Zn. asam klorida. dan c benar.1 mµ. kertas saring menjadi hijau. e. [5]. e. HCl. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa. d. c. dan c benar. b. c. Pernyataan berikut ini yang benar adalah : a. (c). gas berbau amoniak. CaCl2(aq) + Na2CO3(aq). SO2 + K2Cr2O7 + H2SO4. dan c benar. . c. d. e. c.net. e. Reaksi berikut ini akan menghasilkan endapan garam. Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a. c. d. ZnO(s) + NaOH(aq). [8]. b. gas tidak berbau. b. dapat menyala jika ke dalamnya dialiri arus listrik. kertas saring menjadi tidak berwarna. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. d. kertas saring menjadi hijau. [6]. partikelnya bersifat antara lain:a. a dan b benar. [7]. NaOH. Logam yang dengan HCl akan menghasilkan gas. dan dengan api gas itu akan meletup adalah: a. Ba(OH)2(aq) + HCl(aq). Kunci Jawaban: e-mail ke johanoni@cbn. memiliki diameter < 0. a. b.e. Ba(OH)2(aq) + H2SO4(aq). d. asam sulfat. gas berwarna kuning-coklat.tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. b. kertas saring menjadi biru. a dan b benar. [10]. Cu + FeSO4. b. Fe + CuSO4. [9]. (b). e. a. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. a. b. a dan b benar. Suatu sistem koloid. BaCl2(aq) + Na2CO3(aq). dan c benar. c. c. air kapur + gas CO2 berlebih. Fe. kertas saring menjadi tidak berwarna. gas tidak berwarna. gas berbau menyengat. e. Mg. e. b. ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). b. endapan putih berubah menjadi merah.id KOLOID MULTIPLE CHOICE [1]. Pada reaksi antara Na2SO3 + HCl . d. b. Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. Zn + NaOH. kecuali: a. d. a. HNO3. b. CaCl2(aq) + H2SO4(aq). a dan b benar.

hidrolisis. liofob-sol. [11]. e. tinta dan cat. b. d. b. sedikit larut dalam alkohol. asap. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air. emulsi (sabun sebagai emulgator). c. d. bersifat sangat stabil. tergolong sebagai: a. suspensi(sabun sebagai emulgator). karbon aktif atau norit. [4]. mutiara. [7].hidrofil. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a. dan agak larut dalam belerang disulfida.18H2O. [12]. e. e. e.hair spray. liofob. belerang disulfida atau alkohol (kondensasi kimia). suspensi. cat kayu atau cat tembok. air (kondensasi fisika). emulsi padat. kimia.emulsi padat (sabun sebagai koloid pelindung atau emulgator). asap dariknalpot bis. c.jawaban a. c. b. b. b. kondensasi-redoks. e. b. [13]. c. Sistem koloid yang pelarutnya aseton. sehingga: a.tetapi jika diberi sabun secukupnya maka akan terjadi: a. d. buih atau busa. intan hitam dan beberapa jenis mutiara. b. c. gel. dispersi.b. Alum yaitu Al2(SO4)3. e. Jika bubuk agar-agar diberi air lalu dimasak. dan c benar. d. sol. jawaban a dan b benar. aerosol. d. kondensasi. d. emulsi (sabun sebagai koloid pelindung). air laut. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a. dapat digolongkan sebagai: a. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. e. c.[2]. sol.hidrosol. emulsi. [8]. air dan diberi emulgator (emulsi padat).partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-. santan. redoks.emulsi padat. liofob-gel. b. partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-. belerang disulfida atau alkohol (kondensasi fisika). di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya. c. cat semprot (Pylox). d. c. [5]. kaca warna. c. [9]. b. e. b. b. gel. d. liofil-gel.kondensasi. dispersi-mekanis. c. b. Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a.hidrofob. d. d.kondensasi. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . air (kondensasi kimia). hidrosol. e. dispersi-busur Bredig. Contoh emulsi padat antara lain adalah: a.awan dan kabut. [6]. susu dan Scott's Emulsion (minyak ikan). mentega. d. Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a. c. . debu. keju dan mutiara. c. d. [10]. dispersi. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. Diketahui bahwa air tidak dapat bercampur dengan minyak. [3]. fisika. e. e. Diketahui belerang tidak dapat larut dalam air. e.suspensi (sabun sebagai koloid pelindung).

b.id (ini pelayanan gratis !) ESSAY 1. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. c.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan.zat (bukan koloid) untuk mencegah koagulasi suatu koloid . CH3-(CH2)3-CH2OH. e. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6. e. Peristiwa koagulasi dapat terjadi sebagai berikut. [3]. c. dietil keton. alkanal dengan alkanon. Kunci Jawaban: e-mail ke koloid@a03jkt.3-metil 2-butanol. propil etanoat. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. c.e. e.3-dimetilbutanoat. d. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. eter dengan alkohol. propana etilkarboksilat. b. alkana dengan sikloalkana. CH3-(CH2)2-CHOH-CH3. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain. alkena dengan sikloalkana. 2. alkanoat dengan ester.3-dimetilpropana karboksilat. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1].e. b. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a. 2-metil butana 3-karboksilat. kecuali:a. Koloid pelindung adalah merupakan: a. e.3-metil butana 2-karboksilat. d.d.b. c.bpkpenabur. CH3-C(CH3)2-CH2OH. d.or. e. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4. Senyawa 2-metil butanal berisomer dengan: a. propilpropanoat. [4]. propana etana karboksilat. [15]. 2. ke dalam sistem koloid dimasukkan suatu elektrolit. b. zat(bukan koloid) untuk membuat emulsi. dietileter. c. b. 3-pentanol. dua macam koloid bermuatan berlawanan dicampurkan.3-dimetil butirat. zat (berupa koloid) untuk membuat emulsi. sistem koloid dipanaskan. d. zat penolong (berupa koloid) untuk membuat emulsi. d. b. etil propil karboksilat. (CH3)2-CH-CH2-CH2OH. CH3-CH2-CHOH-CH2-CH3. 2. Oksidasi suatu alkohol menghasilkan 3-metil butanal. Senyawa berikut ini yang tidak dapat berisomeradalah: a. d.c.[14].c. [5]. . Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3. [2]. Alkoholtersebut adalah: a. etil isopropil eter.

Fehling A terdiridari CuSO4 dan NaOH. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. etanol dengan etanoat. c. [13]. c.3-dimetil pentanal.d.mengikat air yang terjadi. [16].4-dimetil2-heksanol. b. (4) etil sekunder propil eter. Suatu senyawa karbon. butanoat. dan c benar. e.alkanol. b. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a.aseton. alkil alkana sulfat. metil propanoat.3. [7]. [11]. c. b. e. tersier butil alkohol.a.3.propanon.3-dimetil 2-butanon.4. e.n-butanol. b. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a. 2. a dan b benar. d. d. 2. c. 1. Fehling B terdiri dari NaOH dan kalium natriumtartrat.(3) 2-propoksi etana. (2) 2-etoksi propana. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a.c. b. Pereaksi Tollen bersifat sebagai berikut: a. etil alkohol. 1. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. c.3.4. Fehling B terdiri dari NaOH. b. b. [8]. Fehling A terdiridari Cu2O. etil etana karboksilat. e. 2. metanal. Fehling A terdiri dari CuSO4.3. Pada reaksi metil alkohol + asam salisilat. dan denganasam asetat terbentuk ester. a dan b benar. n-butanal. d. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. Pernyataan yang tepat mengenai larutan Fehling adalah:a. metanol.2-dimetil propana.oksidator. e. propil metanoat. [15]. d. formalin. d.2. oksidasi2butanol. ditambahkanH2SO4 pekat yang maksudnya adalah: a.4. c. 2. etanoldengan asam sulfat pekat. b. metil alkohol. a dan b benar. maka senyawa tersebut adalah: a.oksidasi 2-butanon. alkanal. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. Dietil eter dapat dihasilkan dari reaksi: a.c. c.3-dietil butana. a. a dan b benar. . mengandung garam perak dalam larutan amoniaberlebih. d. c. a. 3. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. d. e.dietil eter. Fehling B terdiridari NaOH dan kalium natrium tartrat. d.maka senyawa itu kemungkinan adalah: a. b. matanal. tak dapat dioksidasi. kecuali:a. dietil keton. mencegah oksidasi.dietil eter. e. Penamaanyang benar semuanya terdapat pada: a.[6]. 1.aseton. etena.2. b. e. d. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. c. 1. [17]. menggeser kestimbangan reaksi.Fehling A terdiri dari NaOH dan Cu2O. 2-metil propanoat. [14].mengandung garam perak dalam larutan amonia berlebih. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter. oksidator. d. e. alkanon. mengandung CuO dalam larutan kalium natrium tartrat. b. e.4. Etil asetat berisomer dengan senyawa berikut ini. [10]. [9].3. n-butanon. c.2. reduktor. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. b. b. dan c benar.metanol. e. d. asetaldehida. Fehling B terdiri dari kaliumnatrium tartrat. c. dan c benar. [12]. b. supaya teroksidasi. e. oksidasi 2-butanal. d. [18]. ester. b.

titik beku pelarutnya lebih rendah daripada titik beku larutannya c. keduanya bukan elektrolit b. banyak sedikitnya larutan 5. ESSAY [1]. e. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. Titik didih larutan CaCl2 0. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a. Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a. demetil keton + NaOH(aq)+ I2(KI aq). banyaknya partikel zat terlarut d. (e) formalin dengan pereaksi Tollen. Mg(NO3)2 0. CuSO4 0. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. c. d. jumlah g zat terlarut dalam 1 L larutan b.2M 2. tuliskan pula masing-masingnamanya ! [3]. Tuliskan reaksi yang terjadi pada: (a).id Kembali ke Kimia SMU Home Page .8M e.03 molal adalah sama. glukosa 0. Na2CO3 0. [19]. jumlah mol zat terlarut dalam 1 L pelarut d. tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e.2M b. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. (b). Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. asetaldehida + NaOH(aq)+I2(KI aq). jumlah mol zat terlarut dalam 1 L larutan c. karena: a. a dan bbenar. metanal denganpereaksi Fehling.reduktor. warna zat pelarut c. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a. butil alkohol dengan K2Cr2O7+ H2SO4. jenis partikel zat terlarut e. Harga kenaikan titik didih molal (Kb) bergantung pada: a.(f). etil alkohol + NaOH(aq)+ I2(KI aq).3M c. (c). jumlah mol zat terlarut dalam 1000 g larutan e. jumlah mol zat terlarut dalam 1000 g pelarut 4. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b. mengandung senyawa perak dan CuOdalam NaOH.5 M d. CH3COOH 0. (d). Kunci Jawaban: e-mailke johanoni@cbn. keduanya adalah nonelektrolit . mengandung CuO dalam kalium natriumtartrat.01 molal dan titik didih larutan glukosa (C6H12O6) 0.b. pH pelarutnya lebih besar daripada pH larutannya 3. KMnO4 + H2SO4.net.pereaksi Tollen. e. reduktor. pereaksi Fehling. K2Cr2O7 + H2SO4. massa jenis larutan b.

5 M d.3M b. CuSO4 0. CH3COOH 0.8M e. AlCl3 0. C6H12O6 0. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e.c. n = 2 d. isotonik b. titik beku pelarut lebih tinggi daripada titik beku larutannya c.1M d. hitunglah derajat pengionan elektrolit tersebut ! 3. berapakah Mr zat non-elektrolit tersebut ? 3. Na2CO3 0. monotonik 7. 1 mol NaCl dalam 1 L larutan d. 1 g NaCl dalam 1 L larutan e. merupakan elektrolit biner dalam b.125 g/mL dan massa molekul relatif elektrolit 125. massa jenis larutan 1.86 C°. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a. n disebut faktor van't Hoff 2x e. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2. Ca(NO3)2 ------> Ca2+ + 2NO3a. 1 mol NaCl dalam 1000 g pelarut b. Berapa tekanan uap jenuh 100mL larutan 0.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. 1 g NaCl dalam 1 L larutan 9.2M 8. ESSAY 1. Ba(NO3)2 0. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d.046 C° . Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a. NaCl 1m artinya: a. Berapa tekanan uap jenuh larutan 10. Tekanan osmotiknya = 15.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL. jumlah partikel larutan menjadi II. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6.2M b. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. hipertonik d.1 mol suatu asam lemah bervalensi satu dalam 88.3M e. maka larutan A terhadap larutan B disebut: a. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! . Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a. supertonik e. Sebanyak 3. CO(NH2)2 0. I. massa jenis pelarut lebih besar daripada massa jenis larutannya 10.2M c. Mg(NO3)2 0. glukosa 0. titik didih pelarut lebih rendah daripada titik didih larutannya b. NaCl 0. derajat ionisasi = 1 c. jumlah partikel yang ada dalam kedua larutan sama banyak e. hipotonik c.2 cmHg.3M c.2 g air pada p dan t yang sama? Ka = 1 x 10-7. 1 mol NaCl dalam 1000 g larutan c. keduanya adalah elektrolit kuat d.2M 11. Jika penurunan titik beku molal air 1.

NH4Cl c. asam lemah berlebih + basa kuat c. NaHSO4 b. [H+] = (Kb)½.Ka/Kb 10. asam sangat lemah + basa sangat lemah c. Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. Konsentrasi ion OH. [H+]3 = [PO43-] b. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini.[g]/Kw e. NH4OH merupakan basa kuat karena mudah larut dalam air b. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a. Dalam kesetimbangan asam-basa. umumnya dipakai air sebagai pelarut. kesetimbangan air akan bergeser d. kecuali: a. volumenya 7. derajat ionisasinya c.9 x 10-3 . konsentrasinya e. larutan basa akan mengurangi [H+] dalam air. asam kuat + basa kuat b. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a.dalam larutan H2SO4 0. harga Kw tetap tidak berubah b. maka yang pH nya paling tinggi: a. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. 5 x 10-3M c. karena Kw tetap e. CH3COONa 3. harga Kw berubah.5 x10-3M b. 10-12M d. [H+] = (Kb)½. jenis pelarutnya b. tidak ada 2. larutan asam akan mengurangi [OH-] dalam air. (NH4)2SO4 e. asam kuat + basa lemah berlebih b. [H+] = (Kw)½. dan K3 = 4. penambahan garam b. penambahan asam c. karena pH berubah c.Ka + ½ c. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. asam kuat + basa lemah e. karena Kw tetap 8. kecuali: a. HCl d.4 x 10-13. asam sangat lemah + basa lemah berlebih e. Jika zat di bawah ini konsentrasinya 1 M.3 x 10-8. asam sangat lemah berlebih + basa lemah . Harga tetapan kesetimbangan air dapat berubah oleh: a. perubahan tekanan e. 2. K2 = 6.1M . Ka nya d.005 N adalah: a. perubahan suhu 6. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. penambahan basa d. Ka = K1 x K2 x K3 c. jika diketahui K1 = 5. Pernyataan yang benar di antara pernyataan berikut ini adalah: a. Larutan penyangga dapat terjadi sebagai berikut. dari data itu pengaruh K2 dan K3 tidak berarti e. [H+] = (Kb)½/Kw. asam lemah + basa sangat lemah berlebih d.Ka/Kw b. 10-2M e. Pada larutan asam fosfat 0.[g]/Kb d. pernyataan yang salah adalah: a. Larutan HCl merupakan asam kuat karena akan terion sempurna d. NaOH merupakan basa pekat karena mudah larut dalam air c. asam lemah + basa kuat 4. [H ] = (Kw) .1. asam lemah + basa lemah d. [H+] ={ [asam] x K1}½ d.

HCO3. H3O+ 14. Hr = -94. Bila 1 mol gas CO2 = 30 L. dibebaskan kalor sebesar 94.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0.1 N mempunyai pH = 3 . berapa L HCl 0. Diketahui pH CH3COOH 0. H-O. tidak ada 13.5M. pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a. a dan b benar e.1 kkal/mol d. 1200 kal/mol e.log 3. 2. 10 kkal/mol b. Jika diketahui energi ikatan rata-rata H-H. H3O+ d. Pada reaksi C(s) + O2(g) -----> CO2(g). HCl + H2O -------> H2O+ + Cl-.4 kkal/mol d. HCl b. NH3 adalah basa karena sebagai donor elektron II. Hitung derajat pengionan asam itu ! 5. berturut-turut adalah 104 . berdasarkan konsep Bronted-Lowry. 1.Hitunglah! a.11. H2O c. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). O=O. PO43. HCl e.02 N dengan 400 ml HNO3 0. NH3 adalah basa karena sebagai donor proton d. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0. Pada percobaan panas reaksi. (NH4)2CO3 b. Hf CO2(g) = -94.1 kkal c. Dalam hal ini pernyataan yang tidak sesuai adalah: a.01 N ! I. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. zat yang merupakan asam sangat kuat adalah: a. a dan c benar 12. NH4Cl c.0 kkal/mol c.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. 20 kkal/mol 3. NH3 adalah basa karena sebagai akseptor proton c. terjadi perubahan suhu dari 30°C menjadi 35°C. Energi ikatan CO2(g) = +94. ESSAY 1. jika 1. NH3 adalah basa karena sebagai akseptor elektron e. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. NH3 adalah basa karena dapat mengikat H b.1 kkal/mol. maka kalor yang dibebaskan adalah: a. Cle. NaOH d.1 kkal/mol b. Larutan asam fosfat 0. berapa mL HCl 0. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4.1M = 3.b. Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e.c. Hc C(s) = -94. NH3 + HCl ------> NH4Cl. NaCl d. pernyataan yang salah berdasarkan teori Lewis: a. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a. Derajat ionisasi asam tersebut adalah 3%.1 kkal/mol 2. Berapa K1 asam itu ? 2.

C(g) + ¼S8(g) -----> CS2(g) d.6 kJ/mol c.32 kkal e. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g. 81. dipanaskan selama lima menit hingga suhu akhir 55°C. 14.1 kkal/mol c.8 kJ/mol 9. 0. -184. -2100 kJ 5. C(s) + 2S(s) -----> CS2(g) 7. 218. Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH). jawaban b dan c benar c. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a. -113 kkal c. terjadi perubahan suhu dari 30°C menjadi 35°C. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal. Jika kalor pembentukan H2O(l) 68400 kal. Bila 1 mol gas CO2 = 30 L.6 g c. 2 kkal/mol 6. Pada percobaan panas reaksi. 29.24 kkal/mol d. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ.2 J/g°C.2 kJ/mol d. Untuk itu digunakan 50 mL air yang suhunya 25°C.5 kkal b. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18. 16. 0. Kalor pembakaran metanol itu adalah: a. +30 kJ c. -720 kJ d. Jika diketahui Hf HCl = -92. 119 kkal/mol. C(g) + 2S(g) -----> CS2(g) b. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi. 36. 12.05M. 2H(g) + O(g) ----> H2O(l) d. 100 kkal/mol b. +7200 kJ e.800 kal.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. C(s) + 2S(s) -----> CS2(l) e.12 kkal c. 2H2(g) + O2(g) -----> 2H2O(g) 8. 504 kJ/mol b. 73 g O // . -30 kJ b.4 kkal b. 0.3 kkal e. Mr metanol = 32. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. -56. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a. 25. -28. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1. 50. OH-(aq)+ H+(aq) --->H2O(l) c. kalor pembakaran C2H5OH = +1380 kJ. maka kalor yang dibebaskan adalah: a.kkal/mol. H2(g) + ½O2(g) ---> H2O(l) b.5 kJ/mol. 91. 2H(g) + O(g) ---> H2O(g) e. jika 0.64 kkal d.5 g e.4 kJ/mol e.2 kkal 10. -3 kkal 4. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a. 7. 100.3 g b.2 g d. 36. Diketahui kalor jenis air = 4. O = 16) a.5 kkal d. 110 kkal/mol. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ.5 kkal/mol e. maka kalor pembentukan natrium oksida adalah: a.

Pada reaksi penguraian A2B2 -----> 2A + 2B. Setelah reaksi berlangsung 2 detik.det b.9 kkal b. C-O = 85 kkal/mol. -17. 0. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0.75 x 10 mol/L.25 x 10-5 mol/L. Pada suhu tertentu. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]². Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g). 0. 27/64 k d.1 d. Konsentrasi A2B2 mula-mula 1 molar.3 kkal c. Setelah berapa detik gas Br2 tinggal 8 mol ? a. laju penguraian A2B2 = 0. -16. maka pada saat konsentrasi P tinggal 3/4 mol/L. laju pembentukan A = 0.0 detik . laju reaksinya adalah: a. maka perubahan entalpi reaksi itu adalah: a. 1/3 a dan 27a b. 1.5 kkal 12. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C .6 M dt-1 c. -24.50 x 10-5 mol/L. luas permukaan kontak d. 1/3 a dan 9a 7. konsentrasi pereaksi e. a dan b benar b. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a.11. 10. Jika diketahui energi ikatan rata-rata C-H = 99. Laju pembentukan NO2 adalah: a. -14.8 c. konsentrasi pereaksi 4. dan OH = 110.det 2. -31.1 I. 1. a dan b benar b.8 detik c. 8.4. -32 kkal e.1 kkal/mol. Jika konsentrasi P dan Q mula-mula 1 mol/L. laju pembentukan A = 1. 0. konsentrasi zat hasil reaksi e. pernyataan yang benar adalah: a.C-. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1.1 e.25 detik d. a dan c benar c. Diketahui reaksi CH3.0 detik e.6 kkal/mol. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a.625 detik b. konsentrasi zat hasil reaksi d.7 kkal d. 1/16 k b. -42. 1. b dan c benar c.00 x 10-5 mol/L. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a.det. Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a. Jika energi ikatan C=O = 173 kkal/mol. H-H = 104. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2. laju pembentukan B = 0.det d. tahapan reaksi 3.4 M dt-1 e. 37a dan 3a c. -26.H + H2 ------> CH2-CH2-OH.1 b. 3/16 k e. 1/8 k c.dt pada suhu 30°C. C-H = 99. 3/8 k 5.2 M dt-1 6.50 x 10-5 mol/L.0 dan -52. -36.4molar. .3 kkal/mol dan energi ikatan ratarata C-C = 83. 3a dan 27a e.det e. konsentrasi A2B2 menjadi 0. 27a dan 1/3 a d. 0. 0.2 kkal/mol.det -5 c.50 x 10-5 mol/L. Setelah 5 detik masih ada 5 mol gas NO. Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L .3 kkal/mol.6 M dt-1 d.1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173. laju penguraian A2B2 = 0.2 M dt-1 b.

+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a. H2O2 + I.3 x 10-6 c.5 detik c. Saat 50% gas O2 berubah dan k = 1. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a. 6. diberi katalis . Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0. maka kecepatan reaksinya adalah: a. H2O e.5 mol belerang dan 0.4 0. pada suhu kamar b. IOb. 0.8 [Br-] awal mil/L 0. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a.8.8 detik e. IO. 1.3 x 10-12 b. Essay [nilai 2 per soal] 1.24 0. rumus kecepatan reaksi itu b.------> H2O + IOII.01 0.2 detik d.2 x 10-9 9.4 0.3 x 10-3.8 0.24 [H+] awal mol/L 0.24 0.01 0. Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0. a dan b benar II. 8.2 detik 10. H2O2 d. 37.4 mol gas O2.5 x 10-6 d. 3.48 0. Suatu reaksi berlangsung dalam dua tahap berikut: I. Ic. 320 menit b. 28. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat. pada suhu tinggi c. 83.25 x 10-7 e.18. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a.01 0. tingkat reaksi total 2.

You're Reading a Free Preview

Download
scribd
/*********** DO NOT ALTER ANYTHING BELOW THIS LINE ! ************/ var s_code=s.t();if(s_code)document.write(s_code)//-->