REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

cepat mengendap jika didiamkan. asam klorida. Mg. Pernyataan berikut ini yang benar adalah : a. Ba(OH)2(aq) + HCl(aq). c. Reaksi berikut ini akan menghasilkan endapan garam. Zn. e. dan c benar. e. c. Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. BaCl2(aq) + Na2CO3(aq). d. b. b. SO2 + K2Cr2O7 + H2SO4.e. (c). c. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa.net. d.id KOLOID MULTIPLE CHOICE [1]. Suatu sistem koloid. e. HCl. b. [6]. dan dengan api gas itu akan meletup adalah: a. kertas saring menjadi tidak berwarna. b. dan c benar. e. a. a dan b benar. gas tidak berbau. gas tidak berwarna. d. kertas saring menjadi tidak berwarna. Pada reaksi antara Na2SO3 + HCl . [10]. [8]. gas berwarna kuning-coklat. dan c benar. air kapur + gas CO2 berlebih. Fe + CuSO4. partikelnya bersifat antara lain:a. dapat menyala jika ke dalamnya dialiri arus listrik. e. . b.1 mµ. [5]. d. endapan putih berubah menjadi merah. dan c benar. a dan b benar. asam nitrat. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. memiliki diameter < 0. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. d. c. kecuali: a. Kunci Jawaban: e-mail ke johanoni@cbn. kertas saring menjadi hijau. b. c. b. gas berbau amoniak. HNO3. CaCl2(aq) + H2SO4(aq). b. a dan b benar. d. kertas saring menjadi hijau. a. Cu + FeSO4. ZnO(s) + NaOH(aq). a. e. e.tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. c. NaOH. Ba(OH)2(aq) + H2SO4(aq). b. [7]. a. Fe. kertas saring menjadi biru. a dan b benar. gas berbau menyengat. Zn + NaOH. [9]. d. asam sulfat. b. CaCl2(aq) + Na2CO3(aq). b. c. ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a. (b). Logam yang dengan HCl akan menghasilkan gas.

di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya.18H2O. suspensi(sabun sebagai emulgator). sehingga: a. [11]. kimia. sedikit larut dalam alkohol. cat kayu atau cat tembok. c. liofob-gel. c. b. b. fisika. emulsi (sabun sebagai koloid pelindung). b. suspensi. c.awan dan kabut.b. Sistem koloid yang pelarutnya aseton. gel. emulsi (sabun sebagai emulgator). b. e. dispersi-mekanis. b. intan hitam dan beberapa jenis mutiara. e. liofob-sol. partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-. c. air laut. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. dispersi. b. d. mutiara. emulsi. d. keju dan mutiara. air dan diberi emulgator (emulsi padat). emulsi padat.suspensi (sabun sebagai koloid pelindung). b. d. sol. b. [7]. c. e.tetapi jika diberi sabun secukupnya maka akan terjadi: a. e. d. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. [12]. [13]. susu dan Scott's Emulsion (minyak ikan).kondensasi.jawaban a. dispersi. [5]. hidrolisis. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a. gel.partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-.kondensasi. air (kondensasi kimia). dispersi-busur Bredig. . c. d. c. e. e. d. Contoh emulsi padat antara lain adalah: a. c. e. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. buih atau busa. [10]. b. belerang disulfida atau alkohol (kondensasi fisika). b.emulsi padat.hidrosol.emulsi padat (sabun sebagai koloid pelindung atau emulgator). Jika bubuk agar-agar diberi air lalu dimasak. tinta dan cat. Alum yaitu Al2(SO4)3. e. Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan. c. e. santan. debu. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a. dapat digolongkan sebagai: a. kaca warna. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . karbon aktif atau norit. b. asap. liofil-gel. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a. air (kondensasi fisika). [3]. Diketahui belerang tidak dapat larut dalam air. redoks. dan agak larut dalam belerang disulfida. [6].hidrofob. e. c. d.[2]. d. d. hidrosol. c. Diketahui bahwa air tidak dapat bercampur dengan minyak. d. liofob.hair spray. sol. [8]. e. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air.hidrofil. d. kondensasi-redoks. c. e. mentega. Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a. aerosol. asap dariknalpot bis. cat semprot (Pylox). kondensasi. tergolong sebagai: a. jawaban a dan b benar. b. belerang disulfida atau alkohol (kondensasi kimia). bersifat sangat stabil. d. dan c benar. [4]. [9].

d. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6. c. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5. e. b. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. e. (CH3)2-CH-CH2-CH2OH. Senyawa berikut ini yang tidak dapat berisomeradalah: a. zat (berupa koloid) untuk membuat emulsi. 2-metil butana 3-karboksilat. d. CH3-(CH2)2-CHOH-CH3. alkena dengan sikloalkana. dietileter. dietil keton. [5]. Oksidasi suatu alkohol menghasilkan 3-metil butanal.id (ini pelayanan gratis !) ESSAY 1.3-metil 2-butanol. Senyawa 2-metil butanal berisomer dengan: a. dua macam koloid bermuatan berlawanan dicampurkan. e. 2. alkanal dengan alkanon. Alkoholtersebut adalah: a. zat(bukan koloid) untuk membuat emulsi. b.e. Peristiwa koagulasi dapat terjadi sebagai berikut. etil propil karboksilat.3-dimetilpropana karboksilat.e. e.c. b. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain. [3]. c. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. propilpropanoat. Kunci Jawaban: e-mail ke koloid@a03jkt. b.zat (bukan koloid) untuk mencegah koagulasi suatu koloid . c.3-metil butana 2-karboksilat. d. 3-pentanol. alkana dengan sikloalkana. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4. eter dengan alkohol. 2. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. b. . alkanoat dengan ester. [2]. c. ke dalam sistem koloid dimasukkan suatu elektrolit.bpkpenabur. CH3-CH2-CHOH-CH2-CH3. [4]. Koloid pelindung adalah merupakan: a. b. Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3. d. propana etana karboksilat. [15]. kecuali:a.3-dimetilbutanoat. zat penolong (berupa koloid) untuk membuat emulsi.3-dimetil butirat.[14]. e. etil isopropil eter.d. d. d.b. propil etanoat. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a.c. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1]. propana etilkarboksilat.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan. 2. CH3-C(CH3)2-CH2OH. sistem koloid dipanaskan. CH3-(CH2)3-CH2OH.or. c.

dietil eter. c. Fehling B terdiri dari kaliumnatrium tartrat. e.3. Fehling B terdiridari NaOH dan kalium natrium tartrat. [9]. mencegah oksidasi. Suatu senyawa karbon. [13]. a dan b benar. b. b. tersier butil alkohol. kecuali:a.4. [7].3-dimetil pentanal. supaya teroksidasi. 2-metil propanoat.3. 1. alkanon. [8].4-dimetil2-heksanol. ditambahkanH2SO4 pekat yang maksudnya adalah: a. d. Penamaanyang benar semuanya terdapat pada: a. b. metil propanoat. Pernyataan yang tepat mengenai larutan Fehling adalah:a.metanol.Fehling A terdiri dari NaOH dan Cu2O.oksidasi 2-butanon. d. etanoldengan asam sulfat pekat. Fehling A terdiridari Cu2O. Fehling B terdiri dari NaOH. b. oksidator. c. Pereaksi Tollen bersifat sebagai berikut: a.a. e. [14]. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. mengandung garam perak dalam larutan amoniaberlebih.3-dimetil 2-butanon. d. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. 1.[6]. 1. dan c benar. b. menggeser kestimbangan reaksi. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. b. dan c benar. propil metanoat. e. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. e. alkanal. [15].oksidator. etanol dengan etanoat. e.2-dimetil propana. formalin. b. c. d. b. e. c. reduktor. b. d. mengandung CuO dalam larutan kalium natrium tartrat. [18]. 2. [17]. Dietil eter dapat dihasilkan dari reaksi: a. etil etana karboksilat. Fehling A terdiridari CuSO4 dan NaOH. a dan b benar. tak dapat dioksidasi. e.aseton. b.3. [11]. dan denganasam asetat terbentuk ester. b. Fehling B terdiridari NaOH dan kalium natrium tartrat. 2. a dan b benar. matanal. n-butanal. oksidasi2butanol. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar.2. b. (2) 2-etoksi propana.maka senyawa itu kemungkinan adalah: a. alkil alkana sulfat. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. b. [10]. 2. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. metanal.aseton. metil alkohol. d. c. c. e.3. ester. d. d.(3) 2-propoksi etana. d. b. maka senyawa tersebut adalah: a. . c. 1. e. e.propanon.d.mengandung garam perak dalam larutan amonia berlebih. asetaldehida.4. d. n-butanon. [16].mengikat air yang terjadi.n-butanol. etil alkohol.4.c. a. b. c. (4) etil sekunder propil eter. butanoat. c. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter.dietil eter.3.c. metanol. d. [12]. oksidasi 2-butanal.4. c. 3.alkanol. etena. a dan b benar.2. d. b. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. Fehling B terdiri dari NaOH dan kalium natriumtartrat. e. a. dietil keton. Pada reaksi metil alkohol + asam salisilat. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a.2. e. Etil asetat berisomer dengan senyawa berikut ini. 2. dan c benar. Fehling A terdiri dari CuSO4.3-dietil butana. c.

(b). banyaknya partikel zat terlarut d. KMnO4 + H2SO4. mengandung senyawa perak dan CuOdalam NaOH.pereaksi Tollen.net. etil alkohol + NaOH(aq)+ I2(KI aq). Kunci Jawaban: e-mailke johanoni@cbn. titik beku pelarutnya lebih rendah daripada titik beku larutannya c. a dan bbenar. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. demetil keton + NaOH(aq)+ I2(KI aq). keduanya bukan elektrolit b. (d). karena: a. jumlah mol zat terlarut dalam 1 L pelarut d. c. keduanya adalah nonelektrolit . PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. jenis partikel zat terlarut e. massa jenis larutan b. e. d. tuliskan pula masing-masingnamanya ! [3]. tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e. Titik didih larutan CaCl2 0. butil alkohol dengan K2Cr2O7+ H2SO4. CuSO4 0. (e) formalin dengan pereaksi Tollen.2M 2.2M b. pH pelarutnya lebih besar daripada pH larutannya 3. ESSAY [1].reduktor.3M c. asetaldehida + NaOH(aq)+I2(KI aq). Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. pereaksi Fehling.01 molal dan titik didih larutan glukosa (C6H12O6) 0.5 M d. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. jumlah mol zat terlarut dalam 1000 g larutan e. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b. (c). Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. warna zat pelarut c.b. mengandung CuO dalam kalium natriumtartrat. K2Cr2O7 + H2SO4. metanal denganpereaksi Fehling. jumlah mol zat terlarut dalam 1 L larutan c. CH3COOH 0. Harga kenaikan titik didih molal (Kb) bergantung pada: a.id Kembali ke Kimia SMU Home Page . Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a. [19]. jumlah mol zat terlarut dalam 1000 g pelarut 4. jumlah g zat terlarut dalam 1 L larutan b. Mg(NO3)2 0. glukosa 0.(f). Tuliskan reaksi yang terjadi pada: (a). banyak sedikitnya larutan 5. Na2CO3 0. reduktor.03 molal adalah sama. e.8M e. Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a.

2M c. massa jenis pelarut lebih besar daripada massa jenis larutannya 10.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. Tekanan osmotiknya = 15. derajat ionisasi = 1 c.5 M d. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2.046 C° . berapakah Mr zat non-elektrolit tersebut ? 3. 1 mol NaCl dalam 1000 g pelarut b. titik beku pelarut lebih tinggi daripada titik beku larutannya c.3M b. Jika penurunan titik beku molal air 1. Na2CO3 0.2 g air pada p dan t yang sama? Ka = 1 x 10-7. CO(NH2)2 0.1M d.125 g/mL dan massa molekul relatif elektrolit 125. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6.c. n = 2 d. merupakan elektrolit biner dalam b. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e. glukosa 0.2 cmHg. isotonik b.2M 11. n disebut faktor van't Hoff 2x e. 1 g NaCl dalam 1 L larutan 9.3M e. CuSO4 0.2M 8. NaCl 0. jumlah partikel larutan menjadi II. 1 mol NaCl dalam 1000 g larutan c. C6H12O6 0. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a.1 mol suatu asam lemah bervalensi satu dalam 88.2M b. titik didih pelarut lebih rendah daripada titik didih larutannya b.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL.3M c. monotonik 7. Berapa tekanan uap jenuh larutan 10. I. jumlah partikel yang ada dalam kedua larutan sama banyak e. maka larutan A terhadap larutan B disebut: a. Sebanyak 3.86 C°. Mg(NO3)2 0. Ca(NO3)2 ------> Ca2+ + 2NO3a. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. AlCl3 0. 1 g NaCl dalam 1 L larutan e. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. 1 mol NaCl dalam 1 L larutan d. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! .8M e. Berapa tekanan uap jenuh 100mL larutan 0. hipertonik d. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g. Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a. hitunglah derajat pengionan elektrolit tersebut ! 3. massa jenis larutan 1. CH3COOH 0. hipotonik c. NaCl 1m artinya: a. Ba(NO3)2 0. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d. Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a. supertonik e. keduanya adalah elektrolit kuat d. ESSAY 1.

HCl d.[g]/Kb d. karena Kw tetap 8. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. larutan asam akan mengurangi [OH-] dalam air. Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. K2 = 6. Harga tetapan kesetimbangan air dapat berubah oleh: a. Ka = K1 x K2 x K3 c. pernyataan yang salah adalah: a. penambahan garam b. 10-2M e.Ka/Kb 10. Ka nya d.1M . kecuali: a. (NH4)2SO4 e. NH4Cl c.dalam larutan H2SO4 0. Pada larutan asam fosfat 0. NaHSO4 b. asam sangat lemah + basa lemah berlebih e. asam lemah + basa kuat 4.Ka + ½ c. [H ] = (Kw) . asam sangat lemah + basa sangat lemah c. karena Kw tetap e. asam kuat + basa lemah e.[g]/Kw e. NaOH merupakan basa pekat karena mudah larut dalam air c.Ka/Kw b. jika diketahui K1 = 5. penambahan basa d. kesetimbangan air akan bergeser d. umumnya dipakai air sebagai pelarut.005 N adalah: a. Pernyataan yang benar di antara pernyataan berikut ini adalah: a. asam sangat lemah berlebih + basa lemah . harga Kw tetap tidak berubah b. Dalam kesetimbangan asam-basa. Larutan penyangga dapat terjadi sebagai berikut.4 x 10-13. [H+] = (Kb)½/Kw.1.9 x 10-3 . 5 x 10-3M c. penambahan asam c. asam kuat + basa kuat b. asam kuat + basa lemah berlebih b. Larutan HCl merupakan asam kuat karena akan terion sempurna d. kecuali: a.3 x 10-8. perubahan tekanan e. [H+]3 = [PO43-] b. NH4OH merupakan basa kuat karena mudah larut dalam air b. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. dan K3 = 4. volumenya 7. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a. [H+] = (Kb)½. asam lemah + basa lemah d. harga Kw berubah. 10-12M d. 2. [H+] ={ [asam] x K1}½ d. asam lemah berlebih + basa kuat c. karena pH berubah c. asam lemah + basa sangat lemah berlebih d. larutan basa akan mengurangi [H+] dalam air. konsentrasinya e. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. maka yang pH nya paling tinggi: a. derajat ionisasinya c. [H+] = (Kw)½. Jika zat di bawah ini konsentrasinya 1 M. Konsentrasi ion OH.5 x10-3M b. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a. [H+] = (Kb)½. CH3COONa 3. jenis pelarutnya b. perubahan suhu 6. tidak ada 2. dari data itu pengaruh K2 dan K3 tidak berarti e.

NH3 adalah basa karena sebagai donor elektron II. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0. maka kalor yang dibebaskan adalah: a. jika 1. NH3 adalah basa karena sebagai akseptor proton c. Berapa K1 asam itu ? 2.log 3. (NH4)2CO3 b.1 kkal c.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. NH3 adalah basa karena sebagai akseptor elektron e. berdasarkan konsep Bronted-Lowry. berapa L HCl 0. NH3 adalah basa karena sebagai donor proton d. PO43. terjadi perubahan suhu dari 30°C menjadi 35°C.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. 10 kkal/mol b.01 N ! I. HCl + H2O -------> H2O+ + Cl-.5M. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). NH4Cl c.1 kkal/mol b. HCl e. Pada percobaan panas reaksi.1 kkal/mol. pernyataan yang salah berdasarkan teori Lewis: a. Derajat ionisasi asam tersebut adalah 3%.1 kkal/mol 2. HCl b. Hitung derajat pengionan asam itu ! 5. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. Diketahui pH CH3COOH 0. NaCl d. O=O. H3O+ d.0 kkal/mol c.1 N mempunyai pH = 3 . Bila 1 mol gas CO2 = 30 L. Pada reaksi C(s) + O2(g) -----> CO2(g). dibebaskan kalor sebesar 94.02 N dengan 400 ml HNO3 0.1M = 3. pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a. Energi ikatan CO2(g) = +94. 20 kkal/mol 3. NH3 + HCl ------> NH4Cl.1 kkal/mol d. Cle.c.4 kkal/mol d. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a. 1200 kal/mol e.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3. 1. a dan b benar e. tidak ada 13.Hitunglah! a. NH3 adalah basa karena dapat mengikat H b. NaOH d. Dalam hal ini pernyataan yang tidak sesuai adalah: a. a dan c benar 12. berapa mL HCl 0. H2O c. H3O+ 14. Hf CO2(g) = -94. H-O. Jika diketahui energi ikatan rata-rata H-H.b. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4. Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e. HCO3. zat yang merupakan asam sangat kuat adalah: a. Larutan asam fosfat 0. 2. ESSAY 1. Hc C(s) = -94.11. berturut-turut adalah 104 . Hr = -94.

64 kkal d. jawaban b dan c benar c. -720 kJ d. 0.8 kJ/mol 9.2 J/g°C. 81. 14.05M.32 kkal e. +30 kJ c. 36. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a. OH-(aq)+ H+(aq) --->H2O(l) c. -28.4 kJ/mol e.5 kkal b.5 kkal d. kalor pembakaran C2H5OH = +1380 kJ.12 kkal c. 12.5 g e. -3 kkal 4. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ.5 kkal/mol e. O = 16) a. -113 kkal c.24 kkal/mol d. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. Jika kalor pembentukan H2O(l) 68400 kal. -2100 kJ 5.6 kJ/mol c. 0. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1. Kalor pembakaran metanol itu adalah: a. Bila 1 mol gas CO2 = 30 L. C(s) + 2S(s) -----> CS2(g) 7. 29.2 g d. 2H(g) + O(g) ----> H2O(l) d. 16.800 kal.4 kkal b.5 kJ/mol. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal. H2(g) + ½O2(g) ---> H2O(l) b. 2H2(g) + O2(g) -----> 2H2O(g) 8. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. C(s) + 2S(s) -----> CS2(l) e. jika 0. 25. 0. 50. dipanaskan selama lima menit hingga suhu akhir 55°C. 91. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi.6 g c. 119 kkal/mol.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ. -184.1 kkal/mol c. 100. 36. +7200 kJ e. 110 kkal/mol. C(g) + 2S(g) -----> CS2(g) b. Jika diketahui Hf HCl = -92. 2 kkal/mol 6. maka kalor pembentukan natrium oksida adalah: a. 504 kJ/mol b. Mr metanol = 32.kkal/mol. 2H(g) + O(g) ---> H2O(g) e. Pada percobaan panas reaksi.3 g b. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a. Untuk itu digunakan 50 mL air yang suhunya 25°C. terjadi perubahan suhu dari 30°C menjadi 35°C. 100 kkal/mol b.3 kkal e.2 kkal 10. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18. 7. C(g) + ¼S8(g) -----> CS2(g) d. -30 kJ b. -56. Diketahui kalor jenis air = 4. 218. maka kalor yang dibebaskan adalah: a. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g. 73 g O // . Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH).2 kJ/mol d.

Setelah berapa detik gas Br2 tinggal 8 mol ? a. a dan b benar b.0 detik .dt pada suhu 30°C. 27a dan 1/3 a d.625 detik b. a dan c benar c. 37a dan 3a c.2 M dt-1 6.3 kkal/mol. 1. -42. konsentrasi zat hasil reaksi d. 1.H + H2 ------> CH2-CH2-OH. -26. C-H = 99. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a. pernyataan yang benar adalah: a. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a. maka perubahan entalpi reaksi itu adalah: a.det d. -16. 1/3 a dan 27a b.det e. -31. Konsentrasi A2B2 mula-mula 1 molar.7 kkal d. -17. . 1/3 a dan 9a 7.2 M dt-1 b. 8.det b. konsentrasi A2B2 menjadi 0. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. laju penguraian A2B2 = 0. 1/16 k b. konsentrasi pereaksi e.6 M dt-1 c. tahapan reaksi 3. b dan c benar c.det. maka pada saat konsentrasi P tinggal 3/4 mol/L. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0.0 detik e. luas permukaan kontak d. 10.1 b.50 x 10-5 mol/L. 1/8 k c.2 kkal/mol. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a. Setelah reaksi berlangsung 2 detik. 3a dan 27a e.3 kkal c. laju reaksinya adalah: a.4molar.det -5 c.1 d. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]². C-O = 85 kkal/mol. laju pembentukan B = 0. -24. Diketahui reaksi CH3. 0. H-H = 104.5 kkal 12. -14.8 c.4. 3/16 k e. Jika energi ikatan C=O = 173 kkal/mol.1 I. Setelah 5 detik masih ada 5 mol gas NO.1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173. Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L . 0.3 kkal/mol dan energi ikatan ratarata C-C = 83.4 M dt-1 e. laju pembentukan A = 0. 0.det 2.1 e. dan OH = 110. Jika konsentrasi P dan Q mula-mula 1 mol/L. Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a.1 kkal/mol. 27/64 k d. Laju pembentukan NO2 adalah: a. -32 kkal e. 0.6 M dt-1 d.25 x 10-5 mol/L.00 x 10-5 mol/L. 3/8 k 5. Pada suhu tertentu. 1. a dan b benar b.8 detik c. konsentrasi zat hasil reaksi e. Jika diketahui energi ikatan rata-rata C-H = 99. -36. laju pembentukan A = 1.50 x 10-5 mol/L. konsentrasi pereaksi 4.50 x 10-5 mol/L.25 detik d.0 dan -52.75 x 10 mol/L.11. Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g).C-. laju penguraian A2B2 = 0. Pada reaksi penguraian A2B2 -----> 2A + 2B. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C . 0.9 kkal b.6 kkal/mol.

3 x 10-12 b.01 0. H2O2 d.48 0.8 detik e. tingkat reaksi total 2. Saat 50% gas O2 berubah dan k = 1.8 0.2 x 10-9 9.01 0. rumus kecepatan reaksi itu b.3 x 10-6 c. diberi katalis . 37. 8.+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a. pada suhu tinggi c. 1.01 0. 3. 28.2 detik 10. pada suhu kamar b.8. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat. 6.24 0.24 0.5 detik c. H2O2 + I.8 [Br-] awal mil/L 0. 83.2 detik d. maka kecepatan reaksinya adalah: a.4 0. Suatu reaksi berlangsung dalam dua tahap berikut: I. IOb.4 0.5 x 10-6 d.4 mol gas O2. Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0. 320 menit b.25 x 10-7 e.3 x 10-3. Ic.------> H2O + IOII. 0. Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0.5 mol belerang dan 0. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit.24 [H+] awal mol/L 0.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a.18. IO. a dan b benar II. H2O e. Essay [nilai 2 per soal] 1.

Sign up to vote on this title
UsefulNot useful