REAKSI LARUTAN ELEKTROLIT MULTIPLE CHOICE [1]. Serbuk ZnO + H2O, diberi beberapa tetes pp, maka akan terjadi: a.

larutan berwarna merah ungu, karena terbentuk basa Zn(OH)2; b. larutan berwarna merah ungu, karena terbentuk asam H2ZnO2; c. larutan yang tidak berwarna, karena bersifat basa; d. tidak bereaksi, karena ZnO mudah larut dalam air; e. tidak bereaksi, karena ZnO tidak larut dalam air. [2]. Cu(OH)2 dapat terjadi dari reaksi: a. CuO(s) + H2O; b. CuSO4(aq) + NaOH(aq); c. CuO(s) + NaOH(aq); d. a dan b benar; e. a, b, dan c benar. [3]. Serbuk MnO2 dalam HCl akan terjadi: a. tidak bereaksi karena MnO2 merupakan oksida indiferen; b. tidak bereaksi karena MnO2 merupakan oksida amfoter; c. tidak bereaksi karena MnO2 merupakan oksida asam; d. tidak bereaksi karena MnO2 merupakan oksida basa; e. bereaksi membentuk MnCl4 + H2O. [4]. Cairan hasil campuran serbuk CaO dengan air + 1 tetes indikator pp, ketika ditiup dengan udara pernafasan terajdi hal berikut ini, kecuali: a. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh kemudian bening kembali; b. warna larutan tidak berubah, larutan mengeruh kemudian bening kembali; c. warna larutan merah berubah menjadi tidak berwarna, larutan mengeruh atau mengendap, tidak dapat larut lagi; d. endapan putih tidak larut;

dan c benar. HNO3. d. b.1 mµ. endapan putih berubah menjadi merah. asam nitrat. c. Ba(OH)2(aq) + HCl(aq). b.net. kertas saring menjadi biru. partikelnya bersifat antara lain:a. c. asam sulfat. kertas saring menjadi hijau. e. BaCl2(aq) + Na2CO3(aq). ESSAY Tuliskan reaksi dan perubahan warna yang terjadi pada: (a). b. gas yang terjadi diperiksa dengan keratas saring yang dibasahi dengan larutan K2Cr2O7 + H2SO4. dapat terlihat jelas dengan mikroskop ultra tetapi tidak tampak dengan mikroskop biasa. a dan b benar. e. e. b. e. HCl. CaCl2(aq) + H2SO4(aq). Fe + CuSO4. dan c benar. Cu + FeSO4. gas berwarna kuning-coklat. Pernyataan berikut ini yang benar adalah : a. cepat mengendap jika didiamkan. Logam Cu akan menghasilkan gas berwarna kuning-coklat dengan: a. d. . asam klorida. Kunci Jawaban: e-mail ke johanoni@cbn. dapat menyala jika ke dalamnya dialiri arus listrik. b. gas berbau amoniak. memiliki diameter < 0. c. b. b. Mg. Pada reaksi antara Na2SO3 + HCl . NaOH. a. e. (c). d. dan c benar. ZnO(s) + NaOH(aq). [9]. Reaksi berikut ini akan menghasilkan endapan garam. a. e. a dan b benar. Reaksi berikut ini yang menghasilkan endapan logam lain adalah: a. d. kertas saring menjadi hijau. [6]. b. Zn. gas tidak berbau. c. b. [8]. a dan b benar. Logam yang dengan HCl akan menghasilkan gas. SO2 + K2Cr2O7 + H2SO4. Gas hidrogen dapat dihasilkan dari reaksi seng dengan larutan: a. b. [5]. gas tidak berwarna. [10]. (b). CaCl2(aq) + Na2CO3(aq). kertas saring menjadi tidak berwarna. kecuali: a. [7]. kertas saring menjadi tidak berwarna. c. d. a. dan c benar. air kapur + gas CO2 berlebih. a dan b benar. c. Suatu sistem koloid. dan dengan api gas itu akan meletup adalah: a. b.e. Zn + NaOH. gas berbau menyengat. d. d. a.tidak dapat terpisah dengan penyaring biasa tetapi dapat terpisah dengan penyaring ultra. e. Ba(OH)2(aq) + H2SO4(aq). Fe. c.id KOLOID MULTIPLE CHOICE [1].

liofob-gel. intan hitam dan beberapa jenis mutiara. dispersi-busur Bredig. tinta dan cat. c. Contoh pembuatan sistem koloid secara dispersi-peptisasi antara lain ialah: a.18H2O. sedikit larut dalam alkohol. gel. e. partikel koloid akan bermuatan negatif karena cenderung mengikat ion H+. dan c benar. e. sol. c. c. d. c. b. d. b.jawaban a. [5]. [10]. d. [9]. b.kondensasi. b. Nama koloid yang terjadi dari fase terdispersi gas dengan fase pendispersi cair adalah: a. air laut. kondensasi. Jika bubuk agar-agar diberi air lalu dimasak. asap. di dalam air akan terhidrolisis membentuk sistem koloid yang dapat mengadsorpsi partikel halus atau ion-ion di sekitarnya. e. sol. dapat digolongkan sebagai: a. b. dispersi. liofob-sol. [7]. belerang disulfida atau alkohol (kondensasi fisika).awan dan kabut.b. b. d. kimia. d. d. b. air dan diberi emulgator (emulsi padat). santan. Diketahui bahwa air tidak dapat bercampur dengan minyak. suspensi(sabun sebagai emulgator). asap dariknalpot bis.hair spray.kondensasi. b.suspensi (sabun sebagai koloid pelindung). emulsi (sabun sebagai koloid pelindung). bersifat sangat stabil. d. e.hidrofil. dan agak larut dalam belerang disulfida. maka setelahdingin akan terjadi sistem koloid yang berdasarkan jenis wujud zat terdispersi dan pendispersinya dapat digolongkan sebagai: a. emulsi. e. [12].emulsi padat (sabun sebagai koloid pelindung atau emulgator). c. partikel koloid akan tidak bermuatan karena cenderung mengikat molekul air. [6]. . b. c. keju dan mutiara. c. e. suspensi. cat semprot (Pylox). [13]. Pembuatan sol perak dari reaksi Ag+ dan Fe2+menjadi Ag dan Fe3+ merupakan cara pembuatan sistem koloid: a.partikel koloid akan bermuatan negatif karena cenderung mengikat ion OH-. c. b. jawaban a dan b benar. b. dispersi-mekanis.hidrosol. hidrosol. d. c. aerosol. Contoh emulsi padat antara lain adalah: a. Pembuatan sol emas dalam air dapat dilakukan secara berikut yaitu: a. c. d.[2]. b. liofob.hidrofob. [3]. buih atau busa. karbon aktif atau norit. e. hidrolisis. e. mutiara. c. e. [11].tetapi jika diberi sabun secukupnya maka akan terjadi: a.emulsi padat. emulsi padat. c. cat kayu atau cat tembok. d. e. fisika. Alum yaitu Al2(SO4)3. tergolong sebagai: a. d. e. Diketahui belerang tidak dapat larut dalam air. Supaya terjadi sistem koloid maka belerang itu harus dimasukkanke dalam: a. sehingga: a. gel. [8]. liofil-gel. debu. dispersi. susu dan Scott's Emulsion (minyak ikan). kondensasi-redoks. air (kondensasi fisika). mentega. emulsi (sabun sebagai emulgator). Di antara zat berikut ini yang bukan merupakan sistem koloid ialah: a. d. belerang disulfida atau alkohol (kondensasi kimia). redoks. Sistem koloid yang pelarutnya aseton. kaca warna. partikel kolid akan bermuatan positif karena cenderung mengikat ion H+ . [4]. air (kondensasi kimia). e. partikel koloid akan bermuatan positif karena cenderung mengikat ion OH-. Berdasarkan sifat kelarutan zat terdispersi dalam zat pendispersinya maka sistem koloid yang terjadi dari agar-agar dengan air yang telah dimasak dan didinginkan.

bpkpenabur. [15]. zat penolong (berupa koloid) untuk membuat emulsi. propil etanoat.3-dimetilpropana karboksilat. d.3-dimetilbutanoat. e.c. b. Peristiwa koagulasi dapat terjadi sebagai berikut.ke dalam sistem koloid ditambahkan fase pendispersinya secara berlebihan. alkanoat dengan ester. eter dengan alkohol. 2. Apakah yang dimaksud dengan elektroforesis ! Buat gambarnya! 4. [2]. [5]. c. Jelaskan terjadinya efek Tyndall pada sistem koloid ! Buatgambarnya ! 3. b. d. CH3-(CH2)3-CH2OH.3-metil 2-butanol. Kunci Jawaban: e-mail ke koloid@a03jkt.3-dimetil butirat. Jelaskan terjadinya gerak Brown pada sistem koloid ! Buat gambarnya! 2. c. e. . 2. b. Apakah kegunaan pesawat Cotrell ! Buat gambarnya ! 6. kecuali:a. sistem koloid dipanaskan. d. CH3-C(CH3)2-CH2OH. 3-pentanol. e. d. c. ke dalam sistem koloid ditambahkan fase terdispersinya secara belebihan. 2-metil butana 3-karboksilat. alkena dengan sikloalkana.3-metil butana 2-karboksilat. e. [3]. 2. d. e. ke dalam sistem koloid dimasukkan suatu elektrolit. Alkoholtersebut adalah: a. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah: a. etil isopropil eter. d. Jelaskan cara pembuatan koloid dengan busur Bredig ! Buat gambarnya! Kembali ke Kimia SMU Home Page KIMIA KARBON MULTIPLE CHOICE [1]. zat (berupa koloid) untuk membuat emulsi. b. Senyawa berikut ini yang tidak dapat berisomeradalah: a.c. alkanal dengan alkanon.zat (bukan koloid) untuk mencegah koagulasi suatu koloid . b. propilpropanoat. [4]. b. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah: a.e. CH3-(CH2)2-CHOH-CH3.or.b.id (ini pelayanan gratis !) ESSAY 1. c. Oksidasi suatu alkohol menghasilkan 3-metil butanal. dietil keton. propana etana karboksilat. c. CH3-CH2-CHOH-CH2-CH3. dietileter. Senyawa 2-metil butanal berisomer dengan: a.d. etil propil karboksilat. Koloid pelindung adalah merupakan: a. Apakah yang dimaksud denngan dialisis ! Buat gambarnya ! 5. dua macam koloid bermuatan berlawanan dicampurkan.e. zat(bukan koloid) untuk membuat emulsi.[14]. zat (berupa koloid) untuk mencegah koagulasi suatu koloid lain. alkana dengan sikloalkana. (CH3)2-CH-CH2-CH2OH. propana etilkarboksilat.

Penamaanyang benar semuanya terdapat pada: a. a dan b benar. [8]. dan c benar.2. b. 2-metil propanoat. metil alkohol. Dietil eter dapat dihasilkan dari reaksi: a. c. dan c benar. Suatu senyawa karbon. c. e. e. [7].metanol.[6]. Pernyataan yang tepat mengenai larutan Fehling adalah:a. b. ester.c. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar. c. metanal. butanoat.d. e. c. 2. alkanal. [14]. b. e. a dan b benar. alkanon. dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi. [17].n-butanol.oksidasi 2-butanon. etil alkohol. tak dapat dioksidasi.aseton. Fehling B terdiri dari NaOH dan kalium natriumtartrat. e.aseton. b. alkil alkana sulfat. e.3. Fehling A terdiridari CuSO4 dan NaOH. [13]. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah: a. b. metil propanoat. [9].dietil eter. 2. kecuali:a. Pada reaksi metil alkohol + asam salisilat. [15].alkanol.dietil eter. dietil keton. [12].mengandung garam perak dalam larutan amonia berlebih. mengandung CuO dalam larutan kalium natrium tartrat. c.2-dimetil propana. metanol. e. d. b. d. Fehling A terdiri dari CuSO4. . propil metanoat. asetaldehida. b. c. oksidasi2butanol. d. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah: a. e. c.3-dietil butana.3. c. (2) 2-etoksi propana. e. etena.3-dimetil pentanal. b.2. b. e. mencegah oksidasi.oksidator. b. etanoldengan asam sulfat pekat. (4) etil sekunder propil eter. b. etil etana karboksilat. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah: a. Fehling B terdiridari NaOH dan kalium natrium tartrat. oksidasi 2-butanal. c.4.4. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah: a.3. dan c benar. 1.4. n-butanon. Fehling B terdiridari NaOH dan kalium natrium tartrat. dan denganasam asetat terbentuk ester. n-butanal. formalin. a.propanon. d. Fehling A terdiridari Cu2O. a dan b benar. d.4-dimetil2-heksanol.2. c. Fehling A terdiri dari CuSO4dan kalium natrium tartrat. [11]. b. maka senyawa tersebut adalah: a. a dan b benar. 1.3. b. supaya teroksidasi. d. oksidator. etanol dengan etanoat.maka senyawa itu kemungkinan adalah: a.(3) 2-propoksi etana. [10]. Pereaksi Tollen bersifat sebagai berikut: a. b.mengikat air yang terjadi. Fehling B terdiri dari NaOH. a.a. reduktor. ditambahkanH2SO4 pekat yang maksudnya adalah: a. d. e. 1. tersier butil alkohol. 2. b. [16]. d. Fehling B terdiri dari kaliumnatrium tartrat. 1. d. d. [18]. matanal.c.3-dimetil 2-butanon. c. 2.3. menggeser kestimbangan reaksi. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter.4. Etil asetat berisomer dengan senyawa berikut ini.Fehling A terdiri dari NaOH dan Cu2O. tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling. b. mengandung garam perak dalam larutan amoniaberlebih. d. e. 3. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah: a. d.

3M c.pereaksi Tollen. pereaksi Fehling. glukosa 0. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. tekanan uap jenuh pelarut murninya lebih rendah daripada tekanan uap jenuh larutannya d. jumlah g zat terlarut dalam 1 L larutan b. asetaldehida + NaOH(aq)+I2(KI aq). etil alkohol + NaOH(aq)+ I2(KI aq). karena: a. c. d. (d). a dan bbenar. tekanan osmotik pelarutnya lebih tinggi daripada tekanan osmotik larutannya e. Tuliskan reaksi yang terjadi pada: (a). Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:a. titik didih pelarutnya lebih tinggi daripada titik didih larutannya b.01 molal dan titik didih larutan glukosa (C6H12O6) 0. Sifat koligatif larutan ialah sifat larutan yang hanya dipengaruhi oleh: a. [19]. e. Kunci Jawaban: e-mailke johanoni@cbn.2M b. ESSAY [1]. banyak sedikitnya larutan 5.2M 2.03 molal adalah sama. keduanya adalah nonelektrolit . e. jenis partikel zat terlarut e. mengandung CuO dalam kalium natriumtartrat.(f). K2Cr2O7 + H2SO4. CuSO4 0. (e) formalin dengan pereaksi Tollen. jumlah mol zat terlarut dalam 1 L larutan c. tuliskan pula masing-masingnamanya ! [3]. metanal denganpereaksi Fehling. jumlah mol zat terlarut dalam 1000 g pelarut 4. demetil keton + NaOH(aq)+ I2(KI aq). Mg(NO3)2 0. reduktor. CH3COOH 0.8M e. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O. butil alkohol dengan K2Cr2O7+ H2SO4. jumlah mol zat terlarut dalam 1000 g larutan e. titik beku pelarutnya lebih rendah daripada titik beku larutannya c. Garam NH4Cl yang dilarutkan dalam air akan terjadi larutan yang: a. Di antara larutan zat berikut ini yang titik bekunya paling tinggi adalah: a. (b). jumlah mol zat terlarut dalam 1 L pelarut d.net. massa jenis larutan b.id Kembali ke Kimia SMU Home Page . banyaknya partikel zat terlarut d. Na2CO3 0.b. pH pelarutnya lebih besar daripada pH larutannya 3. (c). warna zat pelarut c.reduktor. KMnO4 + H2SO4. Titik didih larutan CaCl2 0.5 M d. Harga kenaikan titik didih molal (Kb) bergantung pada: a. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon! [2]. mengandung senyawa perak dan CuOdalam NaOH. keduanya bukan elektrolit b.

1 mol NaCl dalam 1000 g larutan c. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. isotonik b.2M 11. massa jenis larutan 1. Di antara larutan zat berikut ini yang titik bekunya paling rendah adalah: a. 1 mol NaCl dalam 1 L larutan d.2 g air pada p dan t yang sama? Ka = 1 x 10-7. Ca(NO3)2 ------> Ca2+ + 2NO3a. Larutan satu molar elektrolit biner dalam air menunjukkan penurunan titik beku 2. maka larutan A terhadap larutan B disebut: a. Ba(NO3)2 0.1 mol suatu asam lemah bervalensi satu dalam 88. Tekanan osmotiknya = 15.8M e.6 g suatu zat nonelektrolit dilarutkan dalam air sampai volume larutan = 200 mL.3M c. jumlah partikel larutan menjadi II. tekanan osmotik pelarut lebih tinggi daripada tekanan osmotik larutannya e. supertonik e. berapakah Mr zat non-elektrolit tersebut ? 3.86 C°. 1 g NaCl dalam 1 L larutan e. titik didih pelarut lebih rendah daripada titik didih larutannya b. Na2CO3 0. Mg(NO3)2 0. Sebanyak 3. jumlah partikel yang ada dalam kedua larutan sama banyak e.1M d. CH3COOH 0.3M e. Diketahui tekanan uap jenuh air pada p dan t tertentu = 20 mmHg. I. derajat ionisasi = 1 c. tekanan uap jenuh pelarut murni lebih tinggi daripada tekanan uap jenuh larutannya d. keduanya adalah elektrolit kuat d. Zat yang dilarutkan dalam suatu pelarut akan terjadi larutan yang: a.2M 8. CuSO4 0. CO(NH2)2 0. ESSAY 1. Jika penurunan titik beku molal air 1. Di antara larutan berikut ini yang mengandung jumlah partikel terbanyak: a. glukosa 0. NaCl 0.046 C° . merupakan elektrolit biner dalam b. Berapa tekanan uap jenuh 100mL larutan 0.4 g BaCl2 dalam 540 g air pada p dan t yang sama ? 2. NaCl 1m artinya: a. C6H12O6 0. hipertonik d.2M c.2 cmHg.2M b.5 M d. Berapa tekanan uap jenuh larutan 10. AlCl3 0. titik beku pelarut lebih tinggi daripada titik beku larutannya c. derajat ionisasi CaCl2 3x lebih besar daripada derajat ionisasi glukosa 6. n = 2 d. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! . massa jenis pelarut lebih besar daripada massa jenis larutannya 10. 1 mol NaCl dalam 1000 g pelarut b. Jika pada suhu yang sama 1 L gas NO yang tekanannya 38 cmHg beratnya = 15 g. Larutan A mempunyai tekanan osmotik lebih besar daripada larutan B. monotonik 7. 1 g NaCl dalam 1 L larutan 9.c.3M b. n disebut faktor van't Hoff 2x e.125 g/mL dan massa molekul relatif elektrolit 125. hipotonik c. hitunglah derajat pengionan elektrolit tersebut ! 3.

pernyataan yang salah adalah: a. derajat ionisasinya c. HCl d. asam lemah + basa sangat lemah berlebih d. asam kuat + basa lemah berlebih b. (NH4)2SO4 e.Ka/Kb 10. asam kuat + basa kuat b. harga Kw tetap tidak berubah b. 2. asam sangat lemah berlebih + basa lemah . NH4Cl c. Ka nya d.[g]/Kw e. Dalam kesetimbangan asam-basa. maka yang pH nya paling tinggi: a. CH3COONa 3.Ka + ½ c.Ka/Kw b. larutan asam akan mengurangi [OH-] dalam air. asam sangat lemah + basa sangat lemah c. asam lemah + basa lemah d. asam sangat lemah + basa lemah berlebih e. perubahan tekanan e. kecuali: a.[g]/Kb d. NH4OH merupakan basa kuat karena mudah larut dalam air b. volumenya 7. penambahan asam c. perubahan suhu 6. dan K3 = 4.5 x10-3M b. karena pH berubah c. dari data itu pengaruh K2 dan K3 tidak berarti e. penambahan basa d. Pernyataan yang benar di antara pernyataan berikut ini adalah: a.3 x 10-8. 10-12M d. [H+] = (Kw)½. Larutan garam amonium asetat dapat dihitung [H+] nya dengan rumus: a.1. Hidrolisis tidak terjadi pada garam yang terbentuk dari: a. penambahan garam b. K2 = 6. [H ] = (Kw) . NaOH merupakan basa pekat karena mudah larut dalam air c. kesetimbangan air akan bergeser d. [H+] = (Kb)½/Kw. Harga tetapan kesetimbangan air dapat berubah oleh: a. Harga pH suatu asam akan dipengaruhi oleh faktor berikut ini. Ka = K1 x K2 x K3 c. umumnya dipakai air sebagai pelarut.9 x 10-3 . [H+] = (Kb)½. Pada larutan asam fosfat 0. [H+] ={ [asam] x K1}½ d.005 N adalah: a. Jika zat di bawah ini konsentrasinya 1 M. Pernyataan yang salah jika air ditambahkan asam atau basa pada suhu tetap: a. 10-2M e. 5 x 10-3M c. Konsentrasi ion OH. karena Kw tetap e. konsentrasinya e. jenis pelarutnya b. H2SO4 merupakan basa lemah karena sukar terion dalam larutannya e. asam kuat + basa lemah e. asam lemah berlebih + basa kuat c.1M . kecuali: a. [H+] bisa dianggap hanya berasal dari kesetimbangan yang pertama 9. jika diketahui K1 = 5. asam lemah + basa kuat 4. Larutan penyangga dapat terjadi sebagai berikut.dalam larutan H2SO4 0. Larutan CH3COOH merupakan asam lemah karena sukar larut dalam air 5. karena Kw tetap 8. tidak ada 2. NaHSO4 b. harga Kw berubah. Larutan HCl merupakan asam kuat karena akan terion sempurna d. [H+]3 = [PO43-] b. larutan basa akan mengurangi [H+] dalam air.4 x 10-13. [H+] = (Kb)½.

4 kkal/mol d.1 kkal/mol b. 1200 kal/mol e. 2. Pada percobaan panas reaksi.2 N yang harus ditambahkan supaya pH larutan menjadi 5 ? b. 1 mol C(s) + 1 mol O2(g) -----> 1 mol CO2(g). a dan c benar 12.1 N mempunyai pH = 3 . Energi ikatan CO2(g) = +94.01 N ! I. NH3 adalah basa karena sebagai akseptor elektron e. Jika diketahui energi ikatan rata-rata H-H. NH3 + HCl ------> NH4Cl. Hitung derajat pengionan asam itu ! 5. Hr = -94. terjadi perubahan suhu dari 30°C menjadi 35°C.11. HCO3. berturut-turut adalah 104 .1 kkal c. NaCl d. HCl e. Hc C(s) = -94. dibebaskan kalor sebesar 94. tidak ada 13. H3O+ d. pernyataan yang salah berdasarkan teori Lewis: a. O=O. H-O. zat yang merupakan asam sangat kuat adalah: a. H2O c.1 kkal/mol d. HCl b. maka kalor yang dibebaskan adalah: a.5M. NaOH d. Derajat ionisasi asam tersebut adalah 3%. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C. 1. Molekul atau ion yang dapat bersifat amfiprotik menurut teori Bronsted -Lowry adalah: a.1 kkal/mol 2. Dalam hal ini pernyataan yang tidak sesuai adalah: a. HCl + H2O -------> H2O+ + Cl-.0 kkal/mol c.5 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. (NH4)2CO3 b. PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. Cle. NH4Cl c. ESSAY 1.b. berapa L HCl 0.1 kkal/mol. Hitung pH larutan yang terjadi dari 100 ml Ca(OH)2 0. 20 kkal/mol 3. a dan b benar e. berdasarkan konsep Bronted-Lowry. Pada reaksi C(s) + O2(g) -----> CO2(g). pH larutan yang tidak terpengaruh oleh konsentrasi garamnya adalah: a. jika 1. Larutan asam fosfat 0. NH3 adalah basa karena dapat mengikat H b. H3O+ 14. PO43. Hr = Hf CO2(g) Hf C(s) + Hf O2(g) e.2 N yang harus ditambahkan lagi supaya pH larutan menjadi 4 ? 3.Hitunglah! a. NH3 adalah basa karena sebagai akseptor proton c.log 3. Diketahui pH CH3COOH 0.02 N dengan 400 ml HNO3 0. Apakah yang dimaksud dengan kapasitas larutan penyangga? Jelaskan! 4. Hf CO2(g) = -94. berapa mL HCl 0.1M = 3. Bila 1 mol gas CO2 = 30 L. NH3 adalah basa karena sebagai donor elektron II. Berapa K1 asam itu ? 2.c. 10 kkal/mol b. NH3 adalah basa karena sebagai donor proton d.

O = 16) a. Bila 1 mol gas CO2 = 30 L. C(g) + 2S(g) -----> CS2(g) b. 2 kkal/mol 6. -2100 kJ 5.1 kkal/mol c. H2(g) + ½O2(g) ---> H2O(l) b. C6H12O6 --------> 2C2H5OH + 2CO2 adalah: a. Pada reaksi gas hidrogen dan gas klor dibebaskan kalor sebanyak 37 kJ. 36.2 kJ/mol d. -184. Jika diketahui Hf HCl = -92. Jumlah spiritus yang terpakai dalam pemanasan itu adalah 8 g.4 kJ/mol e. 119 kkal/mol. terjadi perubahan suhu dari 30°C menjadi 35°C. 218. maka kalor pembentukan natrium oksida adalah: a.6 g c. -56. Energi reaksi berikut ini yang merupakan energi ikatan ialah: a.2 kkal 10. -28. 0. 0.5 kkal d. jawaban b dan c benar c. 50. maka kalor yang dibebaskan adalah: a. -720 kJ d. 2H(g) + O(g) ---> H2O(g) e. 100.2 J/g°C. 100 kkal/mol b.800 kal. +7200 kJ e.64 kkal d. +30 kJ c. -113 kkal c.5 kkal/mol e. 12. Pada percobaan panas reaksi. Mr metanol = 32. Kalor reaksi pada fermentasi 90g glukosa menurut reaksi.3 kkal e. C(s) + 2S(s) -----> CS2(l) e.5 kkal b. 16.5 g e. 73 g O // . 29. C(g) + ¼S8(g) -----> CS2(g) d. OH-(aq)+ H+(aq) --->H2O(l) c. C(s) + 2S(s) -----> CS2(g) 7. 25. -30 kJ b. Diketahui kalor jenis air = 4. maka perubahan entalpi pada pembentukan 18 g air adalah: (Ar H = 1.24 kkal/mol d.05M. 81.32 kkal e. 110 kkal/mol. 2H2(g) + O2(g) -----> 2H2O(g) 8. Pada reaksi 5 g bubuk natrium oksida dalam air terbentuk natrium hidroksida dan dibebaskan kalor sebesar 5100 kal. Untuk itu digunakan 50 mL air yang suhunya 25°C. 14. Diketahui: kalor pembakaran C6H12O6 = +2820 kJ.3 g b.5 kJ/mol. Jika kalor pembentukan H2O(l) 68400 kal. Perubahan entalpi reaksi berikut ini yang merupakan perubahan entalpi pembentukan standar ( H°f) adalah: a.2 g d. 36. Kalor pembakaran metanol itu adalah: a. 91. maka banyaknya HCl yang terbentuk pada reaksi tersebut adalah: a. 504 kJ/mol b.4 kkal b. Pada reaksi 10 g logam natrium dalam air terbentuk natrium hidroksida dan hidrogen serta dibebaskan kalor sebesar 18.6 kJ/mol c. dipanaskan selama lima menit hingga suhu akhir 55°C. kalor pembakaran C2H5OH = +1380 kJ. Pada pemanasan air dengan lampu spiritus akan dihitung banyaknya kalor pembakaran metanol (CH3OH). 2H(g) + O(g) ----> H2O(l) d.15 L gas CO2 direaksikan dengan 100 mL Ca(OH)2 0. massa jenis larutan = 1 g/mL dan kalor jenis larutan = 1 kal/g °C.12 kkal c. jika 0. -3 kkal 4. 0. 7.8 kJ/mol 9.kkal/mol.

1 kkal/mol dan kalor pembentukan atom-atom gas C dan H dari unsurunsurnya masing-masing -173. Setelah berapa detik gas Br2 tinggal 8 mol ? a.1 kkal/mol. -24.8 detik c.6 M dt-1 d.5 kkal 12.det. 1.625 detik b.H + H2 ------> CH2-CH2-OH. 0. 37a dan 3a c. laju penguraian A2B2 = 0. pernyataan yang benar adalah: a. 0. -36. Reaksi A + B -----> C mempunyai harga laju reaksi a mol/L .2 M dt-1 b. 1/3 a dan 27a b. Diketahui reaksi CH3. 8. maka pada saat konsentrasi P tinggal 3/4 mol/L. Laju pembentukan NO2 adalah: a. Harga tetapan laju reaksi bertambah tiga kali lipat jika suhu dinaikkan 20°C . a dan c benar c. 27a dan 1/3 a d.3 kkal c.7 kkal d.det 2.0 dan -52. konsentrasi zat hasil reaksi e. maka entalpi pembentukan propana (dalam kkal/mol) adalah: a. -26. tahapan reaksi 3. a dan b benar b.75 x 10 mol/L. 0.25 x 10-5 mol/L. H-H = 104.11. Diketahui reaksi 2NO(g) + Br2(g) --------> 2NOBr(g).8 c.0 detik . konsentrasi A2B2 menjadi 0. Setelah reaksi berlangsung 2 detik. Dalam volume 2 L terdapat 9 mol gas NO dan 12 mol gas Br2.3 kkal/mol. -42.C-.2 M dt-1 6.1 I. 1.det e. Jika reaksi itu berlangsung pada suhu 10°C dan 90°C maka laju reaksinya adalah: a.dt pada suhu 30°C. 0. 1/3 a dan 9a 7. laju pembentukan A = 1. laju penguraian A2B2 = 0. Setelah 5 detik masih ada 5 mol gas NO. dan OH = 110. maka perubahan entalpi reaksi itu adalah: a. b dan c benar c.25 detik d. laju penguraian N2O5 menjadi NO2 dan O2 adalah 0.4.1 e. Jika energi ikatan C=O = 173 kkal/mol. konsentrasi pereaksi e.50 x 10-5 mol/L. laju pembentukan B = 0.9 kkal b.50 x 10-5 mol/L. Pada suhu tertentu. 10.det d. 3/16 k e. a dan b benar b.det -5 c.2 kkal/mol. 1/8 k c.0 detik e. Jika konsentrasi P dan Q mula-mula 1 mol/L. 27/64 k d. Persamaan laju reaksi untuk reaksi P + 2Q --------> R adalah v = k [P][Q]². C-O = 85 kkal/mol. -17. Jika diketahui energi ikatan rata-rata C-H = 99. konsentrasi pereaksi 4. . PILIHLAH SATU JAWABAN YANG PALING TEPAT ! 1. Berikut ini faktor yang akan mempengaruhi laju reaksi yang diberi katalis: a. Konsentrasi A2B2 mula-mula 1 molar.6 M dt-1 c.4 M dt-1 e.50 x 10-5 mol/L. -14. 3a dan 27a e.3 kkal/mol dan energi ikatan ratarata C-C = 83. 1. C-H = 99.1 d.6 kkal/mol. 0. luas permukaan kontak d. Berikut ini faktor yang dapat mempengaruhi laju reaksi pada sistem yang heterogen adalah: a. -32 kkal e. konsentrasi zat hasil reaksi d.det b. -16.4molar.00 x 10-5 mol/L.1 b. 3/8 k 5. laju reaksinya adalah: a. -31. 1/16 k b. Pada reaksi penguraian A2B2 -----> 2A + 2B. laju pembentukan A = 0.

8 0.5 x 10-6 d.01 0.2 x 10-9 9.4 0. Saat 50% gas O2 berubah dan k = 1. Diketahui reaksi S(s) + O2(g) -------> SO2(g) (tahap cepat) 2SO2(g) + O2(g) --------> 2SO3(g) (tahap lambat) Dalam ruang 2 L dimasukkan 0. 320 menit b.25 x 10-7 e.8. H2O2 + I. 0.+ H2O2 ------> H2O + O2 + IZat yang bertindak sebagai katalis dalam reaksi itu adalah: a.48 0. Jika setiap kenaikan 10 C° laju reaksi menjadi dua kali lebih cepat. IO. 1. maka kecepatan reaksinya adalah: a.3 x 10-3.2 detik 10. 6.18. tingkat reaksi total 2. Suatu reaksi pada 15°C berlangsung hingga selesai selama 10 menit. Essay [nilai 2 per soal] 1.24 0.24 0. a dan b benar II.01 0. IOb.5 detik c. Gambarkan sebuah grafik (berikan keterangan seperlunya) laju reaksi endoterm dengan kurva-kurva: a.4 0. rumus kecepatan reaksi itu b. Ic.02 Waktu Reaksi detik 150 75 75 25 Tentukan: a.3 x 10-12 b. Suatu reaksi berlangsung dalam dua tahap berikut: I. pada suhu kamar b. 83.01 0.3 x 10-6 c.2 detik d.24 [H+] awal mol/L 0. pada suhu tinggi c. H2O e. 37. H2O2 d.5 mol belerang dan 0.4 mol gas O2.8 detik e. 28. 3. 8.------> H2O + IOII.8 [Br-] awal mil/L 0. maka reaksi tersebut diperkirakan akan selesai jika suhu dinaikkan menjadi 50°C selama: a. diberi katalis . Dari hasil percobaan diperoleh data sebagai berikut: [BrO3-] awal mol/L 0.

Sign up to vote on this title
UsefulNot useful